Initial commit (Clean history)
This commit is contained in:
211
path/to/venv/lib/python3.12/site-packages/urllib3/__init__.py
Normal file
211
path/to/venv/lib/python3.12/site-packages/urllib3/__init__.py
Normal file
@@ -0,0 +1,211 @@
|
||||
"""
|
||||
Python HTTP library with thread-safe connection pooling, file post support, user friendly, and more
|
||||
"""
|
||||
|
||||
from __future__ import annotations
|
||||
|
||||
# Set default logging handler to avoid "No handler found" warnings.
|
||||
import logging
|
||||
import sys
|
||||
import typing
|
||||
import warnings
|
||||
from logging import NullHandler
|
||||
|
||||
from . import exceptions
|
||||
from ._base_connection import _TYPE_BODY
|
||||
from ._collections import HTTPHeaderDict
|
||||
from ._version import __version__
|
||||
from .connectionpool import HTTPConnectionPool, HTTPSConnectionPool, connection_from_url
|
||||
from .filepost import _TYPE_FIELDS, encode_multipart_formdata
|
||||
from .poolmanager import PoolManager, ProxyManager, proxy_from_url
|
||||
from .response import BaseHTTPResponse, HTTPResponse
|
||||
from .util.request import make_headers
|
||||
from .util.retry import Retry
|
||||
from .util.timeout import Timeout
|
||||
|
||||
# Ensure that Python is compiled with OpenSSL 1.1.1+
|
||||
# If the 'ssl' module isn't available at all that's
|
||||
# fine, we only care if the module is available.
|
||||
try:
|
||||
import ssl
|
||||
except ImportError:
|
||||
pass
|
||||
else:
|
||||
if not ssl.OPENSSL_VERSION.startswith("OpenSSL "): # Defensive:
|
||||
warnings.warn(
|
||||
"urllib3 v2 only supports OpenSSL 1.1.1+, currently "
|
||||
f"the 'ssl' module is compiled with {ssl.OPENSSL_VERSION!r}. "
|
||||
"See: https://github.com/urllib3/urllib3/issues/3020",
|
||||
exceptions.NotOpenSSLWarning,
|
||||
)
|
||||
elif ssl.OPENSSL_VERSION_INFO < (1, 1, 1): # Defensive:
|
||||
raise ImportError(
|
||||
"urllib3 v2 only supports OpenSSL 1.1.1+, currently "
|
||||
f"the 'ssl' module is compiled with {ssl.OPENSSL_VERSION!r}. "
|
||||
"See: https://github.com/urllib3/urllib3/issues/2168"
|
||||
)
|
||||
|
||||
__author__ = "Andrey Petrov (andrey.petrov@shazow.net)"
|
||||
__license__ = "MIT"
|
||||
__version__ = __version__
|
||||
|
||||
__all__ = (
|
||||
"HTTPConnectionPool",
|
||||
"HTTPHeaderDict",
|
||||
"HTTPSConnectionPool",
|
||||
"PoolManager",
|
||||
"ProxyManager",
|
||||
"HTTPResponse",
|
||||
"Retry",
|
||||
"Timeout",
|
||||
"add_stderr_logger",
|
||||
"connection_from_url",
|
||||
"disable_warnings",
|
||||
"encode_multipart_formdata",
|
||||
"make_headers",
|
||||
"proxy_from_url",
|
||||
"request",
|
||||
"BaseHTTPResponse",
|
||||
)
|
||||
|
||||
logging.getLogger(__name__).addHandler(NullHandler())
|
||||
|
||||
|
||||
def add_stderr_logger(
|
||||
level: int = logging.DEBUG,
|
||||
) -> logging.StreamHandler[typing.TextIO]:
|
||||
"""
|
||||
Helper for quickly adding a StreamHandler to the logger. Useful for
|
||||
debugging.
|
||||
|
||||
Returns the handler after adding it.
|
||||
"""
|
||||
# This method needs to be in this __init__.py to get the __name__ correct
|
||||
# even if urllib3 is vendored within another package.
|
||||
logger = logging.getLogger(__name__)
|
||||
handler = logging.StreamHandler()
|
||||
handler.setFormatter(logging.Formatter("%(asctime)s %(levelname)s %(message)s"))
|
||||
logger.addHandler(handler)
|
||||
logger.setLevel(level)
|
||||
logger.debug("Added a stderr logging handler to logger: %s", __name__)
|
||||
return handler
|
||||
|
||||
|
||||
# ... Clean up.
|
||||
del NullHandler
|
||||
|
||||
|
||||
# All warning filters *must* be appended unless you're really certain that they
|
||||
# shouldn't be: otherwise, it's very hard for users to use most Python
|
||||
# mechanisms to silence them.
|
||||
# SecurityWarning's always go off by default.
|
||||
warnings.simplefilter("always", exceptions.SecurityWarning, append=True)
|
||||
# InsecurePlatformWarning's don't vary between requests, so we keep it default.
|
||||
warnings.simplefilter("default", exceptions.InsecurePlatformWarning, append=True)
|
||||
|
||||
|
||||
def disable_warnings(category: type[Warning] = exceptions.HTTPWarning) -> None:
|
||||
"""
|
||||
Helper for quickly disabling all urllib3 warnings.
|
||||
"""
|
||||
warnings.simplefilter("ignore", category)
|
||||
|
||||
|
||||
_DEFAULT_POOL = PoolManager()
|
||||
|
||||
|
||||
def request(
|
||||
method: str,
|
||||
url: str,
|
||||
*,
|
||||
body: _TYPE_BODY | None = None,
|
||||
fields: _TYPE_FIELDS | None = None,
|
||||
headers: typing.Mapping[str, str] | None = None,
|
||||
preload_content: bool | None = True,
|
||||
decode_content: bool | None = True,
|
||||
redirect: bool | None = True,
|
||||
retries: Retry | bool | int | None = None,
|
||||
timeout: Timeout | float | int | None = 3,
|
||||
json: typing.Any | None = None,
|
||||
) -> BaseHTTPResponse:
|
||||
"""
|
||||
A convenience, top-level request method. It uses a module-global ``PoolManager`` instance.
|
||||
Therefore, its side effects could be shared across dependencies relying on it.
|
||||
To avoid side effects create a new ``PoolManager`` instance and use it instead.
|
||||
The method does not accept low-level ``**urlopen_kw`` keyword arguments.
|
||||
|
||||
:param method:
|
||||
HTTP request method (such as GET, POST, PUT, etc.)
|
||||
|
||||
:param url:
|
||||
The URL to perform the request on.
|
||||
|
||||
:param body:
|
||||
Data to send in the request body, either :class:`str`, :class:`bytes`,
|
||||
an iterable of :class:`str`/:class:`bytes`, or a file-like object.
|
||||
|
||||
:param fields:
|
||||
Data to encode and send in the request body.
|
||||
|
||||
:param headers:
|
||||
Dictionary of custom headers to send, such as User-Agent,
|
||||
If-None-Match, etc.
|
||||
|
||||
:param bool preload_content:
|
||||
If True, the response's body will be preloaded into memory.
|
||||
|
||||
:param bool decode_content:
|
||||
If True, will attempt to decode the body based on the
|
||||
'content-encoding' header.
|
||||
|
||||
:param redirect:
|
||||
If True, automatically handle redirects (status codes 301, 302,
|
||||
303, 307, 308). Each redirect counts as a retry. Disabling retries
|
||||
will disable redirect, too.
|
||||
|
||||
:param retries:
|
||||
Configure the number of retries to allow before raising a
|
||||
:class:`~urllib3.exceptions.MaxRetryError` exception.
|
||||
|
||||
If ``None`` (default) will retry 3 times, see ``Retry.DEFAULT``. Pass a
|
||||
:class:`~urllib3.util.retry.Retry` object for fine-grained control
|
||||
over different types of retries.
|
||||
Pass an integer number to retry connection errors that many times,
|
||||
but no other types of errors. Pass zero to never retry.
|
||||
|
||||
If ``False``, then retries are disabled and any exception is raised
|
||||
immediately. Also, instead of raising a MaxRetryError on redirects,
|
||||
the redirect response will be returned.
|
||||
|
||||
:type retries: :class:`~urllib3.util.retry.Retry`, False, or an int.
|
||||
|
||||
:param timeout:
|
||||
If specified, overrides the default timeout for this one
|
||||
request. It may be a float (in seconds) or an instance of
|
||||
:class:`urllib3.util.Timeout`.
|
||||
|
||||
:param json:
|
||||
Data to encode and send as JSON with UTF-encoded in the request body.
|
||||
The ``"Content-Type"`` header will be set to ``"application/json"``
|
||||
unless specified otherwise.
|
||||
"""
|
||||
|
||||
return _DEFAULT_POOL.request(
|
||||
method,
|
||||
url,
|
||||
body=body,
|
||||
fields=fields,
|
||||
headers=headers,
|
||||
preload_content=preload_content,
|
||||
decode_content=decode_content,
|
||||
redirect=redirect,
|
||||
retries=retries,
|
||||
timeout=timeout,
|
||||
json=json,
|
||||
)
|
||||
|
||||
|
||||
if sys.platform == "emscripten":
|
||||
from .contrib.emscripten import inject_into_urllib3 # noqa: 401
|
||||
|
||||
inject_into_urllib3()
|
||||
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
@@ -0,0 +1,165 @@
|
||||
from __future__ import annotations
|
||||
|
||||
import typing
|
||||
|
||||
from .util.connection import _TYPE_SOCKET_OPTIONS
|
||||
from .util.timeout import _DEFAULT_TIMEOUT, _TYPE_TIMEOUT
|
||||
from .util.url import Url
|
||||
|
||||
_TYPE_BODY = typing.Union[bytes, typing.IO[typing.Any], typing.Iterable[bytes], str]
|
||||
|
||||
|
||||
class ProxyConfig(typing.NamedTuple):
|
||||
ssl_context: ssl.SSLContext | None
|
||||
use_forwarding_for_https: bool
|
||||
assert_hostname: None | str | typing.Literal[False]
|
||||
assert_fingerprint: str | None
|
||||
|
||||
|
||||
class _ResponseOptions(typing.NamedTuple):
|
||||
# TODO: Remove this in favor of a better
|
||||
# HTTP request/response lifecycle tracking.
|
||||
request_method: str
|
||||
request_url: str
|
||||
preload_content: bool
|
||||
decode_content: bool
|
||||
enforce_content_length: bool
|
||||
|
||||
|
||||
if typing.TYPE_CHECKING:
|
||||
import ssl
|
||||
from typing import Protocol
|
||||
|
||||
from .response import BaseHTTPResponse
|
||||
|
||||
class BaseHTTPConnection(Protocol):
|
||||
default_port: typing.ClassVar[int]
|
||||
default_socket_options: typing.ClassVar[_TYPE_SOCKET_OPTIONS]
|
||||
|
||||
host: str
|
||||
port: int
|
||||
timeout: None | (
|
||||
float
|
||||
) # Instance doesn't store _DEFAULT_TIMEOUT, must be resolved.
|
||||
blocksize: int
|
||||
source_address: tuple[str, int] | None
|
||||
socket_options: _TYPE_SOCKET_OPTIONS | None
|
||||
|
||||
proxy: Url | None
|
||||
proxy_config: ProxyConfig | None
|
||||
|
||||
is_verified: bool
|
||||
proxy_is_verified: bool | None
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
host: str,
|
||||
port: int | None = None,
|
||||
*,
|
||||
timeout: _TYPE_TIMEOUT = _DEFAULT_TIMEOUT,
|
||||
source_address: tuple[str, int] | None = None,
|
||||
blocksize: int = 8192,
|
||||
socket_options: _TYPE_SOCKET_OPTIONS | None = ...,
|
||||
proxy: Url | None = None,
|
||||
proxy_config: ProxyConfig | None = None,
|
||||
) -> None: ...
|
||||
|
||||
def set_tunnel(
|
||||
self,
|
||||
host: str,
|
||||
port: int | None = None,
|
||||
headers: typing.Mapping[str, str] | None = None,
|
||||
scheme: str = "http",
|
||||
) -> None: ...
|
||||
|
||||
def connect(self) -> None: ...
|
||||
|
||||
def request(
|
||||
self,
|
||||
method: str,
|
||||
url: str,
|
||||
body: _TYPE_BODY | None = None,
|
||||
headers: typing.Mapping[str, str] | None = None,
|
||||
# We know *at least* botocore is depending on the order of the
|
||||
# first 3 parameters so to be safe we only mark the later ones
|
||||
# as keyword-only to ensure we have space to extend.
|
||||
*,
|
||||
chunked: bool = False,
|
||||
preload_content: bool = True,
|
||||
decode_content: bool = True,
|
||||
enforce_content_length: bool = True,
|
||||
) -> None: ...
|
||||
|
||||
def getresponse(self) -> BaseHTTPResponse: ...
|
||||
|
||||
def close(self) -> None: ...
|
||||
|
||||
@property
|
||||
def is_closed(self) -> bool:
|
||||
"""Whether the connection either is brand new or has been previously closed.
|
||||
If this property is True then both ``is_connected`` and ``has_connected_to_proxy``
|
||||
properties must be False.
|
||||
"""
|
||||
|
||||
@property
|
||||
def is_connected(self) -> bool:
|
||||
"""Whether the connection is actively connected to any origin (proxy or target)"""
|
||||
|
||||
@property
|
||||
def has_connected_to_proxy(self) -> bool:
|
||||
"""Whether the connection has successfully connected to its proxy.
|
||||
This returns False if no proxy is in use. Used to determine whether
|
||||
errors are coming from the proxy layer or from tunnelling to the target origin.
|
||||
"""
|
||||
|
||||
class BaseHTTPSConnection(BaseHTTPConnection, Protocol):
|
||||
default_port: typing.ClassVar[int]
|
||||
default_socket_options: typing.ClassVar[_TYPE_SOCKET_OPTIONS]
|
||||
|
||||
# Certificate verification methods
|
||||
cert_reqs: int | str | None
|
||||
assert_hostname: None | str | typing.Literal[False]
|
||||
assert_fingerprint: str | None
|
||||
ssl_context: ssl.SSLContext | None
|
||||
|
||||
# Trusted CAs
|
||||
ca_certs: str | None
|
||||
ca_cert_dir: str | None
|
||||
ca_cert_data: None | str | bytes
|
||||
|
||||
# TLS version
|
||||
ssl_minimum_version: int | None
|
||||
ssl_maximum_version: int | None
|
||||
ssl_version: int | str | None # Deprecated
|
||||
|
||||
# Client certificates
|
||||
cert_file: str | None
|
||||
key_file: str | None
|
||||
key_password: str | None
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
host: str,
|
||||
port: int | None = None,
|
||||
*,
|
||||
timeout: _TYPE_TIMEOUT = _DEFAULT_TIMEOUT,
|
||||
source_address: tuple[str, int] | None = None,
|
||||
blocksize: int = 16384,
|
||||
socket_options: _TYPE_SOCKET_OPTIONS | None = ...,
|
||||
proxy: Url | None = None,
|
||||
proxy_config: ProxyConfig | None = None,
|
||||
cert_reqs: int | str | None = None,
|
||||
assert_hostname: None | str | typing.Literal[False] = None,
|
||||
assert_fingerprint: str | None = None,
|
||||
server_hostname: str | None = None,
|
||||
ssl_context: ssl.SSLContext | None = None,
|
||||
ca_certs: str | None = None,
|
||||
ca_cert_dir: str | None = None,
|
||||
ca_cert_data: None | str | bytes = None,
|
||||
ssl_minimum_version: int | None = None,
|
||||
ssl_maximum_version: int | None = None,
|
||||
ssl_version: int | str | None = None, # Deprecated
|
||||
cert_file: str | None = None,
|
||||
key_file: str | None = None,
|
||||
key_password: str | None = None,
|
||||
) -> None: ...
|
||||
@@ -0,0 +1,487 @@
|
||||
from __future__ import annotations
|
||||
|
||||
import typing
|
||||
from collections import OrderedDict
|
||||
from enum import Enum, auto
|
||||
from threading import RLock
|
||||
|
||||
if typing.TYPE_CHECKING:
|
||||
# We can only import Protocol if TYPE_CHECKING because it's a development
|
||||
# dependency, and is not available at runtime.
|
||||
from typing import Protocol
|
||||
|
||||
from typing_extensions import Self
|
||||
|
||||
class HasGettableStringKeys(Protocol):
|
||||
def keys(self) -> typing.Iterator[str]: ...
|
||||
|
||||
def __getitem__(self, key: str) -> str: ...
|
||||
|
||||
|
||||
__all__ = ["RecentlyUsedContainer", "HTTPHeaderDict"]
|
||||
|
||||
|
||||
# Key type
|
||||
_KT = typing.TypeVar("_KT")
|
||||
# Value type
|
||||
_VT = typing.TypeVar("_VT")
|
||||
# Default type
|
||||
_DT = typing.TypeVar("_DT")
|
||||
|
||||
ValidHTTPHeaderSource = typing.Union[
|
||||
"HTTPHeaderDict",
|
||||
typing.Mapping[str, str],
|
||||
typing.Iterable[tuple[str, str]],
|
||||
"HasGettableStringKeys",
|
||||
]
|
||||
|
||||
|
||||
class _Sentinel(Enum):
|
||||
not_passed = auto()
|
||||
|
||||
|
||||
def ensure_can_construct_http_header_dict(
|
||||
potential: object,
|
||||
) -> ValidHTTPHeaderSource | None:
|
||||
if isinstance(potential, HTTPHeaderDict):
|
||||
return potential
|
||||
elif isinstance(potential, typing.Mapping):
|
||||
# Full runtime checking of the contents of a Mapping is expensive, so for the
|
||||
# purposes of typechecking, we assume that any Mapping is the right shape.
|
||||
return typing.cast(typing.Mapping[str, str], potential)
|
||||
elif isinstance(potential, typing.Iterable):
|
||||
# Similarly to Mapping, full runtime checking of the contents of an Iterable is
|
||||
# expensive, so for the purposes of typechecking, we assume that any Iterable
|
||||
# is the right shape.
|
||||
return typing.cast(typing.Iterable[tuple[str, str]], potential)
|
||||
elif hasattr(potential, "keys") and hasattr(potential, "__getitem__"):
|
||||
return typing.cast("HasGettableStringKeys", potential)
|
||||
else:
|
||||
return None
|
||||
|
||||
|
||||
class RecentlyUsedContainer(typing.Generic[_KT, _VT], typing.MutableMapping[_KT, _VT]):
|
||||
"""
|
||||
Provides a thread-safe dict-like container which maintains up to
|
||||
``maxsize`` keys while throwing away the least-recently-used keys beyond
|
||||
``maxsize``.
|
||||
|
||||
:param maxsize:
|
||||
Maximum number of recent elements to retain.
|
||||
|
||||
:param dispose_func:
|
||||
Every time an item is evicted from the container,
|
||||
``dispose_func(value)`` is called. Callback which will get called
|
||||
"""
|
||||
|
||||
_container: typing.OrderedDict[_KT, _VT]
|
||||
_maxsize: int
|
||||
dispose_func: typing.Callable[[_VT], None] | None
|
||||
lock: RLock
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
maxsize: int = 10,
|
||||
dispose_func: typing.Callable[[_VT], None] | None = None,
|
||||
) -> None:
|
||||
super().__init__()
|
||||
self._maxsize = maxsize
|
||||
self.dispose_func = dispose_func
|
||||
self._container = OrderedDict()
|
||||
self.lock = RLock()
|
||||
|
||||
def __getitem__(self, key: _KT) -> _VT:
|
||||
# Re-insert the item, moving it to the end of the eviction line.
|
||||
with self.lock:
|
||||
item = self._container.pop(key)
|
||||
self._container[key] = item
|
||||
return item
|
||||
|
||||
def __setitem__(self, key: _KT, value: _VT) -> None:
|
||||
evicted_item = None
|
||||
with self.lock:
|
||||
# Possibly evict the existing value of 'key'
|
||||
try:
|
||||
# If the key exists, we'll overwrite it, which won't change the
|
||||
# size of the pool. Because accessing a key should move it to
|
||||
# the end of the eviction line, we pop it out first.
|
||||
evicted_item = key, self._container.pop(key)
|
||||
self._container[key] = value
|
||||
except KeyError:
|
||||
# When the key does not exist, we insert the value first so that
|
||||
# evicting works in all cases, including when self._maxsize is 0
|
||||
self._container[key] = value
|
||||
if len(self._container) > self._maxsize:
|
||||
# If we didn't evict an existing value, and we've hit our maximum
|
||||
# size, then we have to evict the least recently used item from
|
||||
# the beginning of the container.
|
||||
evicted_item = self._container.popitem(last=False)
|
||||
|
||||
# After releasing the lock on the pool, dispose of any evicted value.
|
||||
if evicted_item is not None and self.dispose_func:
|
||||
_, evicted_value = evicted_item
|
||||
self.dispose_func(evicted_value)
|
||||
|
||||
def __delitem__(self, key: _KT) -> None:
|
||||
with self.lock:
|
||||
value = self._container.pop(key)
|
||||
|
||||
if self.dispose_func:
|
||||
self.dispose_func(value)
|
||||
|
||||
def __len__(self) -> int:
|
||||
with self.lock:
|
||||
return len(self._container)
|
||||
|
||||
def __iter__(self) -> typing.NoReturn:
|
||||
raise NotImplementedError(
|
||||
"Iteration over this class is unlikely to be threadsafe."
|
||||
)
|
||||
|
||||
def clear(self) -> None:
|
||||
with self.lock:
|
||||
# Copy pointers to all values, then wipe the mapping
|
||||
values = list(self._container.values())
|
||||
self._container.clear()
|
||||
|
||||
if self.dispose_func:
|
||||
for value in values:
|
||||
self.dispose_func(value)
|
||||
|
||||
def keys(self) -> set[_KT]: # type: ignore[override]
|
||||
with self.lock:
|
||||
return set(self._container.keys())
|
||||
|
||||
|
||||
class HTTPHeaderDictItemView(set[tuple[str, str]]):
|
||||
"""
|
||||
HTTPHeaderDict is unusual for a Mapping[str, str] in that it has two modes of
|
||||
address.
|
||||
|
||||
If we directly try to get an item with a particular name, we will get a string
|
||||
back that is the concatenated version of all the values:
|
||||
|
||||
>>> d['X-Header-Name']
|
||||
'Value1, Value2, Value3'
|
||||
|
||||
However, if we iterate over an HTTPHeaderDict's items, we will optionally combine
|
||||
these values based on whether combine=True was called when building up the dictionary
|
||||
|
||||
>>> d = HTTPHeaderDict({"A": "1", "B": "foo"})
|
||||
>>> d.add("A", "2", combine=True)
|
||||
>>> d.add("B", "bar")
|
||||
>>> list(d.items())
|
||||
[
|
||||
('A', '1, 2'),
|
||||
('B', 'foo'),
|
||||
('B', 'bar'),
|
||||
]
|
||||
|
||||
This class conforms to the interface required by the MutableMapping ABC while
|
||||
also giving us the nonstandard iteration behavior we want; items with duplicate
|
||||
keys, ordered by time of first insertion.
|
||||
"""
|
||||
|
||||
_headers: HTTPHeaderDict
|
||||
|
||||
def __init__(self, headers: HTTPHeaderDict) -> None:
|
||||
self._headers = headers
|
||||
|
||||
def __len__(self) -> int:
|
||||
return len(list(self._headers.iteritems()))
|
||||
|
||||
def __iter__(self) -> typing.Iterator[tuple[str, str]]:
|
||||
return self._headers.iteritems()
|
||||
|
||||
def __contains__(self, item: object) -> bool:
|
||||
if isinstance(item, tuple) and len(item) == 2:
|
||||
passed_key, passed_val = item
|
||||
if isinstance(passed_key, str) and isinstance(passed_val, str):
|
||||
return self._headers._has_value_for_header(passed_key, passed_val)
|
||||
return False
|
||||
|
||||
|
||||
class HTTPHeaderDict(typing.MutableMapping[str, str]):
|
||||
"""
|
||||
:param headers:
|
||||
An iterable of field-value pairs. Must not contain multiple field names
|
||||
when compared case-insensitively.
|
||||
|
||||
:param kwargs:
|
||||
Additional field-value pairs to pass in to ``dict.update``.
|
||||
|
||||
A ``dict`` like container for storing HTTP Headers.
|
||||
|
||||
Field names are stored and compared case-insensitively in compliance with
|
||||
RFC 7230. Iteration provides the first case-sensitive key seen for each
|
||||
case-insensitive pair.
|
||||
|
||||
Using ``__setitem__`` syntax overwrites fields that compare equal
|
||||
case-insensitively in order to maintain ``dict``'s api. For fields that
|
||||
compare equal, instead create a new ``HTTPHeaderDict`` and use ``.add``
|
||||
in a loop.
|
||||
|
||||
If multiple fields that are equal case-insensitively are passed to the
|
||||
constructor or ``.update``, the behavior is undefined and some will be
|
||||
lost.
|
||||
|
||||
>>> headers = HTTPHeaderDict()
|
||||
>>> headers.add('Set-Cookie', 'foo=bar')
|
||||
>>> headers.add('set-cookie', 'baz=quxx')
|
||||
>>> headers['content-length'] = '7'
|
||||
>>> headers['SET-cookie']
|
||||
'foo=bar, baz=quxx'
|
||||
>>> headers['Content-Length']
|
||||
'7'
|
||||
"""
|
||||
|
||||
_container: typing.MutableMapping[str, list[str]]
|
||||
|
||||
def __init__(self, headers: ValidHTTPHeaderSource | None = None, **kwargs: str):
|
||||
super().__init__()
|
||||
self._container = {} # 'dict' is insert-ordered
|
||||
if headers is not None:
|
||||
if isinstance(headers, HTTPHeaderDict):
|
||||
self._copy_from(headers)
|
||||
else:
|
||||
self.extend(headers)
|
||||
if kwargs:
|
||||
self.extend(kwargs)
|
||||
|
||||
def __setitem__(self, key: str, val: str) -> None:
|
||||
# avoid a bytes/str comparison by decoding before httplib
|
||||
if isinstance(key, bytes):
|
||||
key = key.decode("latin-1")
|
||||
self._container[key.lower()] = [key, val]
|
||||
|
||||
def __getitem__(self, key: str) -> str:
|
||||
if isinstance(key, bytes):
|
||||
key = key.decode("latin-1")
|
||||
val = self._container[key.lower()]
|
||||
return ", ".join(val[1:])
|
||||
|
||||
def __delitem__(self, key: str) -> None:
|
||||
if isinstance(key, bytes):
|
||||
key = key.decode("latin-1")
|
||||
del self._container[key.lower()]
|
||||
|
||||
def __contains__(self, key: object) -> bool:
|
||||
if isinstance(key, bytes):
|
||||
key = key.decode("latin-1")
|
||||
if isinstance(key, str):
|
||||
return key.lower() in self._container
|
||||
return False
|
||||
|
||||
def setdefault(self, key: str, default: str = "") -> str:
|
||||
return super().setdefault(key, default)
|
||||
|
||||
def __eq__(self, other: object) -> bool:
|
||||
maybe_constructable = ensure_can_construct_http_header_dict(other)
|
||||
if maybe_constructable is None:
|
||||
return False
|
||||
else:
|
||||
other_as_http_header_dict = type(self)(maybe_constructable)
|
||||
|
||||
return {k.lower(): v for k, v in self.itermerged()} == {
|
||||
k.lower(): v for k, v in other_as_http_header_dict.itermerged()
|
||||
}
|
||||
|
||||
def __ne__(self, other: object) -> bool:
|
||||
return not self.__eq__(other)
|
||||
|
||||
def __len__(self) -> int:
|
||||
return len(self._container)
|
||||
|
||||
def __iter__(self) -> typing.Iterator[str]:
|
||||
# Only provide the originally cased names
|
||||
for vals in self._container.values():
|
||||
yield vals[0]
|
||||
|
||||
def discard(self, key: str) -> None:
|
||||
try:
|
||||
del self[key]
|
||||
except KeyError:
|
||||
pass
|
||||
|
||||
def add(self, key: str, val: str, *, combine: bool = False) -> None:
|
||||
"""Adds a (name, value) pair, doesn't overwrite the value if it already
|
||||
exists.
|
||||
|
||||
If this is called with combine=True, instead of adding a new header value
|
||||
as a distinct item during iteration, this will instead append the value to
|
||||
any existing header value with a comma. If no existing header value exists
|
||||
for the key, then the value will simply be added, ignoring the combine parameter.
|
||||
|
||||
>>> headers = HTTPHeaderDict(foo='bar')
|
||||
>>> headers.add('Foo', 'baz')
|
||||
>>> headers['foo']
|
||||
'bar, baz'
|
||||
>>> list(headers.items())
|
||||
[('foo', 'bar'), ('foo', 'baz')]
|
||||
>>> headers.add('foo', 'quz', combine=True)
|
||||
>>> list(headers.items())
|
||||
[('foo', 'bar, baz, quz')]
|
||||
"""
|
||||
# avoid a bytes/str comparison by decoding before httplib
|
||||
if isinstance(key, bytes):
|
||||
key = key.decode("latin-1")
|
||||
key_lower = key.lower()
|
||||
new_vals = [key, val]
|
||||
# Keep the common case aka no item present as fast as possible
|
||||
vals = self._container.setdefault(key_lower, new_vals)
|
||||
if new_vals is not vals:
|
||||
# if there are values here, then there is at least the initial
|
||||
# key/value pair
|
||||
assert len(vals) >= 2
|
||||
if combine:
|
||||
vals[-1] = vals[-1] + ", " + val
|
||||
else:
|
||||
vals.append(val)
|
||||
|
||||
def extend(self, *args: ValidHTTPHeaderSource, **kwargs: str) -> None:
|
||||
"""Generic import function for any type of header-like object.
|
||||
Adapted version of MutableMapping.update in order to insert items
|
||||
with self.add instead of self.__setitem__
|
||||
"""
|
||||
if len(args) > 1:
|
||||
raise TypeError(
|
||||
f"extend() takes at most 1 positional arguments ({len(args)} given)"
|
||||
)
|
||||
other = args[0] if len(args) >= 1 else ()
|
||||
|
||||
if isinstance(other, HTTPHeaderDict):
|
||||
for key, val in other.iteritems():
|
||||
self.add(key, val)
|
||||
elif isinstance(other, typing.Mapping):
|
||||
for key, val in other.items():
|
||||
self.add(key, val)
|
||||
elif isinstance(other, typing.Iterable):
|
||||
other = typing.cast(typing.Iterable[tuple[str, str]], other)
|
||||
for key, value in other:
|
||||
self.add(key, value)
|
||||
elif hasattr(other, "keys") and hasattr(other, "__getitem__"):
|
||||
# THIS IS NOT A TYPESAFE BRANCH
|
||||
# In this branch, the object has a `keys` attr but is not a Mapping or any of
|
||||
# the other types indicated in the method signature. We do some stuff with
|
||||
# it as though it partially implements the Mapping interface, but we're not
|
||||
# doing that stuff safely AT ALL.
|
||||
for key in other.keys():
|
||||
self.add(key, other[key])
|
||||
|
||||
for key, value in kwargs.items():
|
||||
self.add(key, value)
|
||||
|
||||
@typing.overload
|
||||
def getlist(self, key: str) -> list[str]: ...
|
||||
|
||||
@typing.overload
|
||||
def getlist(self, key: str, default: _DT) -> list[str] | _DT: ...
|
||||
|
||||
def getlist(
|
||||
self, key: str, default: _Sentinel | _DT = _Sentinel.not_passed
|
||||
) -> list[str] | _DT:
|
||||
"""Returns a list of all the values for the named field. Returns an
|
||||
empty list if the key doesn't exist."""
|
||||
if isinstance(key, bytes):
|
||||
key = key.decode("latin-1")
|
||||
try:
|
||||
vals = self._container[key.lower()]
|
||||
except KeyError:
|
||||
if default is _Sentinel.not_passed:
|
||||
# _DT is unbound; empty list is instance of List[str]
|
||||
return []
|
||||
# _DT is bound; default is instance of _DT
|
||||
return default
|
||||
else:
|
||||
# _DT may or may not be bound; vals[1:] is instance of List[str], which
|
||||
# meets our external interface requirement of `Union[List[str], _DT]`.
|
||||
return vals[1:]
|
||||
|
||||
def _prepare_for_method_change(self) -> Self:
|
||||
"""
|
||||
Remove content-specific header fields before changing the request
|
||||
method to GET or HEAD according to RFC 9110, Section 15.4.
|
||||
"""
|
||||
content_specific_headers = [
|
||||
"Content-Encoding",
|
||||
"Content-Language",
|
||||
"Content-Location",
|
||||
"Content-Type",
|
||||
"Content-Length",
|
||||
"Digest",
|
||||
"Last-Modified",
|
||||
]
|
||||
for header in content_specific_headers:
|
||||
self.discard(header)
|
||||
return self
|
||||
|
||||
# Backwards compatibility for httplib
|
||||
getheaders = getlist
|
||||
getallmatchingheaders = getlist
|
||||
iget = getlist
|
||||
|
||||
# Backwards compatibility for http.cookiejar
|
||||
get_all = getlist
|
||||
|
||||
def __repr__(self) -> str:
|
||||
return f"{type(self).__name__}({dict(self.itermerged())})"
|
||||
|
||||
def _copy_from(self, other: HTTPHeaderDict) -> None:
|
||||
for key in other:
|
||||
val = other.getlist(key)
|
||||
self._container[key.lower()] = [key, *val]
|
||||
|
||||
def copy(self) -> Self:
|
||||
clone = type(self)()
|
||||
clone._copy_from(self)
|
||||
return clone
|
||||
|
||||
def iteritems(self) -> typing.Iterator[tuple[str, str]]:
|
||||
"""Iterate over all header lines, including duplicate ones."""
|
||||
for key in self:
|
||||
vals = self._container[key.lower()]
|
||||
for val in vals[1:]:
|
||||
yield vals[0], val
|
||||
|
||||
def itermerged(self) -> typing.Iterator[tuple[str, str]]:
|
||||
"""Iterate over all headers, merging duplicate ones together."""
|
||||
for key in self:
|
||||
val = self._container[key.lower()]
|
||||
yield val[0], ", ".join(val[1:])
|
||||
|
||||
def items(self) -> HTTPHeaderDictItemView: # type: ignore[override]
|
||||
return HTTPHeaderDictItemView(self)
|
||||
|
||||
def _has_value_for_header(self, header_name: str, potential_value: str) -> bool:
|
||||
if header_name in self:
|
||||
return potential_value in self._container[header_name.lower()][1:]
|
||||
return False
|
||||
|
||||
def __ior__(self, other: object) -> HTTPHeaderDict:
|
||||
# Supports extending a header dict in-place using operator |=
|
||||
# combining items with add instead of __setitem__
|
||||
maybe_constructable = ensure_can_construct_http_header_dict(other)
|
||||
if maybe_constructable is None:
|
||||
return NotImplemented
|
||||
self.extend(maybe_constructable)
|
||||
return self
|
||||
|
||||
def __or__(self, other: object) -> Self:
|
||||
# Supports merging header dicts using operator |
|
||||
# combining items with add instead of __setitem__
|
||||
maybe_constructable = ensure_can_construct_http_header_dict(other)
|
||||
if maybe_constructable is None:
|
||||
return NotImplemented
|
||||
result = self.copy()
|
||||
result.extend(maybe_constructable)
|
||||
return result
|
||||
|
||||
def __ror__(self, other: object) -> Self:
|
||||
# Supports merging header dicts using operator | when other is on left side
|
||||
# combining items with add instead of __setitem__
|
||||
maybe_constructable = ensure_can_construct_http_header_dict(other)
|
||||
if maybe_constructable is None:
|
||||
return NotImplemented
|
||||
result = type(self)(maybe_constructable)
|
||||
result.extend(self)
|
||||
return result
|
||||
@@ -0,0 +1,278 @@
|
||||
from __future__ import annotations
|
||||
|
||||
import json as _json
|
||||
import typing
|
||||
from urllib.parse import urlencode
|
||||
|
||||
from ._base_connection import _TYPE_BODY
|
||||
from ._collections import HTTPHeaderDict
|
||||
from .filepost import _TYPE_FIELDS, encode_multipart_formdata
|
||||
from .response import BaseHTTPResponse
|
||||
|
||||
__all__ = ["RequestMethods"]
|
||||
|
||||
_TYPE_ENCODE_URL_FIELDS = typing.Union[
|
||||
typing.Sequence[tuple[str, typing.Union[str, bytes]]],
|
||||
typing.Mapping[str, typing.Union[str, bytes]],
|
||||
]
|
||||
|
||||
|
||||
class RequestMethods:
|
||||
"""
|
||||
Convenience mixin for classes who implement a :meth:`urlopen` method, such
|
||||
as :class:`urllib3.HTTPConnectionPool` and
|
||||
:class:`urllib3.PoolManager`.
|
||||
|
||||
Provides behavior for making common types of HTTP request methods and
|
||||
decides which type of request field encoding to use.
|
||||
|
||||
Specifically,
|
||||
|
||||
:meth:`.request_encode_url` is for sending requests whose fields are
|
||||
encoded in the URL (such as GET, HEAD, DELETE).
|
||||
|
||||
:meth:`.request_encode_body` is for sending requests whose fields are
|
||||
encoded in the *body* of the request using multipart or www-form-urlencoded
|
||||
(such as for POST, PUT, PATCH).
|
||||
|
||||
:meth:`.request` is for making any kind of request, it will look up the
|
||||
appropriate encoding format and use one of the above two methods to make
|
||||
the request.
|
||||
|
||||
Initializer parameters:
|
||||
|
||||
:param headers:
|
||||
Headers to include with all requests, unless other headers are given
|
||||
explicitly.
|
||||
"""
|
||||
|
||||
_encode_url_methods = {"DELETE", "GET", "HEAD", "OPTIONS"}
|
||||
|
||||
def __init__(self, headers: typing.Mapping[str, str] | None = None) -> None:
|
||||
self.headers = headers or {}
|
||||
|
||||
def urlopen(
|
||||
self,
|
||||
method: str,
|
||||
url: str,
|
||||
body: _TYPE_BODY | None = None,
|
||||
headers: typing.Mapping[str, str] | None = None,
|
||||
encode_multipart: bool = True,
|
||||
multipart_boundary: str | None = None,
|
||||
**kw: typing.Any,
|
||||
) -> BaseHTTPResponse: # Abstract
|
||||
raise NotImplementedError(
|
||||
"Classes extending RequestMethods must implement "
|
||||
"their own ``urlopen`` method."
|
||||
)
|
||||
|
||||
def request(
|
||||
self,
|
||||
method: str,
|
||||
url: str,
|
||||
body: _TYPE_BODY | None = None,
|
||||
fields: _TYPE_FIELDS | None = None,
|
||||
headers: typing.Mapping[str, str] | None = None,
|
||||
json: typing.Any | None = None,
|
||||
**urlopen_kw: typing.Any,
|
||||
) -> BaseHTTPResponse:
|
||||
"""
|
||||
Make a request using :meth:`urlopen` with the appropriate encoding of
|
||||
``fields`` based on the ``method`` used.
|
||||
|
||||
This is a convenience method that requires the least amount of manual
|
||||
effort. It can be used in most situations, while still having the
|
||||
option to drop down to more specific methods when necessary, such as
|
||||
:meth:`request_encode_url`, :meth:`request_encode_body`,
|
||||
or even the lowest level :meth:`urlopen`.
|
||||
|
||||
:param method:
|
||||
HTTP request method (such as GET, POST, PUT, etc.)
|
||||
|
||||
:param url:
|
||||
The URL to perform the request on.
|
||||
|
||||
:param body:
|
||||
Data to send in the request body, either :class:`str`, :class:`bytes`,
|
||||
an iterable of :class:`str`/:class:`bytes`, or a file-like object.
|
||||
|
||||
:param fields:
|
||||
Data to encode and send in the URL or request body, depending on ``method``.
|
||||
|
||||
:param headers:
|
||||
Dictionary of custom headers to send, such as User-Agent,
|
||||
If-None-Match, etc. If None, pool headers are used. If provided,
|
||||
these headers completely replace any pool-specific headers.
|
||||
|
||||
:param json:
|
||||
Data to encode and send as JSON with UTF-encoded in the request body.
|
||||
The ``"Content-Type"`` header will be set to ``"application/json"``
|
||||
unless specified otherwise.
|
||||
"""
|
||||
method = method.upper()
|
||||
|
||||
if json is not None and body is not None:
|
||||
raise TypeError(
|
||||
"request got values for both 'body' and 'json' parameters which are mutually exclusive"
|
||||
)
|
||||
|
||||
if json is not None:
|
||||
if headers is None:
|
||||
headers = self.headers
|
||||
|
||||
if not ("content-type" in map(str.lower, headers.keys())):
|
||||
headers = HTTPHeaderDict(headers)
|
||||
headers["Content-Type"] = "application/json"
|
||||
|
||||
body = _json.dumps(json, separators=(",", ":"), ensure_ascii=False).encode(
|
||||
"utf-8"
|
||||
)
|
||||
|
||||
if body is not None:
|
||||
urlopen_kw["body"] = body
|
||||
|
||||
if method in self._encode_url_methods:
|
||||
return self.request_encode_url(
|
||||
method,
|
||||
url,
|
||||
fields=fields, # type: ignore[arg-type]
|
||||
headers=headers,
|
||||
**urlopen_kw,
|
||||
)
|
||||
else:
|
||||
return self.request_encode_body(
|
||||
method, url, fields=fields, headers=headers, **urlopen_kw
|
||||
)
|
||||
|
||||
def request_encode_url(
|
||||
self,
|
||||
method: str,
|
||||
url: str,
|
||||
fields: _TYPE_ENCODE_URL_FIELDS | None = None,
|
||||
headers: typing.Mapping[str, str] | None = None,
|
||||
**urlopen_kw: str,
|
||||
) -> BaseHTTPResponse:
|
||||
"""
|
||||
Make a request using :meth:`urlopen` with the ``fields`` encoded in
|
||||
the url. This is useful for request methods like GET, HEAD, DELETE, etc.
|
||||
|
||||
:param method:
|
||||
HTTP request method (such as GET, POST, PUT, etc.)
|
||||
|
||||
:param url:
|
||||
The URL to perform the request on.
|
||||
|
||||
:param fields:
|
||||
Data to encode and send in the URL.
|
||||
|
||||
:param headers:
|
||||
Dictionary of custom headers to send, such as User-Agent,
|
||||
If-None-Match, etc. If None, pool headers are used. If provided,
|
||||
these headers completely replace any pool-specific headers.
|
||||
"""
|
||||
if headers is None:
|
||||
headers = self.headers
|
||||
|
||||
extra_kw: dict[str, typing.Any] = {"headers": headers}
|
||||
extra_kw.update(urlopen_kw)
|
||||
|
||||
if fields:
|
||||
url += "?" + urlencode(fields)
|
||||
|
||||
return self.urlopen(method, url, **extra_kw)
|
||||
|
||||
def request_encode_body(
|
||||
self,
|
||||
method: str,
|
||||
url: str,
|
||||
fields: _TYPE_FIELDS | None = None,
|
||||
headers: typing.Mapping[str, str] | None = None,
|
||||
encode_multipart: bool = True,
|
||||
multipart_boundary: str | None = None,
|
||||
**urlopen_kw: str,
|
||||
) -> BaseHTTPResponse:
|
||||
"""
|
||||
Make a request using :meth:`urlopen` with the ``fields`` encoded in
|
||||
the body. This is useful for request methods like POST, PUT, PATCH, etc.
|
||||
|
||||
When ``encode_multipart=True`` (default), then
|
||||
:func:`urllib3.encode_multipart_formdata` is used to encode
|
||||
the payload with the appropriate content type. Otherwise
|
||||
:func:`urllib.parse.urlencode` is used with the
|
||||
'application/x-www-form-urlencoded' content type.
|
||||
|
||||
Multipart encoding must be used when posting files, and it's reasonably
|
||||
safe to use it in other times too. However, it may break request
|
||||
signing, such as with OAuth.
|
||||
|
||||
Supports an optional ``fields`` parameter of key/value strings AND
|
||||
key/filetuple. A filetuple is a (filename, data, MIME type) tuple where
|
||||
the MIME type is optional. For example::
|
||||
|
||||
fields = {
|
||||
'foo': 'bar',
|
||||
'fakefile': ('foofile.txt', 'contents of foofile'),
|
||||
'realfile': ('barfile.txt', open('realfile').read()),
|
||||
'typedfile': ('bazfile.bin', open('bazfile').read(),
|
||||
'image/jpeg'),
|
||||
'nonamefile': 'contents of nonamefile field',
|
||||
}
|
||||
|
||||
When uploading a file, providing a filename (the first parameter of the
|
||||
tuple) is optional but recommended to best mimic behavior of browsers.
|
||||
|
||||
Note that if ``headers`` are supplied, the 'Content-Type' header will
|
||||
be overwritten because it depends on the dynamic random boundary string
|
||||
which is used to compose the body of the request. The random boundary
|
||||
string can be explicitly set with the ``multipart_boundary`` parameter.
|
||||
|
||||
:param method:
|
||||
HTTP request method (such as GET, POST, PUT, etc.)
|
||||
|
||||
:param url:
|
||||
The URL to perform the request on.
|
||||
|
||||
:param fields:
|
||||
Data to encode and send in the request body.
|
||||
|
||||
:param headers:
|
||||
Dictionary of custom headers to send, such as User-Agent,
|
||||
If-None-Match, etc. If None, pool headers are used. If provided,
|
||||
these headers completely replace any pool-specific headers.
|
||||
|
||||
:param encode_multipart:
|
||||
If True, encode the ``fields`` using the multipart/form-data MIME
|
||||
format.
|
||||
|
||||
:param multipart_boundary:
|
||||
If not specified, then a random boundary will be generated using
|
||||
:func:`urllib3.filepost.choose_boundary`.
|
||||
"""
|
||||
if headers is None:
|
||||
headers = self.headers
|
||||
|
||||
extra_kw: dict[str, typing.Any] = {"headers": HTTPHeaderDict(headers)}
|
||||
body: bytes | str
|
||||
|
||||
if fields:
|
||||
if "body" in urlopen_kw:
|
||||
raise TypeError(
|
||||
"request got values for both 'fields' and 'body', can only specify one."
|
||||
)
|
||||
|
||||
if encode_multipart:
|
||||
body, content_type = encode_multipart_formdata(
|
||||
fields, boundary=multipart_boundary
|
||||
)
|
||||
else:
|
||||
body, content_type = (
|
||||
urlencode(fields), # type: ignore[arg-type]
|
||||
"application/x-www-form-urlencoded",
|
||||
)
|
||||
|
||||
extra_kw["body"] = body
|
||||
extra_kw["headers"].setdefault("Content-Type", content_type)
|
||||
|
||||
extra_kw.update(urlopen_kw)
|
||||
|
||||
return self.urlopen(method, url, **extra_kw)
|
||||
@@ -0,0 +1,34 @@
|
||||
# file generated by setuptools-scm
|
||||
# don't change, don't track in version control
|
||||
|
||||
__all__ = [
|
||||
"__version__",
|
||||
"__version_tuple__",
|
||||
"version",
|
||||
"version_tuple",
|
||||
"__commit_id__",
|
||||
"commit_id",
|
||||
]
|
||||
|
||||
TYPE_CHECKING = False
|
||||
if TYPE_CHECKING:
|
||||
from typing import Tuple
|
||||
from typing import Union
|
||||
|
||||
VERSION_TUPLE = Tuple[Union[int, str], ...]
|
||||
COMMIT_ID = Union[str, None]
|
||||
else:
|
||||
VERSION_TUPLE = object
|
||||
COMMIT_ID = object
|
||||
|
||||
version: str
|
||||
__version__: str
|
||||
__version_tuple__: VERSION_TUPLE
|
||||
version_tuple: VERSION_TUPLE
|
||||
commit_id: COMMIT_ID
|
||||
__commit_id__: COMMIT_ID
|
||||
|
||||
__version__ = version = '2.6.1'
|
||||
__version_tuple__ = version_tuple = (2, 6, 1)
|
||||
|
||||
__commit_id__ = commit_id = None
|
||||
1099
path/to/venv/lib/python3.12/site-packages/urllib3/connection.py
Normal file
1099
path/to/venv/lib/python3.12/site-packages/urllib3/connection.py
Normal file
File diff suppressed because it is too large
Load Diff
1178
path/to/venv/lib/python3.12/site-packages/urllib3/connectionpool.py
Normal file
1178
path/to/venv/lib/python3.12/site-packages/urllib3/connectionpool.py
Normal file
File diff suppressed because it is too large
Load Diff
Binary file not shown.
Binary file not shown.
Binary file not shown.
@@ -0,0 +1,16 @@
|
||||
from __future__ import annotations
|
||||
|
||||
import urllib3.connection
|
||||
|
||||
from ...connectionpool import HTTPConnectionPool, HTTPSConnectionPool
|
||||
from .connection import EmscriptenHTTPConnection, EmscriptenHTTPSConnection
|
||||
|
||||
|
||||
def inject_into_urllib3() -> None:
|
||||
# override connection classes to use emscripten specific classes
|
||||
# n.b. mypy complains about the overriding of classes below
|
||||
# if it isn't ignored
|
||||
HTTPConnectionPool.ConnectionCls = EmscriptenHTTPConnection
|
||||
HTTPSConnectionPool.ConnectionCls = EmscriptenHTTPSConnection
|
||||
urllib3.connection.HTTPConnection = EmscriptenHTTPConnection # type: ignore[misc,assignment]
|
||||
urllib3.connection.HTTPSConnection = EmscriptenHTTPSConnection # type: ignore[misc,assignment]
|
||||
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
@@ -0,0 +1,259 @@
|
||||
from __future__ import annotations
|
||||
|
||||
import os
|
||||
import typing
|
||||
|
||||
# use http.client.HTTPException for consistency with non-emscripten
|
||||
from http.client import HTTPException as HTTPException # noqa: F401
|
||||
from http.client import ResponseNotReady
|
||||
|
||||
from ..._base_connection import _TYPE_BODY
|
||||
from ...connection import HTTPConnection, ProxyConfig, port_by_scheme
|
||||
from ...exceptions import TimeoutError
|
||||
from ...response import BaseHTTPResponse
|
||||
from ...util.connection import _TYPE_SOCKET_OPTIONS
|
||||
from ...util.timeout import _DEFAULT_TIMEOUT, _TYPE_TIMEOUT
|
||||
from ...util.url import Url
|
||||
from .fetch import _RequestError, _TimeoutError, send_request, send_streaming_request
|
||||
from .request import EmscriptenRequest
|
||||
from .response import EmscriptenHttpResponseWrapper, EmscriptenResponse
|
||||
|
||||
if typing.TYPE_CHECKING:
|
||||
from ..._base_connection import BaseHTTPConnection, BaseHTTPSConnection
|
||||
|
||||
|
||||
class EmscriptenHTTPConnection:
|
||||
default_port: typing.ClassVar[int] = port_by_scheme["http"]
|
||||
default_socket_options: typing.ClassVar[_TYPE_SOCKET_OPTIONS]
|
||||
|
||||
timeout: None | (float)
|
||||
|
||||
host: str
|
||||
port: int
|
||||
blocksize: int
|
||||
source_address: tuple[str, int] | None
|
||||
socket_options: _TYPE_SOCKET_OPTIONS | None
|
||||
|
||||
proxy: Url | None
|
||||
proxy_config: ProxyConfig | None
|
||||
|
||||
is_verified: bool = False
|
||||
proxy_is_verified: bool | None = None
|
||||
|
||||
_response: EmscriptenResponse | None
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
host: str,
|
||||
port: int = 0,
|
||||
*,
|
||||
timeout: _TYPE_TIMEOUT = _DEFAULT_TIMEOUT,
|
||||
source_address: tuple[str, int] | None = None,
|
||||
blocksize: int = 8192,
|
||||
socket_options: _TYPE_SOCKET_OPTIONS | None = None,
|
||||
proxy: Url | None = None,
|
||||
proxy_config: ProxyConfig | None = None,
|
||||
) -> None:
|
||||
self.host = host
|
||||
self.port = port
|
||||
self.timeout = timeout if isinstance(timeout, float) else 0.0
|
||||
self.scheme = "http"
|
||||
self._closed = True
|
||||
self._response = None
|
||||
# ignore these things because we don't
|
||||
# have control over that stuff
|
||||
self.proxy = None
|
||||
self.proxy_config = None
|
||||
self.blocksize = blocksize
|
||||
self.source_address = None
|
||||
self.socket_options = None
|
||||
self.is_verified = False
|
||||
|
||||
def set_tunnel(
|
||||
self,
|
||||
host: str,
|
||||
port: int | None = 0,
|
||||
headers: typing.Mapping[str, str] | None = None,
|
||||
scheme: str = "http",
|
||||
) -> None:
|
||||
pass
|
||||
|
||||
def connect(self) -> None:
|
||||
pass
|
||||
|
||||
def request(
|
||||
self,
|
||||
method: str,
|
||||
url: str,
|
||||
body: _TYPE_BODY | None = None,
|
||||
headers: typing.Mapping[str, str] | None = None,
|
||||
# We know *at least* botocore is depending on the order of the
|
||||
# first 3 parameters so to be safe we only mark the later ones
|
||||
# as keyword-only to ensure we have space to extend.
|
||||
*,
|
||||
chunked: bool = False,
|
||||
preload_content: bool = True,
|
||||
decode_content: bool = True,
|
||||
enforce_content_length: bool = True,
|
||||
) -> None:
|
||||
self._closed = False
|
||||
if url.startswith("/"):
|
||||
if self.port is not None:
|
||||
port = f":{self.port}"
|
||||
else:
|
||||
port = ""
|
||||
# no scheme / host / port included, make a full url
|
||||
url = f"{self.scheme}://{self.host}{port}{url}"
|
||||
request = EmscriptenRequest(
|
||||
url=url,
|
||||
method=method,
|
||||
timeout=self.timeout if self.timeout else 0,
|
||||
decode_content=decode_content,
|
||||
)
|
||||
request.set_body(body)
|
||||
if headers:
|
||||
for k, v in headers.items():
|
||||
request.set_header(k, v)
|
||||
self._response = None
|
||||
try:
|
||||
if not preload_content:
|
||||
self._response = send_streaming_request(request)
|
||||
if self._response is None:
|
||||
self._response = send_request(request)
|
||||
except _TimeoutError as e:
|
||||
raise TimeoutError(e.message) from e
|
||||
except _RequestError as e:
|
||||
raise HTTPException(e.message) from e
|
||||
|
||||
def getresponse(self) -> BaseHTTPResponse:
|
||||
if self._response is not None:
|
||||
return EmscriptenHttpResponseWrapper(
|
||||
internal_response=self._response,
|
||||
url=self._response.request.url,
|
||||
connection=self,
|
||||
)
|
||||
else:
|
||||
raise ResponseNotReady()
|
||||
|
||||
def close(self) -> None:
|
||||
self._closed = True
|
||||
self._response = None
|
||||
|
||||
@property
|
||||
def is_closed(self) -> bool:
|
||||
"""Whether the connection either is brand new or has been previously closed.
|
||||
If this property is True then both ``is_connected`` and ``has_connected_to_proxy``
|
||||
properties must be False.
|
||||
"""
|
||||
return self._closed
|
||||
|
||||
@property
|
||||
def is_connected(self) -> bool:
|
||||
"""Whether the connection is actively connected to any origin (proxy or target)"""
|
||||
return True
|
||||
|
||||
@property
|
||||
def has_connected_to_proxy(self) -> bool:
|
||||
"""Whether the connection has successfully connected to its proxy.
|
||||
This returns False if no proxy is in use. Used to determine whether
|
||||
errors are coming from the proxy layer or from tunnelling to the target origin.
|
||||
"""
|
||||
return False
|
||||
|
||||
|
||||
class EmscriptenHTTPSConnection(EmscriptenHTTPConnection):
|
||||
default_port = port_by_scheme["https"]
|
||||
# all this is basically ignored, as browser handles https
|
||||
cert_reqs: int | str | None = None
|
||||
ca_certs: str | None = None
|
||||
ca_cert_dir: str | None = None
|
||||
ca_cert_data: None | str | bytes = None
|
||||
cert_file: str | None
|
||||
key_file: str | None
|
||||
key_password: str | None
|
||||
ssl_context: typing.Any | None
|
||||
ssl_version: int | str | None = None
|
||||
ssl_minimum_version: int | None = None
|
||||
ssl_maximum_version: int | None = None
|
||||
assert_hostname: None | str | typing.Literal[False]
|
||||
assert_fingerprint: str | None = None
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
host: str,
|
||||
port: int = 0,
|
||||
*,
|
||||
timeout: _TYPE_TIMEOUT = _DEFAULT_TIMEOUT,
|
||||
source_address: tuple[str, int] | None = None,
|
||||
blocksize: int = 16384,
|
||||
socket_options: (
|
||||
None | _TYPE_SOCKET_OPTIONS
|
||||
) = HTTPConnection.default_socket_options,
|
||||
proxy: Url | None = None,
|
||||
proxy_config: ProxyConfig | None = None,
|
||||
cert_reqs: int | str | None = None,
|
||||
assert_hostname: None | str | typing.Literal[False] = None,
|
||||
assert_fingerprint: str | None = None,
|
||||
server_hostname: str | None = None,
|
||||
ssl_context: typing.Any | None = None,
|
||||
ca_certs: str | None = None,
|
||||
ca_cert_dir: str | None = None,
|
||||
ca_cert_data: None | str | bytes = None,
|
||||
ssl_minimum_version: int | None = None,
|
||||
ssl_maximum_version: int | None = None,
|
||||
ssl_version: int | str | None = None, # Deprecated
|
||||
cert_file: str | None = None,
|
||||
key_file: str | None = None,
|
||||
key_password: str | None = None,
|
||||
) -> None:
|
||||
super().__init__(
|
||||
host,
|
||||
port=port,
|
||||
timeout=timeout,
|
||||
source_address=source_address,
|
||||
blocksize=blocksize,
|
||||
socket_options=socket_options,
|
||||
proxy=proxy,
|
||||
proxy_config=proxy_config,
|
||||
)
|
||||
self.scheme = "https"
|
||||
|
||||
self.key_file = key_file
|
||||
self.cert_file = cert_file
|
||||
self.key_password = key_password
|
||||
self.ssl_context = ssl_context
|
||||
self.server_hostname = server_hostname
|
||||
self.assert_hostname = assert_hostname
|
||||
self.assert_fingerprint = assert_fingerprint
|
||||
self.ssl_version = ssl_version
|
||||
self.ssl_minimum_version = ssl_minimum_version
|
||||
self.ssl_maximum_version = ssl_maximum_version
|
||||
self.ca_certs = ca_certs and os.path.expanduser(ca_certs)
|
||||
self.ca_cert_dir = ca_cert_dir and os.path.expanduser(ca_cert_dir)
|
||||
self.ca_cert_data = ca_cert_data
|
||||
|
||||
self.cert_reqs = None
|
||||
|
||||
# The browser will automatically verify all requests.
|
||||
# We have no control over that setting.
|
||||
self.is_verified = True
|
||||
|
||||
def set_cert(
|
||||
self,
|
||||
key_file: str | None = None,
|
||||
cert_file: str | None = None,
|
||||
cert_reqs: int | str | None = None,
|
||||
key_password: str | None = None,
|
||||
ca_certs: str | None = None,
|
||||
assert_hostname: None | str | typing.Literal[False] = None,
|
||||
assert_fingerprint: str | None = None,
|
||||
ca_cert_dir: str | None = None,
|
||||
ca_cert_data: None | str | bytes = None,
|
||||
) -> None:
|
||||
pass
|
||||
|
||||
|
||||
# verify that this class implements BaseHTTP(s) connection correctly
|
||||
if typing.TYPE_CHECKING:
|
||||
_supports_http_protocol: BaseHTTPConnection = EmscriptenHTTPConnection("", 0)
|
||||
_supports_https_protocol: BaseHTTPSConnection = EmscriptenHTTPSConnection("", 0)
|
||||
@@ -0,0 +1,110 @@
|
||||
let Status = {
|
||||
SUCCESS_HEADER: -1,
|
||||
SUCCESS_EOF: -2,
|
||||
ERROR_TIMEOUT: -3,
|
||||
ERROR_EXCEPTION: -4,
|
||||
};
|
||||
|
||||
let connections = new Map();
|
||||
let nextConnectionID = 1;
|
||||
const encoder = new TextEncoder();
|
||||
|
||||
self.addEventListener("message", async function (event) {
|
||||
if (event.data.close) {
|
||||
let connectionID = event.data.close;
|
||||
connections.delete(connectionID);
|
||||
return;
|
||||
} else if (event.data.getMore) {
|
||||
let connectionID = event.data.getMore;
|
||||
let { curOffset, value, reader, intBuffer, byteBuffer } =
|
||||
connections.get(connectionID);
|
||||
// if we still have some in buffer, then just send it back straight away
|
||||
if (!value || curOffset >= value.length) {
|
||||
// read another buffer if required
|
||||
try {
|
||||
let readResponse = await reader.read();
|
||||
|
||||
if (readResponse.done) {
|
||||
// read everything - clear connection and return
|
||||
connections.delete(connectionID);
|
||||
Atomics.store(intBuffer, 0, Status.SUCCESS_EOF);
|
||||
Atomics.notify(intBuffer, 0);
|
||||
// finished reading successfully
|
||||
// return from event handler
|
||||
return;
|
||||
}
|
||||
curOffset = 0;
|
||||
connections.get(connectionID).value = readResponse.value;
|
||||
value = readResponse.value;
|
||||
} catch (error) {
|
||||
console.log("Request exception:", error);
|
||||
let errorBytes = encoder.encode(error.message);
|
||||
let written = errorBytes.length;
|
||||
byteBuffer.set(errorBytes);
|
||||
intBuffer[1] = written;
|
||||
Atomics.store(intBuffer, 0, Status.ERROR_EXCEPTION);
|
||||
Atomics.notify(intBuffer, 0);
|
||||
}
|
||||
}
|
||||
|
||||
// send as much buffer as we can
|
||||
let curLen = value.length - curOffset;
|
||||
if (curLen > byteBuffer.length) {
|
||||
curLen = byteBuffer.length;
|
||||
}
|
||||
byteBuffer.set(value.subarray(curOffset, curOffset + curLen), 0);
|
||||
|
||||
Atomics.store(intBuffer, 0, curLen); // store current length in bytes
|
||||
Atomics.notify(intBuffer, 0);
|
||||
curOffset += curLen;
|
||||
connections.get(connectionID).curOffset = curOffset;
|
||||
|
||||
return;
|
||||
} else {
|
||||
// start fetch
|
||||
let connectionID = nextConnectionID;
|
||||
nextConnectionID += 1;
|
||||
const intBuffer = new Int32Array(event.data.buffer);
|
||||
const byteBuffer = new Uint8Array(event.data.buffer, 8);
|
||||
try {
|
||||
const response = await fetch(event.data.url, event.data.fetchParams);
|
||||
// return the headers first via textencoder
|
||||
var headers = [];
|
||||
for (const pair of response.headers.entries()) {
|
||||
headers.push([pair[0], pair[1]]);
|
||||
}
|
||||
let headerObj = {
|
||||
headers: headers,
|
||||
status: response.status,
|
||||
connectionID,
|
||||
};
|
||||
const headerText = JSON.stringify(headerObj);
|
||||
let headerBytes = encoder.encode(headerText);
|
||||
let written = headerBytes.length;
|
||||
byteBuffer.set(headerBytes);
|
||||
intBuffer[1] = written;
|
||||
// make a connection
|
||||
connections.set(connectionID, {
|
||||
reader: response.body.getReader(),
|
||||
intBuffer: intBuffer,
|
||||
byteBuffer: byteBuffer,
|
||||
value: undefined,
|
||||
curOffset: 0,
|
||||
});
|
||||
// set header ready
|
||||
Atomics.store(intBuffer, 0, Status.SUCCESS_HEADER);
|
||||
Atomics.notify(intBuffer, 0);
|
||||
// all fetching after this goes through a new postmessage call with getMore
|
||||
// this allows for parallel requests
|
||||
} catch (error) {
|
||||
console.log("Request exception:", error);
|
||||
let errorBytes = encoder.encode(error.message);
|
||||
let written = errorBytes.length;
|
||||
byteBuffer.set(errorBytes);
|
||||
intBuffer[1] = written;
|
||||
Atomics.store(intBuffer, 0, Status.ERROR_EXCEPTION);
|
||||
Atomics.notify(intBuffer, 0);
|
||||
}
|
||||
}
|
||||
});
|
||||
self.postMessage({ inited: true });
|
||||
@@ -0,0 +1,726 @@
|
||||
"""
|
||||
Support for streaming http requests in emscripten.
|
||||
|
||||
A few caveats -
|
||||
|
||||
If your browser (or Node.js) has WebAssembly JavaScript Promise Integration enabled
|
||||
https://github.com/WebAssembly/js-promise-integration/blob/main/proposals/js-promise-integration/Overview.md
|
||||
*and* you launch pyodide using `pyodide.runPythonAsync`, this will fetch data using the
|
||||
JavaScript asynchronous fetch api (wrapped via `pyodide.ffi.call_sync`). In this case
|
||||
timeouts and streaming should just work.
|
||||
|
||||
Otherwise, it uses a combination of XMLHttpRequest and a web-worker for streaming.
|
||||
|
||||
This approach has several caveats:
|
||||
|
||||
Firstly, you can't do streaming http in the main UI thread, because atomics.wait isn't allowed.
|
||||
Streaming only works if you're running pyodide in a web worker.
|
||||
|
||||
Secondly, this uses an extra web worker and SharedArrayBuffer to do the asynchronous fetch
|
||||
operation, so it requires that you have crossOriginIsolation enabled, by serving over https
|
||||
(or from localhost) with the two headers below set:
|
||||
|
||||
Cross-Origin-Opener-Policy: same-origin
|
||||
Cross-Origin-Embedder-Policy: require-corp
|
||||
|
||||
You can tell if cross origin isolation is successfully enabled by looking at the global crossOriginIsolated variable in
|
||||
JavaScript console. If it isn't, streaming requests will fallback to XMLHttpRequest, i.e. getting the whole
|
||||
request into a buffer and then returning it. it shows a warning in the JavaScript console in this case.
|
||||
|
||||
Finally, the webworker which does the streaming fetch is created on initial import, but will only be started once
|
||||
control is returned to javascript. Call `await wait_for_streaming_ready()` to wait for streaming fetch.
|
||||
|
||||
NB: in this code, there are a lot of JavaScript objects. They are named js_*
|
||||
to make it clear what type of object they are.
|
||||
"""
|
||||
|
||||
from __future__ import annotations
|
||||
|
||||
import io
|
||||
import json
|
||||
from email.parser import Parser
|
||||
from importlib.resources import files
|
||||
from typing import TYPE_CHECKING, Any
|
||||
|
||||
import js # type: ignore[import-not-found]
|
||||
from pyodide.ffi import ( # type: ignore[import-not-found]
|
||||
JsArray,
|
||||
JsException,
|
||||
JsProxy,
|
||||
to_js,
|
||||
)
|
||||
|
||||
if TYPE_CHECKING:
|
||||
from typing_extensions import Buffer
|
||||
|
||||
from .request import EmscriptenRequest
|
||||
from .response import EmscriptenResponse
|
||||
|
||||
"""
|
||||
There are some headers that trigger unintended CORS preflight requests.
|
||||
See also https://github.com/koenvo/pyodide-http/issues/22
|
||||
"""
|
||||
HEADERS_TO_IGNORE = ("user-agent",)
|
||||
|
||||
SUCCESS_HEADER = -1
|
||||
SUCCESS_EOF = -2
|
||||
ERROR_TIMEOUT = -3
|
||||
ERROR_EXCEPTION = -4
|
||||
|
||||
|
||||
class _RequestError(Exception):
|
||||
def __init__(
|
||||
self,
|
||||
message: str | None = None,
|
||||
*,
|
||||
request: EmscriptenRequest | None = None,
|
||||
response: EmscriptenResponse | None = None,
|
||||
):
|
||||
self.request = request
|
||||
self.response = response
|
||||
self.message = message
|
||||
super().__init__(self.message)
|
||||
|
||||
|
||||
class _StreamingError(_RequestError):
|
||||
pass
|
||||
|
||||
|
||||
class _TimeoutError(_RequestError):
|
||||
pass
|
||||
|
||||
|
||||
def _obj_from_dict(dict_val: dict[str, Any]) -> JsProxy:
|
||||
return to_js(dict_val, dict_converter=js.Object.fromEntries)
|
||||
|
||||
|
||||
class _ReadStream(io.RawIOBase):
|
||||
def __init__(
|
||||
self,
|
||||
int_buffer: JsArray,
|
||||
byte_buffer: JsArray,
|
||||
timeout: float,
|
||||
worker: JsProxy,
|
||||
connection_id: int,
|
||||
request: EmscriptenRequest,
|
||||
):
|
||||
self.int_buffer = int_buffer
|
||||
self.byte_buffer = byte_buffer
|
||||
self.read_pos = 0
|
||||
self.read_len = 0
|
||||
self.connection_id = connection_id
|
||||
self.worker = worker
|
||||
self.timeout = int(1000 * timeout) if timeout > 0 else None
|
||||
self.is_live = True
|
||||
self._is_closed = False
|
||||
self.request: EmscriptenRequest | None = request
|
||||
|
||||
def __del__(self) -> None:
|
||||
self.close()
|
||||
|
||||
# this is compatible with _base_connection
|
||||
def is_closed(self) -> bool:
|
||||
return self._is_closed
|
||||
|
||||
# for compatibility with RawIOBase
|
||||
@property
|
||||
def closed(self) -> bool:
|
||||
return self.is_closed()
|
||||
|
||||
def close(self) -> None:
|
||||
if self.is_closed():
|
||||
return
|
||||
self.read_len = 0
|
||||
self.read_pos = 0
|
||||
self.int_buffer = None
|
||||
self.byte_buffer = None
|
||||
self._is_closed = True
|
||||
self.request = None
|
||||
if self.is_live:
|
||||
self.worker.postMessage(_obj_from_dict({"close": self.connection_id}))
|
||||
self.is_live = False
|
||||
super().close()
|
||||
|
||||
def readable(self) -> bool:
|
||||
return True
|
||||
|
||||
def writable(self) -> bool:
|
||||
return False
|
||||
|
||||
def seekable(self) -> bool:
|
||||
return False
|
||||
|
||||
def readinto(self, byte_obj: Buffer) -> int:
|
||||
if not self.int_buffer:
|
||||
raise _StreamingError(
|
||||
"No buffer for stream in _ReadStream.readinto",
|
||||
request=self.request,
|
||||
response=None,
|
||||
)
|
||||
if self.read_len == 0:
|
||||
# wait for the worker to send something
|
||||
js.Atomics.store(self.int_buffer, 0, ERROR_TIMEOUT)
|
||||
self.worker.postMessage(_obj_from_dict({"getMore": self.connection_id}))
|
||||
if (
|
||||
js.Atomics.wait(self.int_buffer, 0, ERROR_TIMEOUT, self.timeout)
|
||||
== "timed-out"
|
||||
):
|
||||
raise _TimeoutError
|
||||
data_len = self.int_buffer[0]
|
||||
if data_len > 0:
|
||||
self.read_len = data_len
|
||||
self.read_pos = 0
|
||||
elif data_len == ERROR_EXCEPTION:
|
||||
string_len = self.int_buffer[1]
|
||||
# decode the error string
|
||||
js_decoder = js.TextDecoder.new()
|
||||
json_str = js_decoder.decode(self.byte_buffer.slice(0, string_len))
|
||||
raise _StreamingError(
|
||||
f"Exception thrown in fetch: {json_str}",
|
||||
request=self.request,
|
||||
response=None,
|
||||
)
|
||||
else:
|
||||
# EOF, free the buffers and return zero
|
||||
# and free the request
|
||||
self.is_live = False
|
||||
self.close()
|
||||
return 0
|
||||
# copy from int32array to python bytes
|
||||
ret_length = min(self.read_len, len(memoryview(byte_obj)))
|
||||
subarray = self.byte_buffer.subarray(
|
||||
self.read_pos, self.read_pos + ret_length
|
||||
).to_py()
|
||||
memoryview(byte_obj)[0:ret_length] = subarray
|
||||
self.read_len -= ret_length
|
||||
self.read_pos += ret_length
|
||||
return ret_length
|
||||
|
||||
|
||||
class _StreamingFetcher:
|
||||
def __init__(self) -> None:
|
||||
# make web-worker and data buffer on startup
|
||||
self.streaming_ready = False
|
||||
streaming_worker_code = (
|
||||
files(__package__)
|
||||
.joinpath("emscripten_fetch_worker.js")
|
||||
.read_text(encoding="utf-8")
|
||||
)
|
||||
js_data_blob = js.Blob.new(
|
||||
to_js([streaming_worker_code], create_pyproxies=False),
|
||||
_obj_from_dict({"type": "application/javascript"}),
|
||||
)
|
||||
|
||||
def promise_resolver(js_resolve_fn: JsProxy, js_reject_fn: JsProxy) -> None:
|
||||
def onMsg(e: JsProxy) -> None:
|
||||
self.streaming_ready = True
|
||||
js_resolve_fn(e)
|
||||
|
||||
def onErr(e: JsProxy) -> None:
|
||||
js_reject_fn(e) # Defensive: never happens in ci
|
||||
|
||||
self.js_worker.onmessage = onMsg
|
||||
self.js_worker.onerror = onErr
|
||||
|
||||
js_data_url = js.URL.createObjectURL(js_data_blob)
|
||||
self.js_worker = js.globalThis.Worker.new(js_data_url)
|
||||
self.js_worker_ready_promise = js.globalThis.Promise.new(promise_resolver)
|
||||
|
||||
def send(self, request: EmscriptenRequest) -> EmscriptenResponse:
|
||||
headers = {
|
||||
k: v for k, v in request.headers.items() if k not in HEADERS_TO_IGNORE
|
||||
}
|
||||
|
||||
body = request.body
|
||||
fetch_data = {"headers": headers, "body": to_js(body), "method": request.method}
|
||||
# start the request off in the worker
|
||||
timeout = int(1000 * request.timeout) if request.timeout > 0 else None
|
||||
js_shared_buffer = js.SharedArrayBuffer.new(1048576)
|
||||
js_int_buffer = js.Int32Array.new(js_shared_buffer)
|
||||
js_byte_buffer = js.Uint8Array.new(js_shared_buffer, 8)
|
||||
|
||||
js.Atomics.store(js_int_buffer, 0, ERROR_TIMEOUT)
|
||||
js.Atomics.notify(js_int_buffer, 0)
|
||||
js_absolute_url = js.URL.new(request.url, js.location).href
|
||||
self.js_worker.postMessage(
|
||||
_obj_from_dict(
|
||||
{
|
||||
"buffer": js_shared_buffer,
|
||||
"url": js_absolute_url,
|
||||
"fetchParams": fetch_data,
|
||||
}
|
||||
)
|
||||
)
|
||||
# wait for the worker to send something
|
||||
js.Atomics.wait(js_int_buffer, 0, ERROR_TIMEOUT, timeout)
|
||||
if js_int_buffer[0] == ERROR_TIMEOUT:
|
||||
raise _TimeoutError(
|
||||
"Timeout connecting to streaming request",
|
||||
request=request,
|
||||
response=None,
|
||||
)
|
||||
elif js_int_buffer[0] == SUCCESS_HEADER:
|
||||
# got response
|
||||
# header length is in second int of intBuffer
|
||||
string_len = js_int_buffer[1]
|
||||
# decode the rest to a JSON string
|
||||
js_decoder = js.TextDecoder.new()
|
||||
# this does a copy (the slice) because decode can't work on shared array
|
||||
# for some silly reason
|
||||
json_str = js_decoder.decode(js_byte_buffer.slice(0, string_len))
|
||||
# get it as an object
|
||||
response_obj = json.loads(json_str)
|
||||
return EmscriptenResponse(
|
||||
request=request,
|
||||
status_code=response_obj["status"],
|
||||
headers=response_obj["headers"],
|
||||
body=_ReadStream(
|
||||
js_int_buffer,
|
||||
js_byte_buffer,
|
||||
request.timeout,
|
||||
self.js_worker,
|
||||
response_obj["connectionID"],
|
||||
request,
|
||||
),
|
||||
)
|
||||
elif js_int_buffer[0] == ERROR_EXCEPTION:
|
||||
string_len = js_int_buffer[1]
|
||||
# decode the error string
|
||||
js_decoder = js.TextDecoder.new()
|
||||
json_str = js_decoder.decode(js_byte_buffer.slice(0, string_len))
|
||||
raise _StreamingError(
|
||||
f"Exception thrown in fetch: {json_str}", request=request, response=None
|
||||
)
|
||||
else:
|
||||
raise _StreamingError(
|
||||
f"Unknown status from worker in fetch: {js_int_buffer[0]}",
|
||||
request=request,
|
||||
response=None,
|
||||
)
|
||||
|
||||
|
||||
class _JSPIReadStream(io.RawIOBase):
|
||||
"""
|
||||
A read stream that uses pyodide.ffi.run_sync to read from a JavaScript fetch
|
||||
response. This requires support for WebAssembly JavaScript Promise Integration
|
||||
in the containing browser, and for pyodide to be launched via runPythonAsync.
|
||||
|
||||
:param js_read_stream:
|
||||
The JavaScript stream reader
|
||||
|
||||
:param timeout:
|
||||
Timeout in seconds
|
||||
|
||||
:param request:
|
||||
The request we're handling
|
||||
|
||||
:param response:
|
||||
The response this stream relates to
|
||||
|
||||
:param js_abort_controller:
|
||||
A JavaScript AbortController object, used for timeouts
|
||||
"""
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
js_read_stream: Any,
|
||||
timeout: float,
|
||||
request: EmscriptenRequest,
|
||||
response: EmscriptenResponse,
|
||||
js_abort_controller: Any, # JavaScript AbortController for timeouts
|
||||
):
|
||||
self.js_read_stream = js_read_stream
|
||||
self.timeout = timeout
|
||||
self._is_closed = False
|
||||
self._is_done = False
|
||||
self.request: EmscriptenRequest | None = request
|
||||
self.response: EmscriptenResponse | None = response
|
||||
self.current_buffer = None
|
||||
self.current_buffer_pos = 0
|
||||
self.js_abort_controller = js_abort_controller
|
||||
|
||||
def __del__(self) -> None:
|
||||
self.close()
|
||||
|
||||
# this is compatible with _base_connection
|
||||
def is_closed(self) -> bool:
|
||||
return self._is_closed
|
||||
|
||||
# for compatibility with RawIOBase
|
||||
@property
|
||||
def closed(self) -> bool:
|
||||
return self.is_closed()
|
||||
|
||||
def close(self) -> None:
|
||||
if self.is_closed():
|
||||
return
|
||||
self.read_len = 0
|
||||
self.read_pos = 0
|
||||
self.js_read_stream.cancel()
|
||||
self.js_read_stream = None
|
||||
self._is_closed = True
|
||||
self._is_done = True
|
||||
self.request = None
|
||||
self.response = None
|
||||
super().close()
|
||||
|
||||
def readable(self) -> bool:
|
||||
return True
|
||||
|
||||
def writable(self) -> bool:
|
||||
return False
|
||||
|
||||
def seekable(self) -> bool:
|
||||
return False
|
||||
|
||||
def _get_next_buffer(self) -> bool:
|
||||
result_js = _run_sync_with_timeout(
|
||||
self.js_read_stream.read(),
|
||||
self.timeout,
|
||||
self.js_abort_controller,
|
||||
request=self.request,
|
||||
response=self.response,
|
||||
)
|
||||
if result_js.done:
|
||||
self._is_done = True
|
||||
return False
|
||||
else:
|
||||
self.current_buffer = result_js.value.to_py()
|
||||
self.current_buffer_pos = 0
|
||||
return True
|
||||
|
||||
def readinto(self, byte_obj: Buffer) -> int:
|
||||
if self.current_buffer is None:
|
||||
if not self._get_next_buffer() or self.current_buffer is None:
|
||||
self.close()
|
||||
return 0
|
||||
ret_length = min(
|
||||
len(byte_obj), len(self.current_buffer) - self.current_buffer_pos
|
||||
)
|
||||
byte_obj[0:ret_length] = self.current_buffer[
|
||||
self.current_buffer_pos : self.current_buffer_pos + ret_length
|
||||
]
|
||||
self.current_buffer_pos += ret_length
|
||||
if self.current_buffer_pos == len(self.current_buffer):
|
||||
self.current_buffer = None
|
||||
return ret_length
|
||||
|
||||
|
||||
# check if we are in a worker or not
|
||||
def is_in_browser_main_thread() -> bool:
|
||||
return hasattr(js, "window") and hasattr(js, "self") and js.self == js.window
|
||||
|
||||
|
||||
def is_cross_origin_isolated() -> bool:
|
||||
return hasattr(js, "crossOriginIsolated") and js.crossOriginIsolated
|
||||
|
||||
|
||||
def is_in_node() -> bool:
|
||||
return (
|
||||
hasattr(js, "process")
|
||||
and hasattr(js.process, "release")
|
||||
and hasattr(js.process.release, "name")
|
||||
and js.process.release.name == "node"
|
||||
)
|
||||
|
||||
|
||||
def is_worker_available() -> bool:
|
||||
return hasattr(js, "Worker") and hasattr(js, "Blob")
|
||||
|
||||
|
||||
_fetcher: _StreamingFetcher | None = None
|
||||
|
||||
if is_worker_available() and (
|
||||
(is_cross_origin_isolated() and not is_in_browser_main_thread())
|
||||
and (not is_in_node())
|
||||
):
|
||||
_fetcher = _StreamingFetcher()
|
||||
else:
|
||||
_fetcher = None
|
||||
|
||||
|
||||
NODE_JSPI_ERROR = (
|
||||
"urllib3 only works in Node.js with pyodide.runPythonAsync"
|
||||
" and requires the flag --experimental-wasm-stack-switching in "
|
||||
" versions of node <24."
|
||||
)
|
||||
|
||||
|
||||
def send_streaming_request(request: EmscriptenRequest) -> EmscriptenResponse | None:
|
||||
if has_jspi():
|
||||
return send_jspi_request(request, True)
|
||||
elif is_in_node():
|
||||
raise _RequestError(
|
||||
message=NODE_JSPI_ERROR,
|
||||
request=request,
|
||||
response=None,
|
||||
)
|
||||
|
||||
if _fetcher and streaming_ready():
|
||||
return _fetcher.send(request)
|
||||
else:
|
||||
_show_streaming_warning()
|
||||
return None
|
||||
|
||||
|
||||
_SHOWN_TIMEOUT_WARNING = False
|
||||
|
||||
|
||||
def _show_timeout_warning() -> None:
|
||||
global _SHOWN_TIMEOUT_WARNING
|
||||
if not _SHOWN_TIMEOUT_WARNING:
|
||||
_SHOWN_TIMEOUT_WARNING = True
|
||||
message = "Warning: Timeout is not available on main browser thread"
|
||||
js.console.warn(message)
|
||||
|
||||
|
||||
_SHOWN_STREAMING_WARNING = False
|
||||
|
||||
|
||||
def _show_streaming_warning() -> None:
|
||||
global _SHOWN_STREAMING_WARNING
|
||||
if not _SHOWN_STREAMING_WARNING:
|
||||
_SHOWN_STREAMING_WARNING = True
|
||||
message = "Can't stream HTTP requests because: \n"
|
||||
if not is_cross_origin_isolated():
|
||||
message += " Page is not cross-origin isolated\n"
|
||||
if is_in_browser_main_thread():
|
||||
message += " Python is running in main browser thread\n"
|
||||
if not is_worker_available():
|
||||
message += " Worker or Blob classes are not available in this environment." # Defensive: this is always False in browsers that we test in
|
||||
if streaming_ready() is False:
|
||||
message += """ Streaming fetch worker isn't ready. If you want to be sure that streaming fetch
|
||||
is working, you need to call: 'await urllib3.contrib.emscripten.fetch.wait_for_streaming_ready()`"""
|
||||
from js import console
|
||||
|
||||
console.warn(message)
|
||||
|
||||
|
||||
def send_request(request: EmscriptenRequest) -> EmscriptenResponse:
|
||||
if has_jspi():
|
||||
return send_jspi_request(request, False)
|
||||
elif is_in_node():
|
||||
raise _RequestError(
|
||||
message=NODE_JSPI_ERROR,
|
||||
request=request,
|
||||
response=None,
|
||||
)
|
||||
try:
|
||||
js_xhr = js.XMLHttpRequest.new()
|
||||
|
||||
if not is_in_browser_main_thread():
|
||||
js_xhr.responseType = "arraybuffer"
|
||||
if request.timeout:
|
||||
js_xhr.timeout = int(request.timeout * 1000)
|
||||
else:
|
||||
js_xhr.overrideMimeType("text/plain; charset=ISO-8859-15")
|
||||
if request.timeout:
|
||||
# timeout isn't available on the main thread - show a warning in console
|
||||
# if it is set
|
||||
_show_timeout_warning()
|
||||
|
||||
js_xhr.open(request.method, request.url, False)
|
||||
for name, value in request.headers.items():
|
||||
if name.lower() not in HEADERS_TO_IGNORE:
|
||||
js_xhr.setRequestHeader(name, value)
|
||||
|
||||
js_xhr.send(to_js(request.body))
|
||||
|
||||
headers = dict(Parser().parsestr(js_xhr.getAllResponseHeaders()))
|
||||
|
||||
if not is_in_browser_main_thread():
|
||||
body = js_xhr.response.to_py().tobytes()
|
||||
else:
|
||||
body = js_xhr.response.encode("ISO-8859-15")
|
||||
return EmscriptenResponse(
|
||||
status_code=js_xhr.status, headers=headers, body=body, request=request
|
||||
)
|
||||
except JsException as err:
|
||||
if err.name == "TimeoutError":
|
||||
raise _TimeoutError(err.message, request=request)
|
||||
elif err.name == "NetworkError":
|
||||
raise _RequestError(err.message, request=request)
|
||||
else:
|
||||
# general http error
|
||||
raise _RequestError(err.message, request=request)
|
||||
|
||||
|
||||
def send_jspi_request(
|
||||
request: EmscriptenRequest, streaming: bool
|
||||
) -> EmscriptenResponse:
|
||||
"""
|
||||
Send a request using WebAssembly JavaScript Promise Integration
|
||||
to wrap the asynchronous JavaScript fetch api (experimental).
|
||||
|
||||
:param request:
|
||||
Request to send
|
||||
|
||||
:param streaming:
|
||||
Whether to stream the response
|
||||
|
||||
:return: The response object
|
||||
:rtype: EmscriptenResponse
|
||||
"""
|
||||
timeout = request.timeout
|
||||
js_abort_controller = js.AbortController.new()
|
||||
headers = {k: v for k, v in request.headers.items() if k not in HEADERS_TO_IGNORE}
|
||||
req_body = request.body
|
||||
fetch_data = {
|
||||
"headers": headers,
|
||||
"body": to_js(req_body),
|
||||
"method": request.method,
|
||||
"signal": js_abort_controller.signal,
|
||||
}
|
||||
# Node.js returns the whole response (unlike opaqueredirect in browsers),
|
||||
# so urllib3 can set `redirect: manual` to control redirects itself.
|
||||
# https://stackoverflow.com/a/78524615
|
||||
if _is_node_js():
|
||||
fetch_data["redirect"] = "manual"
|
||||
# Call JavaScript fetch (async api, returns a promise)
|
||||
fetcher_promise_js = js.fetch(request.url, _obj_from_dict(fetch_data))
|
||||
# Now suspend WebAssembly until we resolve that promise
|
||||
# or time out.
|
||||
response_js = _run_sync_with_timeout(
|
||||
fetcher_promise_js,
|
||||
timeout,
|
||||
js_abort_controller,
|
||||
request=request,
|
||||
response=None,
|
||||
)
|
||||
headers = {}
|
||||
header_iter = response_js.headers.entries()
|
||||
while True:
|
||||
iter_value_js = header_iter.next()
|
||||
if getattr(iter_value_js, "done", False):
|
||||
break
|
||||
else:
|
||||
headers[str(iter_value_js.value[0])] = str(iter_value_js.value[1])
|
||||
status_code = response_js.status
|
||||
body: bytes | io.RawIOBase = b""
|
||||
|
||||
response = EmscriptenResponse(
|
||||
status_code=status_code, headers=headers, body=b"", request=request
|
||||
)
|
||||
if streaming:
|
||||
# get via inputstream
|
||||
if response_js.body is not None:
|
||||
# get a reader from the fetch response
|
||||
body_stream_js = response_js.body.getReader()
|
||||
body = _JSPIReadStream(
|
||||
body_stream_js, timeout, request, response, js_abort_controller
|
||||
)
|
||||
else:
|
||||
# get directly via arraybuffer
|
||||
# n.b. this is another async JavaScript call.
|
||||
body = _run_sync_with_timeout(
|
||||
response_js.arrayBuffer(),
|
||||
timeout,
|
||||
js_abort_controller,
|
||||
request=request,
|
||||
response=response,
|
||||
).to_py()
|
||||
response.body = body
|
||||
return response
|
||||
|
||||
|
||||
def _run_sync_with_timeout(
|
||||
promise: Any,
|
||||
timeout: float,
|
||||
js_abort_controller: Any,
|
||||
request: EmscriptenRequest | None,
|
||||
response: EmscriptenResponse | None,
|
||||
) -> Any:
|
||||
"""
|
||||
Await a JavaScript promise synchronously with a timeout which is implemented
|
||||
via the AbortController
|
||||
|
||||
:param promise:
|
||||
Javascript promise to await
|
||||
|
||||
:param timeout:
|
||||
Timeout in seconds
|
||||
|
||||
:param js_abort_controller:
|
||||
A JavaScript AbortController object, used on timeout
|
||||
|
||||
:param request:
|
||||
The request being handled
|
||||
|
||||
:param response:
|
||||
The response being handled (if it exists yet)
|
||||
|
||||
:raises _TimeoutError: If the request times out
|
||||
:raises _RequestError: If the request raises a JavaScript exception
|
||||
|
||||
:return: The result of awaiting the promise.
|
||||
"""
|
||||
timer_id = None
|
||||
if timeout > 0:
|
||||
timer_id = js.setTimeout(
|
||||
js_abort_controller.abort.bind(js_abort_controller), int(timeout * 1000)
|
||||
)
|
||||
try:
|
||||
from pyodide.ffi import run_sync
|
||||
|
||||
# run_sync here uses WebAssembly JavaScript Promise Integration to
|
||||
# suspend python until the JavaScript promise resolves.
|
||||
return run_sync(promise)
|
||||
except JsException as err:
|
||||
if err.name == "AbortError":
|
||||
raise _TimeoutError(
|
||||
message="Request timed out", request=request, response=response
|
||||
)
|
||||
else:
|
||||
raise _RequestError(message=err.message, request=request, response=response)
|
||||
finally:
|
||||
if timer_id is not None:
|
||||
js.clearTimeout(timer_id)
|
||||
|
||||
|
||||
def has_jspi() -> bool:
|
||||
"""
|
||||
Return true if jspi can be used.
|
||||
|
||||
This requires both browser support and also WebAssembly
|
||||
to be in the correct state - i.e. that the javascript
|
||||
call into python was async not sync.
|
||||
|
||||
:return: True if jspi can be used.
|
||||
:rtype: bool
|
||||
"""
|
||||
try:
|
||||
from pyodide.ffi import can_run_sync, run_sync # noqa: F401
|
||||
|
||||
return bool(can_run_sync())
|
||||
except ImportError:
|
||||
return False
|
||||
|
||||
|
||||
def _is_node_js() -> bool:
|
||||
"""
|
||||
Check if we are in Node.js.
|
||||
|
||||
:return: True if we are in Node.js.
|
||||
:rtype: bool
|
||||
"""
|
||||
return (
|
||||
hasattr(js, "process")
|
||||
and hasattr(js.process, "release")
|
||||
# According to the Node.js documentation, the release name is always "node".
|
||||
and js.process.release.name == "node"
|
||||
)
|
||||
|
||||
|
||||
def streaming_ready() -> bool | None:
|
||||
if _fetcher:
|
||||
return _fetcher.streaming_ready
|
||||
else:
|
||||
return None # no fetcher, return None to signify that
|
||||
|
||||
|
||||
async def wait_for_streaming_ready() -> bool:
|
||||
if _fetcher:
|
||||
await _fetcher.js_worker_ready_promise
|
||||
return True
|
||||
else:
|
||||
return False
|
||||
@@ -0,0 +1,22 @@
|
||||
from __future__ import annotations
|
||||
|
||||
from dataclasses import dataclass, field
|
||||
|
||||
from ..._base_connection import _TYPE_BODY
|
||||
|
||||
|
||||
@dataclass
|
||||
class EmscriptenRequest:
|
||||
method: str
|
||||
url: str
|
||||
params: dict[str, str] | None = None
|
||||
body: _TYPE_BODY | None = None
|
||||
headers: dict[str, str] = field(default_factory=dict)
|
||||
timeout: float = 0
|
||||
decode_content: bool = True
|
||||
|
||||
def set_header(self, name: str, value: str) -> None:
|
||||
self.headers[name.capitalize()] = value
|
||||
|
||||
def set_body(self, body: _TYPE_BODY | None) -> None:
|
||||
self.body = body
|
||||
@@ -0,0 +1,277 @@
|
||||
from __future__ import annotations
|
||||
|
||||
import json as _json
|
||||
import logging
|
||||
import typing
|
||||
from contextlib import contextmanager
|
||||
from dataclasses import dataclass
|
||||
from http.client import HTTPException as HTTPException
|
||||
from io import BytesIO, IOBase
|
||||
|
||||
from ...exceptions import InvalidHeader, TimeoutError
|
||||
from ...response import BaseHTTPResponse
|
||||
from ...util.retry import Retry
|
||||
from .request import EmscriptenRequest
|
||||
|
||||
if typing.TYPE_CHECKING:
|
||||
from ..._base_connection import BaseHTTPConnection, BaseHTTPSConnection
|
||||
|
||||
log = logging.getLogger(__name__)
|
||||
|
||||
|
||||
@dataclass
|
||||
class EmscriptenResponse:
|
||||
status_code: int
|
||||
headers: dict[str, str]
|
||||
body: IOBase | bytes
|
||||
request: EmscriptenRequest
|
||||
|
||||
|
||||
class EmscriptenHttpResponseWrapper(BaseHTTPResponse):
|
||||
def __init__(
|
||||
self,
|
||||
internal_response: EmscriptenResponse,
|
||||
url: str | None = None,
|
||||
connection: BaseHTTPConnection | BaseHTTPSConnection | None = None,
|
||||
):
|
||||
self._pool = None # set by pool class
|
||||
self._body = None
|
||||
self._response = internal_response
|
||||
self._url = url
|
||||
self._connection = connection
|
||||
self._closed = False
|
||||
super().__init__(
|
||||
headers=internal_response.headers,
|
||||
status=internal_response.status_code,
|
||||
request_url=url,
|
||||
version=0,
|
||||
version_string="HTTP/?",
|
||||
reason="",
|
||||
decode_content=True,
|
||||
)
|
||||
self.length_remaining = self._init_length(self._response.request.method)
|
||||
self.length_is_certain = False
|
||||
|
||||
@property
|
||||
def url(self) -> str | None:
|
||||
return self._url
|
||||
|
||||
@url.setter
|
||||
def url(self, url: str | None) -> None:
|
||||
self._url = url
|
||||
|
||||
@property
|
||||
def connection(self) -> BaseHTTPConnection | BaseHTTPSConnection | None:
|
||||
return self._connection
|
||||
|
||||
@property
|
||||
def retries(self) -> Retry | None:
|
||||
return self._retries
|
||||
|
||||
@retries.setter
|
||||
def retries(self, retries: Retry | None) -> None:
|
||||
# Override the request_url if retries has a redirect location.
|
||||
self._retries = retries
|
||||
|
||||
def stream(
|
||||
self, amt: int | None = 2**16, decode_content: bool | None = None
|
||||
) -> typing.Generator[bytes]:
|
||||
"""
|
||||
A generator wrapper for the read() method. A call will block until
|
||||
``amt`` bytes have been read from the connection or until the
|
||||
connection is closed.
|
||||
|
||||
:param amt:
|
||||
How much of the content to read. The generator will return up to
|
||||
much data per iteration, but may return less. This is particularly
|
||||
likely when using compressed data. However, the empty string will
|
||||
never be returned.
|
||||
|
||||
:param decode_content:
|
||||
If True, will attempt to decode the body based on the
|
||||
'content-encoding' header.
|
||||
"""
|
||||
while True:
|
||||
data = self.read(amt=amt, decode_content=decode_content)
|
||||
|
||||
if data:
|
||||
yield data
|
||||
else:
|
||||
break
|
||||
|
||||
def _init_length(self, request_method: str | None) -> int | None:
|
||||
length: int | None
|
||||
content_length: str | None = self.headers.get("content-length")
|
||||
|
||||
if content_length is not None:
|
||||
try:
|
||||
# RFC 7230 section 3.3.2 specifies multiple content lengths can
|
||||
# be sent in a single Content-Length header
|
||||
# (e.g. Content-Length: 42, 42). This line ensures the values
|
||||
# are all valid ints and that as long as the `set` length is 1,
|
||||
# all values are the same. Otherwise, the header is invalid.
|
||||
lengths = {int(val) for val in content_length.split(",")}
|
||||
if len(lengths) > 1:
|
||||
raise InvalidHeader(
|
||||
"Content-Length contained multiple "
|
||||
"unmatching values (%s)" % content_length
|
||||
)
|
||||
length = lengths.pop()
|
||||
except ValueError:
|
||||
length = None
|
||||
else:
|
||||
if length < 0:
|
||||
length = None
|
||||
|
||||
else: # if content_length is None
|
||||
length = None
|
||||
|
||||
# Check for responses that shouldn't include a body
|
||||
if (
|
||||
self.status in (204, 304)
|
||||
or 100 <= self.status < 200
|
||||
or request_method == "HEAD"
|
||||
):
|
||||
length = 0
|
||||
|
||||
return length
|
||||
|
||||
def read(
|
||||
self,
|
||||
amt: int | None = None,
|
||||
decode_content: bool | None = None, # ignored because browser decodes always
|
||||
cache_content: bool = False,
|
||||
) -> bytes:
|
||||
if (
|
||||
self._closed
|
||||
or self._response is None
|
||||
or (isinstance(self._response.body, IOBase) and self._response.body.closed)
|
||||
):
|
||||
return b""
|
||||
|
||||
with self._error_catcher():
|
||||
# body has been preloaded as a string by XmlHttpRequest
|
||||
if not isinstance(self._response.body, IOBase):
|
||||
self.length_remaining = len(self._response.body)
|
||||
self.length_is_certain = True
|
||||
# wrap body in IOStream
|
||||
self._response.body = BytesIO(self._response.body)
|
||||
if amt is not None and amt >= 0:
|
||||
# don't cache partial content
|
||||
cache_content = False
|
||||
data = self._response.body.read(amt)
|
||||
else: # read all we can (and cache it)
|
||||
data = self._response.body.read()
|
||||
if cache_content:
|
||||
self._body = data
|
||||
if self.length_remaining is not None:
|
||||
self.length_remaining = max(self.length_remaining - len(data), 0)
|
||||
if len(data) == 0 or (
|
||||
self.length_is_certain and self.length_remaining == 0
|
||||
):
|
||||
# definitely finished reading, close response stream
|
||||
self._response.body.close()
|
||||
return typing.cast(bytes, data)
|
||||
|
||||
def read_chunked(
|
||||
self,
|
||||
amt: int | None = None,
|
||||
decode_content: bool | None = None,
|
||||
) -> typing.Generator[bytes]:
|
||||
# chunked is handled by browser
|
||||
while True:
|
||||
bytes = self.read(amt, decode_content)
|
||||
if not bytes:
|
||||
break
|
||||
yield bytes
|
||||
|
||||
def release_conn(self) -> None:
|
||||
if not self._pool or not self._connection:
|
||||
return None
|
||||
|
||||
self._pool._put_conn(self._connection)
|
||||
self._connection = None
|
||||
|
||||
def drain_conn(self) -> None:
|
||||
self.close()
|
||||
|
||||
@property
|
||||
def data(self) -> bytes:
|
||||
if self._body:
|
||||
return self._body
|
||||
else:
|
||||
return self.read(cache_content=True)
|
||||
|
||||
def json(self) -> typing.Any:
|
||||
"""
|
||||
Deserializes the body of the HTTP response as a Python object.
|
||||
|
||||
The body of the HTTP response must be encoded using UTF-8, as per
|
||||
`RFC 8529 Section 8.1 <https://www.rfc-editor.org/rfc/rfc8259#section-8.1>`_.
|
||||
|
||||
To use a custom JSON decoder pass the result of :attr:`HTTPResponse.data` to
|
||||
your custom decoder instead.
|
||||
|
||||
If the body of the HTTP response is not decodable to UTF-8, a
|
||||
`UnicodeDecodeError` will be raised. If the body of the HTTP response is not a
|
||||
valid JSON document, a `json.JSONDecodeError` will be raised.
|
||||
|
||||
Read more :ref:`here <json_content>`.
|
||||
|
||||
:returns: The body of the HTTP response as a Python object.
|
||||
"""
|
||||
data = self.data.decode("utf-8")
|
||||
return _json.loads(data)
|
||||
|
||||
def close(self) -> None:
|
||||
if not self._closed:
|
||||
if isinstance(self._response.body, IOBase):
|
||||
self._response.body.close()
|
||||
if self._connection:
|
||||
self._connection.close()
|
||||
self._connection = None
|
||||
self._closed = True
|
||||
|
||||
@contextmanager
|
||||
def _error_catcher(self) -> typing.Generator[None]:
|
||||
"""
|
||||
Catch Emscripten specific exceptions thrown by fetch.py,
|
||||
instead re-raising urllib3 variants, so that low-level exceptions
|
||||
are not leaked in the high-level api.
|
||||
|
||||
On exit, release the connection back to the pool.
|
||||
"""
|
||||
from .fetch import _RequestError, _TimeoutError # avoid circular import
|
||||
|
||||
clean_exit = False
|
||||
|
||||
try:
|
||||
yield
|
||||
# If no exception is thrown, we should avoid cleaning up
|
||||
# unnecessarily.
|
||||
clean_exit = True
|
||||
except _TimeoutError as e:
|
||||
raise TimeoutError(str(e))
|
||||
except _RequestError as e:
|
||||
raise HTTPException(str(e))
|
||||
finally:
|
||||
# If we didn't terminate cleanly, we need to throw away our
|
||||
# connection.
|
||||
if not clean_exit:
|
||||
# The response may not be closed but we're not going to use it
|
||||
# anymore so close it now
|
||||
if (
|
||||
isinstance(self._response.body, IOBase)
|
||||
and not self._response.body.closed
|
||||
):
|
||||
self._response.body.close()
|
||||
# release the connection back to the pool
|
||||
self.release_conn()
|
||||
else:
|
||||
# If we have read everything from the response stream,
|
||||
# return the connection back to the pool.
|
||||
if (
|
||||
isinstance(self._response.body, IOBase)
|
||||
and self._response.body.closed
|
||||
):
|
||||
self.release_conn()
|
||||
@@ -0,0 +1,564 @@
|
||||
"""
|
||||
Module for using pyOpenSSL as a TLS backend. This module was relevant before
|
||||
the standard library ``ssl`` module supported SNI, but now that we've dropped
|
||||
support for Python 2.7 all relevant Python versions support SNI so
|
||||
**this module is no longer recommended**.
|
||||
|
||||
This needs the following packages installed:
|
||||
|
||||
* `pyOpenSSL`_ (tested with 16.0.0)
|
||||
* `cryptography`_ (minimum 1.3.4, from pyopenssl)
|
||||
* `idna`_ (minimum 2.0)
|
||||
|
||||
However, pyOpenSSL depends on cryptography, so while we use all three directly here we
|
||||
end up having relatively few packages required.
|
||||
|
||||
You can install them with the following command:
|
||||
|
||||
.. code-block:: bash
|
||||
|
||||
$ python -m pip install pyopenssl cryptography idna
|
||||
|
||||
To activate certificate checking, call
|
||||
:func:`~urllib3.contrib.pyopenssl.inject_into_urllib3` from your Python code
|
||||
before you begin making HTTP requests. This can be done in a ``sitecustomize``
|
||||
module, or at any other time before your application begins using ``urllib3``,
|
||||
like this:
|
||||
|
||||
.. code-block:: python
|
||||
|
||||
try:
|
||||
import urllib3.contrib.pyopenssl
|
||||
urllib3.contrib.pyopenssl.inject_into_urllib3()
|
||||
except ImportError:
|
||||
pass
|
||||
|
||||
.. _pyopenssl: https://www.pyopenssl.org
|
||||
.. _cryptography: https://cryptography.io
|
||||
.. _idna: https://github.com/kjd/idna
|
||||
"""
|
||||
|
||||
from __future__ import annotations
|
||||
|
||||
import OpenSSL.SSL # type: ignore[import-not-found]
|
||||
from cryptography import x509
|
||||
|
||||
try:
|
||||
from cryptography.x509 import UnsupportedExtension # type: ignore[attr-defined]
|
||||
except ImportError:
|
||||
# UnsupportedExtension is gone in cryptography >= 2.1.0
|
||||
class UnsupportedExtension(Exception): # type: ignore[no-redef]
|
||||
pass
|
||||
|
||||
|
||||
import logging
|
||||
import ssl
|
||||
import typing
|
||||
from io import BytesIO
|
||||
from socket import socket as socket_cls
|
||||
from socket import timeout
|
||||
|
||||
from .. import util
|
||||
|
||||
if typing.TYPE_CHECKING:
|
||||
from OpenSSL.crypto import X509 # type: ignore[import-not-found]
|
||||
|
||||
|
||||
__all__ = ["inject_into_urllib3", "extract_from_urllib3"]
|
||||
|
||||
# Map from urllib3 to PyOpenSSL compatible parameter-values.
|
||||
_openssl_versions: dict[int, int] = {
|
||||
util.ssl_.PROTOCOL_TLS: OpenSSL.SSL.SSLv23_METHOD, # type: ignore[attr-defined]
|
||||
util.ssl_.PROTOCOL_TLS_CLIENT: OpenSSL.SSL.SSLv23_METHOD, # type: ignore[attr-defined]
|
||||
ssl.PROTOCOL_TLSv1: OpenSSL.SSL.TLSv1_METHOD,
|
||||
}
|
||||
|
||||
if hasattr(ssl, "PROTOCOL_TLSv1_1") and hasattr(OpenSSL.SSL, "TLSv1_1_METHOD"):
|
||||
_openssl_versions[ssl.PROTOCOL_TLSv1_1] = OpenSSL.SSL.TLSv1_1_METHOD
|
||||
|
||||
if hasattr(ssl, "PROTOCOL_TLSv1_2") and hasattr(OpenSSL.SSL, "TLSv1_2_METHOD"):
|
||||
_openssl_versions[ssl.PROTOCOL_TLSv1_2] = OpenSSL.SSL.TLSv1_2_METHOD
|
||||
|
||||
|
||||
_stdlib_to_openssl_verify = {
|
||||
ssl.CERT_NONE: OpenSSL.SSL.VERIFY_NONE,
|
||||
ssl.CERT_OPTIONAL: OpenSSL.SSL.VERIFY_PEER,
|
||||
ssl.CERT_REQUIRED: OpenSSL.SSL.VERIFY_PEER
|
||||
+ OpenSSL.SSL.VERIFY_FAIL_IF_NO_PEER_CERT,
|
||||
}
|
||||
_openssl_to_stdlib_verify = {v: k for k, v in _stdlib_to_openssl_verify.items()}
|
||||
|
||||
# The SSLvX values are the most likely to be missing in the future
|
||||
# but we check them all just to be sure.
|
||||
_OP_NO_SSLv2_OR_SSLv3: int = getattr(OpenSSL.SSL, "OP_NO_SSLv2", 0) | getattr(
|
||||
OpenSSL.SSL, "OP_NO_SSLv3", 0
|
||||
)
|
||||
_OP_NO_TLSv1: int = getattr(OpenSSL.SSL, "OP_NO_TLSv1", 0)
|
||||
_OP_NO_TLSv1_1: int = getattr(OpenSSL.SSL, "OP_NO_TLSv1_1", 0)
|
||||
_OP_NO_TLSv1_2: int = getattr(OpenSSL.SSL, "OP_NO_TLSv1_2", 0)
|
||||
_OP_NO_TLSv1_3: int = getattr(OpenSSL.SSL, "OP_NO_TLSv1_3", 0)
|
||||
|
||||
_openssl_to_ssl_minimum_version: dict[int, int] = {
|
||||
ssl.TLSVersion.MINIMUM_SUPPORTED: _OP_NO_SSLv2_OR_SSLv3,
|
||||
ssl.TLSVersion.TLSv1: _OP_NO_SSLv2_OR_SSLv3,
|
||||
ssl.TLSVersion.TLSv1_1: _OP_NO_SSLv2_OR_SSLv3 | _OP_NO_TLSv1,
|
||||
ssl.TLSVersion.TLSv1_2: _OP_NO_SSLv2_OR_SSLv3 | _OP_NO_TLSv1 | _OP_NO_TLSv1_1,
|
||||
ssl.TLSVersion.TLSv1_3: (
|
||||
_OP_NO_SSLv2_OR_SSLv3 | _OP_NO_TLSv1 | _OP_NO_TLSv1_1 | _OP_NO_TLSv1_2
|
||||
),
|
||||
ssl.TLSVersion.MAXIMUM_SUPPORTED: (
|
||||
_OP_NO_SSLv2_OR_SSLv3 | _OP_NO_TLSv1 | _OP_NO_TLSv1_1 | _OP_NO_TLSv1_2
|
||||
),
|
||||
}
|
||||
_openssl_to_ssl_maximum_version: dict[int, int] = {
|
||||
ssl.TLSVersion.MINIMUM_SUPPORTED: (
|
||||
_OP_NO_SSLv2_OR_SSLv3
|
||||
| _OP_NO_TLSv1
|
||||
| _OP_NO_TLSv1_1
|
||||
| _OP_NO_TLSv1_2
|
||||
| _OP_NO_TLSv1_3
|
||||
),
|
||||
ssl.TLSVersion.TLSv1: (
|
||||
_OP_NO_SSLv2_OR_SSLv3 | _OP_NO_TLSv1_1 | _OP_NO_TLSv1_2 | _OP_NO_TLSv1_3
|
||||
),
|
||||
ssl.TLSVersion.TLSv1_1: _OP_NO_SSLv2_OR_SSLv3 | _OP_NO_TLSv1_2 | _OP_NO_TLSv1_3,
|
||||
ssl.TLSVersion.TLSv1_2: _OP_NO_SSLv2_OR_SSLv3 | _OP_NO_TLSv1_3,
|
||||
ssl.TLSVersion.TLSv1_3: _OP_NO_SSLv2_OR_SSLv3,
|
||||
ssl.TLSVersion.MAXIMUM_SUPPORTED: _OP_NO_SSLv2_OR_SSLv3,
|
||||
}
|
||||
|
||||
# OpenSSL will only write 16K at a time
|
||||
SSL_WRITE_BLOCKSIZE = 16384
|
||||
|
||||
orig_util_SSLContext = util.ssl_.SSLContext
|
||||
|
||||
|
||||
log = logging.getLogger(__name__)
|
||||
|
||||
|
||||
def inject_into_urllib3() -> None:
|
||||
"Monkey-patch urllib3 with PyOpenSSL-backed SSL-support."
|
||||
|
||||
_validate_dependencies_met()
|
||||
|
||||
util.SSLContext = PyOpenSSLContext # type: ignore[assignment]
|
||||
util.ssl_.SSLContext = PyOpenSSLContext # type: ignore[assignment]
|
||||
util.IS_PYOPENSSL = True
|
||||
util.ssl_.IS_PYOPENSSL = True
|
||||
|
||||
|
||||
def extract_from_urllib3() -> None:
|
||||
"Undo monkey-patching by :func:`inject_into_urllib3`."
|
||||
|
||||
util.SSLContext = orig_util_SSLContext
|
||||
util.ssl_.SSLContext = orig_util_SSLContext
|
||||
util.IS_PYOPENSSL = False
|
||||
util.ssl_.IS_PYOPENSSL = False
|
||||
|
||||
|
||||
def _validate_dependencies_met() -> None:
|
||||
"""
|
||||
Verifies that PyOpenSSL's package-level dependencies have been met.
|
||||
Throws `ImportError` if they are not met.
|
||||
"""
|
||||
# Method added in `cryptography==1.1`; not available in older versions
|
||||
from cryptography.x509.extensions import Extensions
|
||||
|
||||
if getattr(Extensions, "get_extension_for_class", None) is None:
|
||||
raise ImportError(
|
||||
"'cryptography' module missing required functionality. "
|
||||
"Try upgrading to v1.3.4 or newer."
|
||||
)
|
||||
|
||||
# pyOpenSSL 0.14 and above use cryptography for OpenSSL bindings. The _x509
|
||||
# attribute is only present on those versions.
|
||||
from OpenSSL.crypto import X509
|
||||
|
||||
x509 = X509()
|
||||
if getattr(x509, "_x509", None) is None:
|
||||
raise ImportError(
|
||||
"'pyOpenSSL' module missing required functionality. "
|
||||
"Try upgrading to v0.14 or newer."
|
||||
)
|
||||
|
||||
|
||||
def _dnsname_to_stdlib(name: str) -> str | None:
|
||||
"""
|
||||
Converts a dNSName SubjectAlternativeName field to the form used by the
|
||||
standard library on the given Python version.
|
||||
|
||||
Cryptography produces a dNSName as a unicode string that was idna-decoded
|
||||
from ASCII bytes. We need to idna-encode that string to get it back, and
|
||||
then on Python 3 we also need to convert to unicode via UTF-8 (the stdlib
|
||||
uses PyUnicode_FromStringAndSize on it, which decodes via UTF-8).
|
||||
|
||||
If the name cannot be idna-encoded then we return None signalling that
|
||||
the name given should be skipped.
|
||||
"""
|
||||
|
||||
def idna_encode(name: str) -> bytes | None:
|
||||
"""
|
||||
Borrowed wholesale from the Python Cryptography Project. It turns out
|
||||
that we can't just safely call `idna.encode`: it can explode for
|
||||
wildcard names. This avoids that problem.
|
||||
"""
|
||||
import idna
|
||||
|
||||
try:
|
||||
for prefix in ["*.", "."]:
|
||||
if name.startswith(prefix):
|
||||
name = name[len(prefix) :]
|
||||
return prefix.encode("ascii") + idna.encode(name)
|
||||
return idna.encode(name)
|
||||
except idna.core.IDNAError:
|
||||
return None
|
||||
|
||||
# Don't send IPv6 addresses through the IDNA encoder.
|
||||
if ":" in name:
|
||||
return name
|
||||
|
||||
encoded_name = idna_encode(name)
|
||||
if encoded_name is None:
|
||||
return None
|
||||
return encoded_name.decode("utf-8")
|
||||
|
||||
|
||||
def get_subj_alt_name(peer_cert: X509) -> list[tuple[str, str]]:
|
||||
"""
|
||||
Given an PyOpenSSL certificate, provides all the subject alternative names.
|
||||
"""
|
||||
cert = peer_cert.to_cryptography()
|
||||
|
||||
# We want to find the SAN extension. Ask Cryptography to locate it (it's
|
||||
# faster than looping in Python)
|
||||
try:
|
||||
ext = cert.extensions.get_extension_for_class(x509.SubjectAlternativeName).value
|
||||
except x509.ExtensionNotFound:
|
||||
# No such extension, return the empty list.
|
||||
return []
|
||||
except (
|
||||
x509.DuplicateExtension,
|
||||
UnsupportedExtension,
|
||||
x509.UnsupportedGeneralNameType,
|
||||
UnicodeError,
|
||||
) as e:
|
||||
# A problem has been found with the quality of the certificate. Assume
|
||||
# no SAN field is present.
|
||||
log.warning(
|
||||
"A problem was encountered with the certificate that prevented "
|
||||
"urllib3 from finding the SubjectAlternativeName field. This can "
|
||||
"affect certificate validation. The error was %s",
|
||||
e,
|
||||
)
|
||||
return []
|
||||
|
||||
# We want to return dNSName and iPAddress fields. We need to cast the IPs
|
||||
# back to strings because the match_hostname function wants them as
|
||||
# strings.
|
||||
# Sadly the DNS names need to be idna encoded and then, on Python 3, UTF-8
|
||||
# decoded. This is pretty frustrating, but that's what the standard library
|
||||
# does with certificates, and so we need to attempt to do the same.
|
||||
# We also want to skip over names which cannot be idna encoded.
|
||||
names = [
|
||||
("DNS", name)
|
||||
for name in map(_dnsname_to_stdlib, ext.get_values_for_type(x509.DNSName))
|
||||
if name is not None
|
||||
]
|
||||
names.extend(
|
||||
("IP Address", str(name)) for name in ext.get_values_for_type(x509.IPAddress)
|
||||
)
|
||||
|
||||
return names
|
||||
|
||||
|
||||
class WrappedSocket:
|
||||
"""API-compatibility wrapper for Python OpenSSL's Connection-class."""
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
connection: OpenSSL.SSL.Connection,
|
||||
socket: socket_cls,
|
||||
suppress_ragged_eofs: bool = True,
|
||||
) -> None:
|
||||
self.connection = connection
|
||||
self.socket = socket
|
||||
self.suppress_ragged_eofs = suppress_ragged_eofs
|
||||
self._io_refs = 0
|
||||
self._closed = False
|
||||
|
||||
def fileno(self) -> int:
|
||||
return self.socket.fileno()
|
||||
|
||||
# Copy-pasted from Python 3.5 source code
|
||||
def _decref_socketios(self) -> None:
|
||||
if self._io_refs > 0:
|
||||
self._io_refs -= 1
|
||||
if self._closed:
|
||||
self.close()
|
||||
|
||||
def recv(self, *args: typing.Any, **kwargs: typing.Any) -> bytes:
|
||||
try:
|
||||
data = self.connection.recv(*args, **kwargs)
|
||||
except OpenSSL.SSL.SysCallError as e:
|
||||
if self.suppress_ragged_eofs and e.args == (-1, "Unexpected EOF"):
|
||||
return b""
|
||||
else:
|
||||
raise OSError(e.args[0], str(e)) from e
|
||||
except OpenSSL.SSL.ZeroReturnError:
|
||||
if self.connection.get_shutdown() == OpenSSL.SSL.RECEIVED_SHUTDOWN:
|
||||
return b""
|
||||
else:
|
||||
raise
|
||||
except OpenSSL.SSL.WantReadError as e:
|
||||
if not util.wait_for_read(self.socket, self.socket.gettimeout()):
|
||||
raise timeout("The read operation timed out") from e
|
||||
else:
|
||||
return self.recv(*args, **kwargs)
|
||||
|
||||
# TLS 1.3 post-handshake authentication
|
||||
except OpenSSL.SSL.Error as e:
|
||||
raise ssl.SSLError(f"read error: {e!r}") from e
|
||||
else:
|
||||
return data # type: ignore[no-any-return]
|
||||
|
||||
def recv_into(self, *args: typing.Any, **kwargs: typing.Any) -> int:
|
||||
try:
|
||||
return self.connection.recv_into(*args, **kwargs) # type: ignore[no-any-return]
|
||||
except OpenSSL.SSL.SysCallError as e:
|
||||
if self.suppress_ragged_eofs and e.args == (-1, "Unexpected EOF"):
|
||||
return 0
|
||||
else:
|
||||
raise OSError(e.args[0], str(e)) from e
|
||||
except OpenSSL.SSL.ZeroReturnError:
|
||||
if self.connection.get_shutdown() == OpenSSL.SSL.RECEIVED_SHUTDOWN:
|
||||
return 0
|
||||
else:
|
||||
raise
|
||||
except OpenSSL.SSL.WantReadError as e:
|
||||
if not util.wait_for_read(self.socket, self.socket.gettimeout()):
|
||||
raise timeout("The read operation timed out") from e
|
||||
else:
|
||||
return self.recv_into(*args, **kwargs)
|
||||
|
||||
# TLS 1.3 post-handshake authentication
|
||||
except OpenSSL.SSL.Error as e:
|
||||
raise ssl.SSLError(f"read error: {e!r}") from e
|
||||
|
||||
def settimeout(self, timeout: float) -> None:
|
||||
return self.socket.settimeout(timeout)
|
||||
|
||||
def _send_until_done(self, data: bytes) -> int:
|
||||
while True:
|
||||
try:
|
||||
return self.connection.send(data) # type: ignore[no-any-return]
|
||||
except OpenSSL.SSL.WantWriteError as e:
|
||||
if not util.wait_for_write(self.socket, self.socket.gettimeout()):
|
||||
raise timeout() from e
|
||||
continue
|
||||
except OpenSSL.SSL.SysCallError as e:
|
||||
raise OSError(e.args[0], str(e)) from e
|
||||
|
||||
def sendall(self, data: bytes) -> None:
|
||||
total_sent = 0
|
||||
while total_sent < len(data):
|
||||
sent = self._send_until_done(
|
||||
data[total_sent : total_sent + SSL_WRITE_BLOCKSIZE]
|
||||
)
|
||||
total_sent += sent
|
||||
|
||||
def shutdown(self, how: int) -> None:
|
||||
try:
|
||||
self.connection.shutdown()
|
||||
except OpenSSL.SSL.Error as e:
|
||||
raise ssl.SSLError(f"shutdown error: {e!r}") from e
|
||||
|
||||
def close(self) -> None:
|
||||
self._closed = True
|
||||
if self._io_refs <= 0:
|
||||
self._real_close()
|
||||
|
||||
def _real_close(self) -> None:
|
||||
try:
|
||||
return self.connection.close() # type: ignore[no-any-return]
|
||||
except OpenSSL.SSL.Error:
|
||||
return
|
||||
|
||||
def getpeercert(
|
||||
self, binary_form: bool = False
|
||||
) -> dict[str, list[typing.Any]] | None:
|
||||
x509 = self.connection.get_peer_certificate()
|
||||
|
||||
if not x509:
|
||||
return x509 # type: ignore[no-any-return]
|
||||
|
||||
if binary_form:
|
||||
return OpenSSL.crypto.dump_certificate(OpenSSL.crypto.FILETYPE_ASN1, x509) # type: ignore[no-any-return]
|
||||
|
||||
return {
|
||||
"subject": ((("commonName", x509.get_subject().CN),),), # type: ignore[dict-item]
|
||||
"subjectAltName": get_subj_alt_name(x509),
|
||||
}
|
||||
|
||||
def version(self) -> str:
|
||||
return self.connection.get_protocol_version_name() # type: ignore[no-any-return]
|
||||
|
||||
def selected_alpn_protocol(self) -> str | None:
|
||||
alpn_proto = self.connection.get_alpn_proto_negotiated()
|
||||
return alpn_proto.decode() if alpn_proto else None
|
||||
|
||||
|
||||
WrappedSocket.makefile = socket_cls.makefile # type: ignore[attr-defined]
|
||||
|
||||
|
||||
class PyOpenSSLContext:
|
||||
"""
|
||||
I am a wrapper class for the PyOpenSSL ``Context`` object. I am responsible
|
||||
for translating the interface of the standard library ``SSLContext`` object
|
||||
to calls into PyOpenSSL.
|
||||
"""
|
||||
|
||||
def __init__(self, protocol: int) -> None:
|
||||
self.protocol = _openssl_versions[protocol]
|
||||
self._ctx = OpenSSL.SSL.Context(self.protocol)
|
||||
self._options = 0
|
||||
self.check_hostname = False
|
||||
self._minimum_version: int = ssl.TLSVersion.MINIMUM_SUPPORTED
|
||||
self._maximum_version: int = ssl.TLSVersion.MAXIMUM_SUPPORTED
|
||||
self._verify_flags: int = ssl.VERIFY_X509_TRUSTED_FIRST
|
||||
|
||||
@property
|
||||
def options(self) -> int:
|
||||
return self._options
|
||||
|
||||
@options.setter
|
||||
def options(self, value: int) -> None:
|
||||
self._options = value
|
||||
self._set_ctx_options()
|
||||
|
||||
@property
|
||||
def verify_flags(self) -> int:
|
||||
return self._verify_flags
|
||||
|
||||
@verify_flags.setter
|
||||
def verify_flags(self, value: int) -> None:
|
||||
self._verify_flags = value
|
||||
self._ctx.get_cert_store().set_flags(self._verify_flags)
|
||||
|
||||
@property
|
||||
def verify_mode(self) -> int:
|
||||
return _openssl_to_stdlib_verify[self._ctx.get_verify_mode()]
|
||||
|
||||
@verify_mode.setter
|
||||
def verify_mode(self, value: ssl.VerifyMode) -> None:
|
||||
self._ctx.set_verify(_stdlib_to_openssl_verify[value], _verify_callback)
|
||||
|
||||
def set_default_verify_paths(self) -> None:
|
||||
self._ctx.set_default_verify_paths()
|
||||
|
||||
def set_ciphers(self, ciphers: bytes | str) -> None:
|
||||
if isinstance(ciphers, str):
|
||||
ciphers = ciphers.encode("utf-8")
|
||||
self._ctx.set_cipher_list(ciphers)
|
||||
|
||||
def load_verify_locations(
|
||||
self,
|
||||
cafile: str | None = None,
|
||||
capath: str | None = None,
|
||||
cadata: bytes | None = None,
|
||||
) -> None:
|
||||
if cafile is not None:
|
||||
cafile = cafile.encode("utf-8") # type: ignore[assignment]
|
||||
if capath is not None:
|
||||
capath = capath.encode("utf-8") # type: ignore[assignment]
|
||||
try:
|
||||
self._ctx.load_verify_locations(cafile, capath)
|
||||
if cadata is not None:
|
||||
self._ctx.load_verify_locations(BytesIO(cadata))
|
||||
except OpenSSL.SSL.Error as e:
|
||||
raise ssl.SSLError(f"unable to load trusted certificates: {e!r}") from e
|
||||
|
||||
def load_cert_chain(
|
||||
self,
|
||||
certfile: str,
|
||||
keyfile: str | None = None,
|
||||
password: str | None = None,
|
||||
) -> None:
|
||||
try:
|
||||
self._ctx.use_certificate_chain_file(certfile)
|
||||
if password is not None:
|
||||
if not isinstance(password, bytes):
|
||||
password = password.encode("utf-8") # type: ignore[assignment]
|
||||
self._ctx.set_passwd_cb(lambda *_: password)
|
||||
self._ctx.use_privatekey_file(keyfile or certfile)
|
||||
except OpenSSL.SSL.Error as e:
|
||||
raise ssl.SSLError(f"Unable to load certificate chain: {e!r}") from e
|
||||
|
||||
def set_alpn_protocols(self, protocols: list[bytes | str]) -> None:
|
||||
protocols = [util.util.to_bytes(p, "ascii") for p in protocols]
|
||||
return self._ctx.set_alpn_protos(protocols) # type: ignore[no-any-return]
|
||||
|
||||
def wrap_socket(
|
||||
self,
|
||||
sock: socket_cls,
|
||||
server_side: bool = False,
|
||||
do_handshake_on_connect: bool = True,
|
||||
suppress_ragged_eofs: bool = True,
|
||||
server_hostname: bytes | str | None = None,
|
||||
) -> WrappedSocket:
|
||||
cnx = OpenSSL.SSL.Connection(self._ctx, sock)
|
||||
|
||||
# If server_hostname is an IP, don't use it for SNI, per RFC6066 Section 3
|
||||
if server_hostname and not util.ssl_.is_ipaddress(server_hostname):
|
||||
if isinstance(server_hostname, str):
|
||||
server_hostname = server_hostname.encode("utf-8")
|
||||
cnx.set_tlsext_host_name(server_hostname)
|
||||
|
||||
cnx.set_connect_state()
|
||||
|
||||
while True:
|
||||
try:
|
||||
cnx.do_handshake()
|
||||
except OpenSSL.SSL.WantReadError as e:
|
||||
if not util.wait_for_read(sock, sock.gettimeout()):
|
||||
raise timeout("select timed out") from e
|
||||
continue
|
||||
except OpenSSL.SSL.Error as e:
|
||||
raise ssl.SSLError(f"bad handshake: {e!r}") from e
|
||||
break
|
||||
|
||||
return WrappedSocket(cnx, sock)
|
||||
|
||||
def _set_ctx_options(self) -> None:
|
||||
self._ctx.set_options(
|
||||
self._options
|
||||
| _openssl_to_ssl_minimum_version[self._minimum_version]
|
||||
| _openssl_to_ssl_maximum_version[self._maximum_version]
|
||||
)
|
||||
|
||||
@property
|
||||
def minimum_version(self) -> int:
|
||||
return self._minimum_version
|
||||
|
||||
@minimum_version.setter
|
||||
def minimum_version(self, minimum_version: int) -> None:
|
||||
self._minimum_version = minimum_version
|
||||
self._set_ctx_options()
|
||||
|
||||
@property
|
||||
def maximum_version(self) -> int:
|
||||
return self._maximum_version
|
||||
|
||||
@maximum_version.setter
|
||||
def maximum_version(self, maximum_version: int) -> None:
|
||||
self._maximum_version = maximum_version
|
||||
self._set_ctx_options()
|
||||
|
||||
|
||||
def _verify_callback(
|
||||
cnx: OpenSSL.SSL.Connection,
|
||||
x509: X509,
|
||||
err_no: int,
|
||||
err_depth: int,
|
||||
return_code: int,
|
||||
) -> bool:
|
||||
return err_no == 0
|
||||
@@ -0,0 +1,228 @@
|
||||
"""
|
||||
This module contains provisional support for SOCKS proxies from within
|
||||
urllib3. This module supports SOCKS4, SOCKS4A (an extension of SOCKS4), and
|
||||
SOCKS5. To enable its functionality, either install PySocks or install this
|
||||
module with the ``socks`` extra.
|
||||
|
||||
The SOCKS implementation supports the full range of urllib3 features. It also
|
||||
supports the following SOCKS features:
|
||||
|
||||
- SOCKS4A (``proxy_url='socks4a://...``)
|
||||
- SOCKS4 (``proxy_url='socks4://...``)
|
||||
- SOCKS5 with remote DNS (``proxy_url='socks5h://...``)
|
||||
- SOCKS5 with local DNS (``proxy_url='socks5://...``)
|
||||
- Usernames and passwords for the SOCKS proxy
|
||||
|
||||
.. note::
|
||||
It is recommended to use ``socks5h://`` or ``socks4a://`` schemes in
|
||||
your ``proxy_url`` to ensure that DNS resolution is done from the remote
|
||||
server instead of client-side when connecting to a domain name.
|
||||
|
||||
SOCKS4 supports IPv4 and domain names with the SOCKS4A extension. SOCKS5
|
||||
supports IPv4, IPv6, and domain names.
|
||||
|
||||
When connecting to a SOCKS4 proxy the ``username`` portion of the ``proxy_url``
|
||||
will be sent as the ``userid`` section of the SOCKS request:
|
||||
|
||||
.. code-block:: python
|
||||
|
||||
proxy_url="socks4a://<userid>@proxy-host"
|
||||
|
||||
When connecting to a SOCKS5 proxy the ``username`` and ``password`` portion
|
||||
of the ``proxy_url`` will be sent as the username/password to authenticate
|
||||
with the proxy:
|
||||
|
||||
.. code-block:: python
|
||||
|
||||
proxy_url="socks5h://<username>:<password>@proxy-host"
|
||||
|
||||
"""
|
||||
|
||||
from __future__ import annotations
|
||||
|
||||
try:
|
||||
import socks # type: ignore[import-untyped]
|
||||
except ImportError:
|
||||
import warnings
|
||||
|
||||
from ..exceptions import DependencyWarning
|
||||
|
||||
warnings.warn(
|
||||
(
|
||||
"SOCKS support in urllib3 requires the installation of optional "
|
||||
"dependencies: specifically, PySocks. For more information, see "
|
||||
"https://urllib3.readthedocs.io/en/latest/advanced-usage.html#socks-proxies"
|
||||
),
|
||||
DependencyWarning,
|
||||
)
|
||||
raise
|
||||
|
||||
import typing
|
||||
from socket import timeout as SocketTimeout
|
||||
|
||||
from ..connection import HTTPConnection, HTTPSConnection
|
||||
from ..connectionpool import HTTPConnectionPool, HTTPSConnectionPool
|
||||
from ..exceptions import ConnectTimeoutError, NewConnectionError
|
||||
from ..poolmanager import PoolManager
|
||||
from ..util.url import parse_url
|
||||
|
||||
try:
|
||||
import ssl
|
||||
except ImportError:
|
||||
ssl = None # type: ignore[assignment]
|
||||
|
||||
|
||||
class _TYPE_SOCKS_OPTIONS(typing.TypedDict):
|
||||
socks_version: int
|
||||
proxy_host: str | None
|
||||
proxy_port: str | None
|
||||
username: str | None
|
||||
password: str | None
|
||||
rdns: bool
|
||||
|
||||
|
||||
class SOCKSConnection(HTTPConnection):
|
||||
"""
|
||||
A plain-text HTTP connection that connects via a SOCKS proxy.
|
||||
"""
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
_socks_options: _TYPE_SOCKS_OPTIONS,
|
||||
*args: typing.Any,
|
||||
**kwargs: typing.Any,
|
||||
) -> None:
|
||||
self._socks_options = _socks_options
|
||||
super().__init__(*args, **kwargs)
|
||||
|
||||
def _new_conn(self) -> socks.socksocket:
|
||||
"""
|
||||
Establish a new connection via the SOCKS proxy.
|
||||
"""
|
||||
extra_kw: dict[str, typing.Any] = {}
|
||||
if self.source_address:
|
||||
extra_kw["source_address"] = self.source_address
|
||||
|
||||
if self.socket_options:
|
||||
extra_kw["socket_options"] = self.socket_options
|
||||
|
||||
try:
|
||||
conn = socks.create_connection(
|
||||
(self.host, self.port),
|
||||
proxy_type=self._socks_options["socks_version"],
|
||||
proxy_addr=self._socks_options["proxy_host"],
|
||||
proxy_port=self._socks_options["proxy_port"],
|
||||
proxy_username=self._socks_options["username"],
|
||||
proxy_password=self._socks_options["password"],
|
||||
proxy_rdns=self._socks_options["rdns"],
|
||||
timeout=self.timeout,
|
||||
**extra_kw,
|
||||
)
|
||||
|
||||
except SocketTimeout as e:
|
||||
raise ConnectTimeoutError(
|
||||
self,
|
||||
f"Connection to {self.host} timed out. (connect timeout={self.timeout})",
|
||||
) from e
|
||||
|
||||
except socks.ProxyError as e:
|
||||
# This is fragile as hell, but it seems to be the only way to raise
|
||||
# useful errors here.
|
||||
if e.socket_err:
|
||||
error = e.socket_err
|
||||
if isinstance(error, SocketTimeout):
|
||||
raise ConnectTimeoutError(
|
||||
self,
|
||||
f"Connection to {self.host} timed out. (connect timeout={self.timeout})",
|
||||
) from e
|
||||
else:
|
||||
# Adding `from e` messes with coverage somehow, so it's omitted.
|
||||
# See #2386.
|
||||
raise NewConnectionError(
|
||||
self, f"Failed to establish a new connection: {error}"
|
||||
)
|
||||
else:
|
||||
raise NewConnectionError(
|
||||
self, f"Failed to establish a new connection: {e}"
|
||||
) from e
|
||||
|
||||
except OSError as e: # Defensive: PySocks should catch all these.
|
||||
raise NewConnectionError(
|
||||
self, f"Failed to establish a new connection: {e}"
|
||||
) from e
|
||||
|
||||
return conn
|
||||
|
||||
|
||||
# We don't need to duplicate the Verified/Unverified distinction from
|
||||
# urllib3/connection.py here because the HTTPSConnection will already have been
|
||||
# correctly set to either the Verified or Unverified form by that module. This
|
||||
# means the SOCKSHTTPSConnection will automatically be the correct type.
|
||||
class SOCKSHTTPSConnection(SOCKSConnection, HTTPSConnection):
|
||||
pass
|
||||
|
||||
|
||||
class SOCKSHTTPConnectionPool(HTTPConnectionPool):
|
||||
ConnectionCls = SOCKSConnection
|
||||
|
||||
|
||||
class SOCKSHTTPSConnectionPool(HTTPSConnectionPool):
|
||||
ConnectionCls = SOCKSHTTPSConnection
|
||||
|
||||
|
||||
class SOCKSProxyManager(PoolManager):
|
||||
"""
|
||||
A version of the urllib3 ProxyManager that routes connections via the
|
||||
defined SOCKS proxy.
|
||||
"""
|
||||
|
||||
pool_classes_by_scheme = {
|
||||
"http": SOCKSHTTPConnectionPool,
|
||||
"https": SOCKSHTTPSConnectionPool,
|
||||
}
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
proxy_url: str,
|
||||
username: str | None = None,
|
||||
password: str | None = None,
|
||||
num_pools: int = 10,
|
||||
headers: typing.Mapping[str, str] | None = None,
|
||||
**connection_pool_kw: typing.Any,
|
||||
):
|
||||
parsed = parse_url(proxy_url)
|
||||
|
||||
if username is None and password is None and parsed.auth is not None:
|
||||
split = parsed.auth.split(":")
|
||||
if len(split) == 2:
|
||||
username, password = split
|
||||
if parsed.scheme == "socks5":
|
||||
socks_version = socks.PROXY_TYPE_SOCKS5
|
||||
rdns = False
|
||||
elif parsed.scheme == "socks5h":
|
||||
socks_version = socks.PROXY_TYPE_SOCKS5
|
||||
rdns = True
|
||||
elif parsed.scheme == "socks4":
|
||||
socks_version = socks.PROXY_TYPE_SOCKS4
|
||||
rdns = False
|
||||
elif parsed.scheme == "socks4a":
|
||||
socks_version = socks.PROXY_TYPE_SOCKS4
|
||||
rdns = True
|
||||
else:
|
||||
raise ValueError(f"Unable to determine SOCKS version from {proxy_url}")
|
||||
|
||||
self.proxy_url = proxy_url
|
||||
|
||||
socks_options = {
|
||||
"socks_version": socks_version,
|
||||
"proxy_host": parsed.host,
|
||||
"proxy_port": parsed.port,
|
||||
"username": username,
|
||||
"password": password,
|
||||
"rdns": rdns,
|
||||
}
|
||||
connection_pool_kw["_socks_options"] = socks_options
|
||||
|
||||
super().__init__(num_pools, headers, **connection_pool_kw)
|
||||
|
||||
self.pool_classes_by_scheme = SOCKSProxyManager.pool_classes_by_scheme
|
||||
335
path/to/venv/lib/python3.12/site-packages/urllib3/exceptions.py
Normal file
335
path/to/venv/lib/python3.12/site-packages/urllib3/exceptions.py
Normal file
@@ -0,0 +1,335 @@
|
||||
from __future__ import annotations
|
||||
|
||||
import socket
|
||||
import typing
|
||||
import warnings
|
||||
from email.errors import MessageDefect
|
||||
from http.client import IncompleteRead as httplib_IncompleteRead
|
||||
|
||||
if typing.TYPE_CHECKING:
|
||||
from .connection import HTTPConnection
|
||||
from .connectionpool import ConnectionPool
|
||||
from .response import HTTPResponse
|
||||
from .util.retry import Retry
|
||||
|
||||
# Base Exceptions
|
||||
|
||||
|
||||
class HTTPError(Exception):
|
||||
"""Base exception used by this module."""
|
||||
|
||||
|
||||
class HTTPWarning(Warning):
|
||||
"""Base warning used by this module."""
|
||||
|
||||
|
||||
_TYPE_REDUCE_RESULT = tuple[typing.Callable[..., object], tuple[object, ...]]
|
||||
|
||||
|
||||
class PoolError(HTTPError):
|
||||
"""Base exception for errors caused within a pool."""
|
||||
|
||||
def __init__(self, pool: ConnectionPool, message: str) -> None:
|
||||
self.pool = pool
|
||||
self._message = message
|
||||
super().__init__(f"{pool}: {message}")
|
||||
|
||||
def __reduce__(self) -> _TYPE_REDUCE_RESULT:
|
||||
# For pickling purposes.
|
||||
return self.__class__, (None, self._message)
|
||||
|
||||
|
||||
class RequestError(PoolError):
|
||||
"""Base exception for PoolErrors that have associated URLs."""
|
||||
|
||||
def __init__(self, pool: ConnectionPool, url: str | None, message: str) -> None:
|
||||
self.url = url
|
||||
super().__init__(pool, message)
|
||||
|
||||
def __reduce__(self) -> _TYPE_REDUCE_RESULT:
|
||||
# For pickling purposes.
|
||||
return self.__class__, (None, self.url, self._message)
|
||||
|
||||
|
||||
class SSLError(HTTPError):
|
||||
"""Raised when SSL certificate fails in an HTTPS connection."""
|
||||
|
||||
|
||||
class ProxyError(HTTPError):
|
||||
"""Raised when the connection to a proxy fails."""
|
||||
|
||||
# The original error is also available as __cause__.
|
||||
original_error: Exception
|
||||
|
||||
def __init__(self, message: str, error: Exception) -> None:
|
||||
super().__init__(message, error)
|
||||
self.original_error = error
|
||||
|
||||
|
||||
class DecodeError(HTTPError):
|
||||
"""Raised when automatic decoding based on Content-Type fails."""
|
||||
|
||||
|
||||
class ProtocolError(HTTPError):
|
||||
"""Raised when something unexpected happens mid-request/response."""
|
||||
|
||||
|
||||
#: Renamed to ProtocolError but aliased for backwards compatibility.
|
||||
ConnectionError = ProtocolError
|
||||
|
||||
|
||||
# Leaf Exceptions
|
||||
|
||||
|
||||
class MaxRetryError(RequestError):
|
||||
"""Raised when the maximum number of retries is exceeded.
|
||||
|
||||
:param pool: The connection pool
|
||||
:type pool: :class:`~urllib3.connectionpool.HTTPConnectionPool`
|
||||
:param str url: The requested Url
|
||||
:param reason: The underlying error
|
||||
:type reason: :class:`Exception`
|
||||
|
||||
"""
|
||||
|
||||
def __init__(
|
||||
self, pool: ConnectionPool, url: str | None, reason: Exception | None = None
|
||||
) -> None:
|
||||
self.reason = reason
|
||||
|
||||
message = f"Max retries exceeded with url: {url} (Caused by {reason!r})"
|
||||
|
||||
super().__init__(pool, url, message)
|
||||
|
||||
def __reduce__(self) -> _TYPE_REDUCE_RESULT:
|
||||
# For pickling purposes.
|
||||
return self.__class__, (None, self.url, self.reason)
|
||||
|
||||
|
||||
class HostChangedError(RequestError):
|
||||
"""Raised when an existing pool gets a request for a foreign host."""
|
||||
|
||||
def __init__(
|
||||
self, pool: ConnectionPool, url: str, retries: Retry | int = 3
|
||||
) -> None:
|
||||
message = f"Tried to open a foreign host with url: {url}"
|
||||
super().__init__(pool, url, message)
|
||||
self.retries = retries
|
||||
|
||||
|
||||
class TimeoutStateError(HTTPError):
|
||||
"""Raised when passing an invalid state to a timeout"""
|
||||
|
||||
|
||||
class TimeoutError(HTTPError):
|
||||
"""Raised when a socket timeout error occurs.
|
||||
|
||||
Catching this error will catch both :exc:`ReadTimeoutErrors
|
||||
<ReadTimeoutError>` and :exc:`ConnectTimeoutErrors <ConnectTimeoutError>`.
|
||||
"""
|
||||
|
||||
|
||||
class ReadTimeoutError(TimeoutError, RequestError):
|
||||
"""Raised when a socket timeout occurs while receiving data from a server"""
|
||||
|
||||
|
||||
# This timeout error does not have a URL attached and needs to inherit from the
|
||||
# base HTTPError
|
||||
class ConnectTimeoutError(TimeoutError):
|
||||
"""Raised when a socket timeout occurs while connecting to a server"""
|
||||
|
||||
|
||||
class NewConnectionError(ConnectTimeoutError, HTTPError):
|
||||
"""Raised when we fail to establish a new connection. Usually ECONNREFUSED."""
|
||||
|
||||
def __init__(self, conn: HTTPConnection, message: str) -> None:
|
||||
self.conn = conn
|
||||
self._message = message
|
||||
super().__init__(f"{conn}: {message}")
|
||||
|
||||
def __reduce__(self) -> _TYPE_REDUCE_RESULT:
|
||||
# For pickling purposes.
|
||||
return self.__class__, (None, self._message)
|
||||
|
||||
@property
|
||||
def pool(self) -> HTTPConnection:
|
||||
warnings.warn(
|
||||
"The 'pool' property is deprecated and will be removed "
|
||||
"in urllib3 v2.1.0. Use 'conn' instead.",
|
||||
DeprecationWarning,
|
||||
stacklevel=2,
|
||||
)
|
||||
|
||||
return self.conn
|
||||
|
||||
|
||||
class NameResolutionError(NewConnectionError):
|
||||
"""Raised when host name resolution fails."""
|
||||
|
||||
def __init__(self, host: str, conn: HTTPConnection, reason: socket.gaierror):
|
||||
message = f"Failed to resolve '{host}' ({reason})"
|
||||
self._host = host
|
||||
self._reason = reason
|
||||
super().__init__(conn, message)
|
||||
|
||||
def __reduce__(self) -> _TYPE_REDUCE_RESULT:
|
||||
# For pickling purposes.
|
||||
return self.__class__, (self._host, None, self._reason)
|
||||
|
||||
|
||||
class EmptyPoolError(PoolError):
|
||||
"""Raised when a pool runs out of connections and no more are allowed."""
|
||||
|
||||
|
||||
class FullPoolError(PoolError):
|
||||
"""Raised when we try to add a connection to a full pool in blocking mode."""
|
||||
|
||||
|
||||
class ClosedPoolError(PoolError):
|
||||
"""Raised when a request enters a pool after the pool has been closed."""
|
||||
|
||||
|
||||
class LocationValueError(ValueError, HTTPError):
|
||||
"""Raised when there is something wrong with a given URL input."""
|
||||
|
||||
|
||||
class LocationParseError(LocationValueError):
|
||||
"""Raised when get_host or similar fails to parse the URL input."""
|
||||
|
||||
def __init__(self, location: str) -> None:
|
||||
message = f"Failed to parse: {location}"
|
||||
super().__init__(message)
|
||||
|
||||
self.location = location
|
||||
|
||||
|
||||
class URLSchemeUnknown(LocationValueError):
|
||||
"""Raised when a URL input has an unsupported scheme."""
|
||||
|
||||
def __init__(self, scheme: str):
|
||||
message = f"Not supported URL scheme {scheme}"
|
||||
super().__init__(message)
|
||||
|
||||
self.scheme = scheme
|
||||
|
||||
|
||||
class ResponseError(HTTPError):
|
||||
"""Used as a container for an error reason supplied in a MaxRetryError."""
|
||||
|
||||
GENERIC_ERROR = "too many error responses"
|
||||
SPECIFIC_ERROR = "too many {status_code} error responses"
|
||||
|
||||
|
||||
class SecurityWarning(HTTPWarning):
|
||||
"""Warned when performing security reducing actions"""
|
||||
|
||||
|
||||
class InsecureRequestWarning(SecurityWarning):
|
||||
"""Warned when making an unverified HTTPS request."""
|
||||
|
||||
|
||||
class NotOpenSSLWarning(SecurityWarning):
|
||||
"""Warned when using unsupported SSL library"""
|
||||
|
||||
|
||||
class SystemTimeWarning(SecurityWarning):
|
||||
"""Warned when system time is suspected to be wrong"""
|
||||
|
||||
|
||||
class InsecurePlatformWarning(SecurityWarning):
|
||||
"""Warned when certain TLS/SSL configuration is not available on a platform."""
|
||||
|
||||
|
||||
class DependencyWarning(HTTPWarning):
|
||||
"""
|
||||
Warned when an attempt is made to import a module with missing optional
|
||||
dependencies.
|
||||
"""
|
||||
|
||||
|
||||
class ResponseNotChunked(ProtocolError, ValueError):
|
||||
"""Response needs to be chunked in order to read it as chunks."""
|
||||
|
||||
|
||||
class BodyNotHttplibCompatible(HTTPError):
|
||||
"""
|
||||
Body should be :class:`http.client.HTTPResponse` like
|
||||
(have an fp attribute which returns raw chunks) for read_chunked().
|
||||
"""
|
||||
|
||||
|
||||
class IncompleteRead(HTTPError, httplib_IncompleteRead):
|
||||
"""
|
||||
Response length doesn't match expected Content-Length
|
||||
|
||||
Subclass of :class:`http.client.IncompleteRead` to allow int value
|
||||
for ``partial`` to avoid creating large objects on streamed reads.
|
||||
"""
|
||||
|
||||
partial: int # type: ignore[assignment]
|
||||
expected: int
|
||||
|
||||
def __init__(self, partial: int, expected: int) -> None:
|
||||
self.partial = partial
|
||||
self.expected = expected
|
||||
|
||||
def __repr__(self) -> str:
|
||||
return "IncompleteRead(%i bytes read, %i more expected)" % (
|
||||
self.partial,
|
||||
self.expected,
|
||||
)
|
||||
|
||||
|
||||
class InvalidChunkLength(HTTPError, httplib_IncompleteRead):
|
||||
"""Invalid chunk length in a chunked response."""
|
||||
|
||||
def __init__(self, response: HTTPResponse, length: bytes) -> None:
|
||||
self.partial: int = response.tell() # type: ignore[assignment]
|
||||
self.expected: int | None = response.length_remaining
|
||||
self.response = response
|
||||
self.length = length
|
||||
|
||||
def __repr__(self) -> str:
|
||||
return "InvalidChunkLength(got length %r, %i bytes read)" % (
|
||||
self.length,
|
||||
self.partial,
|
||||
)
|
||||
|
||||
|
||||
class InvalidHeader(HTTPError):
|
||||
"""The header provided was somehow invalid."""
|
||||
|
||||
|
||||
class ProxySchemeUnknown(AssertionError, URLSchemeUnknown):
|
||||
"""ProxyManager does not support the supplied scheme"""
|
||||
|
||||
# TODO(t-8ch): Stop inheriting from AssertionError in v2.0.
|
||||
|
||||
def __init__(self, scheme: str | None) -> None:
|
||||
# 'localhost' is here because our URL parser parses
|
||||
# localhost:8080 -> scheme=localhost, remove if we fix this.
|
||||
if scheme == "localhost":
|
||||
scheme = None
|
||||
if scheme is None:
|
||||
message = "Proxy URL had no scheme, should start with http:// or https://"
|
||||
else:
|
||||
message = f"Proxy URL had unsupported scheme {scheme}, should use http:// or https://"
|
||||
super().__init__(message)
|
||||
|
||||
|
||||
class ProxySchemeUnsupported(ValueError):
|
||||
"""Fetching HTTPS resources through HTTPS proxies is unsupported"""
|
||||
|
||||
|
||||
class HeaderParsingError(HTTPError):
|
||||
"""Raised by assert_header_parsing, but we convert it to a log.warning statement."""
|
||||
|
||||
def __init__(
|
||||
self, defects: list[MessageDefect], unparsed_data: bytes | str | None
|
||||
) -> None:
|
||||
message = f"{defects or 'Unknown'}, unparsed data: {unparsed_data!r}"
|
||||
super().__init__(message)
|
||||
|
||||
|
||||
class UnrewindableBodyError(HTTPError):
|
||||
"""urllib3 encountered an error when trying to rewind a body"""
|
||||
341
path/to/venv/lib/python3.12/site-packages/urllib3/fields.py
Normal file
341
path/to/venv/lib/python3.12/site-packages/urllib3/fields.py
Normal file
@@ -0,0 +1,341 @@
|
||||
from __future__ import annotations
|
||||
|
||||
import email.utils
|
||||
import mimetypes
|
||||
import typing
|
||||
|
||||
_TYPE_FIELD_VALUE = typing.Union[str, bytes]
|
||||
_TYPE_FIELD_VALUE_TUPLE = typing.Union[
|
||||
_TYPE_FIELD_VALUE,
|
||||
tuple[str, _TYPE_FIELD_VALUE],
|
||||
tuple[str, _TYPE_FIELD_VALUE, str],
|
||||
]
|
||||
|
||||
|
||||
def guess_content_type(
|
||||
filename: str | None, default: str = "application/octet-stream"
|
||||
) -> str:
|
||||
"""
|
||||
Guess the "Content-Type" of a file.
|
||||
|
||||
:param filename:
|
||||
The filename to guess the "Content-Type" of using :mod:`mimetypes`.
|
||||
:param default:
|
||||
If no "Content-Type" can be guessed, default to `default`.
|
||||
"""
|
||||
if filename:
|
||||
return mimetypes.guess_type(filename)[0] or default
|
||||
return default
|
||||
|
||||
|
||||
def format_header_param_rfc2231(name: str, value: _TYPE_FIELD_VALUE) -> str:
|
||||
"""
|
||||
Helper function to format and quote a single header parameter using the
|
||||
strategy defined in RFC 2231.
|
||||
|
||||
Particularly useful for header parameters which might contain
|
||||
non-ASCII values, like file names. This follows
|
||||
`RFC 2388 Section 4.4 <https://tools.ietf.org/html/rfc2388#section-4.4>`_.
|
||||
|
||||
:param name:
|
||||
The name of the parameter, a string expected to be ASCII only.
|
||||
:param value:
|
||||
The value of the parameter, provided as ``bytes`` or `str``.
|
||||
:returns:
|
||||
An RFC-2231-formatted unicode string.
|
||||
|
||||
.. deprecated:: 2.0.0
|
||||
Will be removed in urllib3 v2.1.0. This is not valid for
|
||||
``multipart/form-data`` header parameters.
|
||||
"""
|
||||
import warnings
|
||||
|
||||
warnings.warn(
|
||||
"'format_header_param_rfc2231' is deprecated and will be "
|
||||
"removed in urllib3 v2.1.0. This is not valid for "
|
||||
"multipart/form-data header parameters.",
|
||||
DeprecationWarning,
|
||||
stacklevel=2,
|
||||
)
|
||||
|
||||
if isinstance(value, bytes):
|
||||
value = value.decode("utf-8")
|
||||
|
||||
if not any(ch in value for ch in '"\\\r\n'):
|
||||
result = f'{name}="{value}"'
|
||||
try:
|
||||
result.encode("ascii")
|
||||
except (UnicodeEncodeError, UnicodeDecodeError):
|
||||
pass
|
||||
else:
|
||||
return result
|
||||
|
||||
value = email.utils.encode_rfc2231(value, "utf-8")
|
||||
value = f"{name}*={value}"
|
||||
|
||||
return value
|
||||
|
||||
|
||||
def format_multipart_header_param(name: str, value: _TYPE_FIELD_VALUE) -> str:
|
||||
"""
|
||||
Format and quote a single multipart header parameter.
|
||||
|
||||
This follows the `WHATWG HTML Standard`_ as of 2021/06/10, matching
|
||||
the behavior of current browser and curl versions. Values are
|
||||
assumed to be UTF-8. The ``\\n``, ``\\r``, and ``"`` characters are
|
||||
percent encoded.
|
||||
|
||||
.. _WHATWG HTML Standard:
|
||||
https://html.spec.whatwg.org/multipage/
|
||||
form-control-infrastructure.html#multipart-form-data
|
||||
|
||||
:param name:
|
||||
The name of the parameter, an ASCII-only ``str``.
|
||||
:param value:
|
||||
The value of the parameter, a ``str`` or UTF-8 encoded
|
||||
``bytes``.
|
||||
:returns:
|
||||
A string ``name="value"`` with the escaped value.
|
||||
|
||||
.. versionchanged:: 2.0.0
|
||||
Matches the WHATWG HTML Standard as of 2021/06/10. Control
|
||||
characters are no longer percent encoded.
|
||||
|
||||
.. versionchanged:: 2.0.0
|
||||
Renamed from ``format_header_param_html5`` and
|
||||
``format_header_param``. The old names will be removed in
|
||||
urllib3 v2.1.0.
|
||||
"""
|
||||
if isinstance(value, bytes):
|
||||
value = value.decode("utf-8")
|
||||
|
||||
# percent encode \n \r "
|
||||
value = value.translate({10: "%0A", 13: "%0D", 34: "%22"})
|
||||
return f'{name}="{value}"'
|
||||
|
||||
|
||||
def format_header_param_html5(name: str, value: _TYPE_FIELD_VALUE) -> str:
|
||||
"""
|
||||
.. deprecated:: 2.0.0
|
||||
Renamed to :func:`format_multipart_header_param`. Will be
|
||||
removed in urllib3 v2.1.0.
|
||||
"""
|
||||
import warnings
|
||||
|
||||
warnings.warn(
|
||||
"'format_header_param_html5' has been renamed to "
|
||||
"'format_multipart_header_param'. The old name will be "
|
||||
"removed in urllib3 v2.1.0.",
|
||||
DeprecationWarning,
|
||||
stacklevel=2,
|
||||
)
|
||||
return format_multipart_header_param(name, value)
|
||||
|
||||
|
||||
def format_header_param(name: str, value: _TYPE_FIELD_VALUE) -> str:
|
||||
"""
|
||||
.. deprecated:: 2.0.0
|
||||
Renamed to :func:`format_multipart_header_param`. Will be
|
||||
removed in urllib3 v2.1.0.
|
||||
"""
|
||||
import warnings
|
||||
|
||||
warnings.warn(
|
||||
"'format_header_param' has been renamed to "
|
||||
"'format_multipart_header_param'. The old name will be "
|
||||
"removed in urllib3 v2.1.0.",
|
||||
DeprecationWarning,
|
||||
stacklevel=2,
|
||||
)
|
||||
return format_multipart_header_param(name, value)
|
||||
|
||||
|
||||
class RequestField:
|
||||
"""
|
||||
A data container for request body parameters.
|
||||
|
||||
:param name:
|
||||
The name of this request field. Must be unicode.
|
||||
:param data:
|
||||
The data/value body.
|
||||
:param filename:
|
||||
An optional filename of the request field. Must be unicode.
|
||||
:param headers:
|
||||
An optional dict-like object of headers to initially use for the field.
|
||||
|
||||
.. versionchanged:: 2.0.0
|
||||
The ``header_formatter`` parameter is deprecated and will
|
||||
be removed in urllib3 v2.1.0.
|
||||
"""
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
name: str,
|
||||
data: _TYPE_FIELD_VALUE,
|
||||
filename: str | None = None,
|
||||
headers: typing.Mapping[str, str] | None = None,
|
||||
header_formatter: typing.Callable[[str, _TYPE_FIELD_VALUE], str] | None = None,
|
||||
):
|
||||
self._name = name
|
||||
self._filename = filename
|
||||
self.data = data
|
||||
self.headers: dict[str, str | None] = {}
|
||||
if headers:
|
||||
self.headers = dict(headers)
|
||||
|
||||
if header_formatter is not None:
|
||||
import warnings
|
||||
|
||||
warnings.warn(
|
||||
"The 'header_formatter' parameter is deprecated and "
|
||||
"will be removed in urllib3 v2.1.0.",
|
||||
DeprecationWarning,
|
||||
stacklevel=2,
|
||||
)
|
||||
self.header_formatter = header_formatter
|
||||
else:
|
||||
self.header_formatter = format_multipart_header_param
|
||||
|
||||
@classmethod
|
||||
def from_tuples(
|
||||
cls,
|
||||
fieldname: str,
|
||||
value: _TYPE_FIELD_VALUE_TUPLE,
|
||||
header_formatter: typing.Callable[[str, _TYPE_FIELD_VALUE], str] | None = None,
|
||||
) -> RequestField:
|
||||
"""
|
||||
A :class:`~urllib3.fields.RequestField` factory from old-style tuple parameters.
|
||||
|
||||
Supports constructing :class:`~urllib3.fields.RequestField` from
|
||||
parameter of key/value strings AND key/filetuple. A filetuple is a
|
||||
(filename, data, MIME type) tuple where the MIME type is optional.
|
||||
For example::
|
||||
|
||||
'foo': 'bar',
|
||||
'fakefile': ('foofile.txt', 'contents of foofile'),
|
||||
'realfile': ('barfile.txt', open('realfile').read()),
|
||||
'typedfile': ('bazfile.bin', open('bazfile').read(), 'image/jpeg'),
|
||||
'nonamefile': 'contents of nonamefile field',
|
||||
|
||||
Field names and filenames must be unicode.
|
||||
"""
|
||||
filename: str | None
|
||||
content_type: str | None
|
||||
data: _TYPE_FIELD_VALUE
|
||||
|
||||
if isinstance(value, tuple):
|
||||
if len(value) == 3:
|
||||
filename, data, content_type = value
|
||||
else:
|
||||
filename, data = value
|
||||
content_type = guess_content_type(filename)
|
||||
else:
|
||||
filename = None
|
||||
content_type = None
|
||||
data = value
|
||||
|
||||
request_param = cls(
|
||||
fieldname, data, filename=filename, header_formatter=header_formatter
|
||||
)
|
||||
request_param.make_multipart(content_type=content_type)
|
||||
|
||||
return request_param
|
||||
|
||||
def _render_part(self, name: str, value: _TYPE_FIELD_VALUE) -> str:
|
||||
"""
|
||||
Override this method to change how each multipart header
|
||||
parameter is formatted. By default, this calls
|
||||
:func:`format_multipart_header_param`.
|
||||
|
||||
:param name:
|
||||
The name of the parameter, an ASCII-only ``str``.
|
||||
:param value:
|
||||
The value of the parameter, a ``str`` or UTF-8 encoded
|
||||
``bytes``.
|
||||
|
||||
:meta public:
|
||||
"""
|
||||
return self.header_formatter(name, value)
|
||||
|
||||
def _render_parts(
|
||||
self,
|
||||
header_parts: (
|
||||
dict[str, _TYPE_FIELD_VALUE | None]
|
||||
| typing.Sequence[tuple[str, _TYPE_FIELD_VALUE | None]]
|
||||
),
|
||||
) -> str:
|
||||
"""
|
||||
Helper function to format and quote a single header.
|
||||
|
||||
Useful for single headers that are composed of multiple items. E.g.,
|
||||
'Content-Disposition' fields.
|
||||
|
||||
:param header_parts:
|
||||
A sequence of (k, v) tuples or a :class:`dict` of (k, v) to format
|
||||
as `k1="v1"; k2="v2"; ...`.
|
||||
"""
|
||||
iterable: typing.Iterable[tuple[str, _TYPE_FIELD_VALUE | None]]
|
||||
|
||||
parts = []
|
||||
if isinstance(header_parts, dict):
|
||||
iterable = header_parts.items()
|
||||
else:
|
||||
iterable = header_parts
|
||||
|
||||
for name, value in iterable:
|
||||
if value is not None:
|
||||
parts.append(self._render_part(name, value))
|
||||
|
||||
return "; ".join(parts)
|
||||
|
||||
def render_headers(self) -> str:
|
||||
"""
|
||||
Renders the headers for this request field.
|
||||
"""
|
||||
lines = []
|
||||
|
||||
sort_keys = ["Content-Disposition", "Content-Type", "Content-Location"]
|
||||
for sort_key in sort_keys:
|
||||
if self.headers.get(sort_key, False):
|
||||
lines.append(f"{sort_key}: {self.headers[sort_key]}")
|
||||
|
||||
for header_name, header_value in self.headers.items():
|
||||
if header_name not in sort_keys:
|
||||
if header_value:
|
||||
lines.append(f"{header_name}: {header_value}")
|
||||
|
||||
lines.append("\r\n")
|
||||
return "\r\n".join(lines)
|
||||
|
||||
def make_multipart(
|
||||
self,
|
||||
content_disposition: str | None = None,
|
||||
content_type: str | None = None,
|
||||
content_location: str | None = None,
|
||||
) -> None:
|
||||
"""
|
||||
Makes this request field into a multipart request field.
|
||||
|
||||
This method overrides "Content-Disposition", "Content-Type" and
|
||||
"Content-Location" headers to the request parameter.
|
||||
|
||||
:param content_disposition:
|
||||
The 'Content-Disposition' of the request body. Defaults to 'form-data'
|
||||
:param content_type:
|
||||
The 'Content-Type' of the request body.
|
||||
:param content_location:
|
||||
The 'Content-Location' of the request body.
|
||||
|
||||
"""
|
||||
content_disposition = (content_disposition or "form-data") + "; ".join(
|
||||
[
|
||||
"",
|
||||
self._render_parts(
|
||||
(("name", self._name), ("filename", self._filename))
|
||||
),
|
||||
]
|
||||
)
|
||||
|
||||
self.headers["Content-Disposition"] = content_disposition
|
||||
self.headers["Content-Type"] = content_type
|
||||
self.headers["Content-Location"] = content_location
|
||||
@@ -0,0 +1,89 @@
|
||||
from __future__ import annotations
|
||||
|
||||
import binascii
|
||||
import codecs
|
||||
import os
|
||||
import typing
|
||||
from io import BytesIO
|
||||
|
||||
from .fields import _TYPE_FIELD_VALUE_TUPLE, RequestField
|
||||
|
||||
writer = codecs.lookup("utf-8")[3]
|
||||
|
||||
_TYPE_FIELDS_SEQUENCE = typing.Sequence[
|
||||
typing.Union[tuple[str, _TYPE_FIELD_VALUE_TUPLE], RequestField]
|
||||
]
|
||||
_TYPE_FIELDS = typing.Union[
|
||||
_TYPE_FIELDS_SEQUENCE,
|
||||
typing.Mapping[str, _TYPE_FIELD_VALUE_TUPLE],
|
||||
]
|
||||
|
||||
|
||||
def choose_boundary() -> str:
|
||||
"""
|
||||
Our embarrassingly-simple replacement for mimetools.choose_boundary.
|
||||
"""
|
||||
return binascii.hexlify(os.urandom(16)).decode()
|
||||
|
||||
|
||||
def iter_field_objects(fields: _TYPE_FIELDS) -> typing.Iterable[RequestField]:
|
||||
"""
|
||||
Iterate over fields.
|
||||
|
||||
Supports list of (k, v) tuples and dicts, and lists of
|
||||
:class:`~urllib3.fields.RequestField`.
|
||||
|
||||
"""
|
||||
iterable: typing.Iterable[RequestField | tuple[str, _TYPE_FIELD_VALUE_TUPLE]]
|
||||
|
||||
if isinstance(fields, typing.Mapping):
|
||||
iterable = fields.items()
|
||||
else:
|
||||
iterable = fields
|
||||
|
||||
for field in iterable:
|
||||
if isinstance(field, RequestField):
|
||||
yield field
|
||||
else:
|
||||
yield RequestField.from_tuples(*field)
|
||||
|
||||
|
||||
def encode_multipart_formdata(
|
||||
fields: _TYPE_FIELDS, boundary: str | None = None
|
||||
) -> tuple[bytes, str]:
|
||||
"""
|
||||
Encode a dictionary of ``fields`` using the multipart/form-data MIME format.
|
||||
|
||||
:param fields:
|
||||
Dictionary of fields or list of (key, :class:`~urllib3.fields.RequestField`).
|
||||
Values are processed by :func:`urllib3.fields.RequestField.from_tuples`.
|
||||
|
||||
:param boundary:
|
||||
If not specified, then a random boundary will be generated using
|
||||
:func:`urllib3.filepost.choose_boundary`.
|
||||
"""
|
||||
body = BytesIO()
|
||||
if boundary is None:
|
||||
boundary = choose_boundary()
|
||||
|
||||
for field in iter_field_objects(fields):
|
||||
body.write(f"--{boundary}\r\n".encode("latin-1"))
|
||||
|
||||
writer(body).write(field.render_headers())
|
||||
data = field.data
|
||||
|
||||
if isinstance(data, int):
|
||||
data = str(data) # Backwards compatibility
|
||||
|
||||
if isinstance(data, str):
|
||||
writer(body).write(data)
|
||||
else:
|
||||
body.write(data)
|
||||
|
||||
body.write(b"\r\n")
|
||||
|
||||
body.write(f"--{boundary}--\r\n".encode("latin-1"))
|
||||
|
||||
content_type = f"multipart/form-data; boundary={boundary}"
|
||||
|
||||
return body.getvalue(), content_type
|
||||
@@ -0,0 +1,53 @@
|
||||
from __future__ import annotations
|
||||
|
||||
from importlib.metadata import version
|
||||
|
||||
__all__ = [
|
||||
"inject_into_urllib3",
|
||||
"extract_from_urllib3",
|
||||
]
|
||||
|
||||
import typing
|
||||
|
||||
orig_HTTPSConnection: typing.Any = None
|
||||
|
||||
|
||||
def inject_into_urllib3() -> None:
|
||||
# First check if h2 version is valid
|
||||
h2_version = version("h2")
|
||||
if not h2_version.startswith("4."):
|
||||
raise ImportError(
|
||||
"urllib3 v2 supports h2 version 4.x.x, currently "
|
||||
f"the 'h2' module is compiled with {h2_version!r}. "
|
||||
"See: https://github.com/urllib3/urllib3/issues/3290"
|
||||
)
|
||||
|
||||
# Import here to avoid circular dependencies.
|
||||
from .. import connection as urllib3_connection
|
||||
from .. import util as urllib3_util
|
||||
from ..connectionpool import HTTPSConnectionPool
|
||||
from ..util import ssl_ as urllib3_util_ssl
|
||||
from .connection import HTTP2Connection
|
||||
|
||||
global orig_HTTPSConnection
|
||||
orig_HTTPSConnection = urllib3_connection.HTTPSConnection
|
||||
|
||||
HTTPSConnectionPool.ConnectionCls = HTTP2Connection
|
||||
urllib3_connection.HTTPSConnection = HTTP2Connection # type: ignore[misc]
|
||||
|
||||
# TODO: Offer 'http/1.1' as well, but for testing purposes this is handy.
|
||||
urllib3_util.ALPN_PROTOCOLS = ["h2"]
|
||||
urllib3_util_ssl.ALPN_PROTOCOLS = ["h2"]
|
||||
|
||||
|
||||
def extract_from_urllib3() -> None:
|
||||
from .. import connection as urllib3_connection
|
||||
from .. import util as urllib3_util
|
||||
from ..connectionpool import HTTPSConnectionPool
|
||||
from ..util import ssl_ as urllib3_util_ssl
|
||||
|
||||
HTTPSConnectionPool.ConnectionCls = orig_HTTPSConnection
|
||||
urllib3_connection.HTTPSConnection = orig_HTTPSConnection # type: ignore[misc]
|
||||
|
||||
urllib3_util.ALPN_PROTOCOLS = ["http/1.1"]
|
||||
urllib3_util_ssl.ALPN_PROTOCOLS = ["http/1.1"]
|
||||
Binary file not shown.
Binary file not shown.
Binary file not shown.
@@ -0,0 +1,356 @@
|
||||
from __future__ import annotations
|
||||
|
||||
import logging
|
||||
import re
|
||||
import threading
|
||||
import types
|
||||
import typing
|
||||
|
||||
import h2.config # type: ignore[import-untyped]
|
||||
import h2.connection # type: ignore[import-untyped]
|
||||
import h2.events # type: ignore[import-untyped]
|
||||
|
||||
from .._base_connection import _TYPE_BODY
|
||||
from .._collections import HTTPHeaderDict
|
||||
from ..connection import HTTPSConnection, _get_default_user_agent
|
||||
from ..exceptions import ConnectionError
|
||||
from ..response import BaseHTTPResponse
|
||||
|
||||
orig_HTTPSConnection = HTTPSConnection
|
||||
|
||||
T = typing.TypeVar("T")
|
||||
|
||||
log = logging.getLogger(__name__)
|
||||
|
||||
RE_IS_LEGAL_HEADER_NAME = re.compile(rb"^[!#$%&'*+\-.^_`|~0-9a-z]+$")
|
||||
RE_IS_ILLEGAL_HEADER_VALUE = re.compile(rb"[\0\x00\x0a\x0d\r\n]|^[ \r\n\t]|[ \r\n\t]$")
|
||||
|
||||
|
||||
def _is_legal_header_name(name: bytes) -> bool:
|
||||
"""
|
||||
"An implementation that validates fields according to the definitions in Sections
|
||||
5.1 and 5.5 of [HTTP] only needs an additional check that field names do not
|
||||
include uppercase characters." (https://httpwg.org/specs/rfc9113.html#n-field-validity)
|
||||
|
||||
`http.client._is_legal_header_name` does not validate the field name according to the
|
||||
HTTP 1.1 spec, so we do that here, in addition to checking for uppercase characters.
|
||||
|
||||
This does not allow for the `:` character in the header name, so should not
|
||||
be used to validate pseudo-headers.
|
||||
"""
|
||||
return bool(RE_IS_LEGAL_HEADER_NAME.match(name))
|
||||
|
||||
|
||||
def _is_illegal_header_value(value: bytes) -> bool:
|
||||
"""
|
||||
"A field value MUST NOT contain the zero value (ASCII NUL, 0x00), line feed
|
||||
(ASCII LF, 0x0a), or carriage return (ASCII CR, 0x0d) at any position. A field
|
||||
value MUST NOT start or end with an ASCII whitespace character (ASCII SP or HTAB,
|
||||
0x20 or 0x09)." (https://httpwg.org/specs/rfc9113.html#n-field-validity)
|
||||
"""
|
||||
return bool(RE_IS_ILLEGAL_HEADER_VALUE.search(value))
|
||||
|
||||
|
||||
class _LockedObject(typing.Generic[T]):
|
||||
"""
|
||||
A wrapper class that hides a specific object behind a lock.
|
||||
The goal here is to provide a simple way to protect access to an object
|
||||
that cannot safely be simultaneously accessed from multiple threads. The
|
||||
intended use of this class is simple: take hold of it with a context
|
||||
manager, which returns the protected object.
|
||||
"""
|
||||
|
||||
__slots__ = (
|
||||
"lock",
|
||||
"_obj",
|
||||
)
|
||||
|
||||
def __init__(self, obj: T):
|
||||
self.lock = threading.RLock()
|
||||
self._obj = obj
|
||||
|
||||
def __enter__(self) -> T:
|
||||
self.lock.acquire()
|
||||
return self._obj
|
||||
|
||||
def __exit__(
|
||||
self,
|
||||
exc_type: type[BaseException] | None,
|
||||
exc_val: BaseException | None,
|
||||
exc_tb: types.TracebackType | None,
|
||||
) -> None:
|
||||
self.lock.release()
|
||||
|
||||
|
||||
class HTTP2Connection(HTTPSConnection):
|
||||
def __init__(
|
||||
self, host: str, port: int | None = None, **kwargs: typing.Any
|
||||
) -> None:
|
||||
self._h2_conn = self._new_h2_conn()
|
||||
self._h2_stream: int | None = None
|
||||
self._headers: list[tuple[bytes, bytes]] = []
|
||||
|
||||
if "proxy" in kwargs or "proxy_config" in kwargs: # Defensive:
|
||||
raise NotImplementedError("Proxies aren't supported with HTTP/2")
|
||||
|
||||
super().__init__(host, port, **kwargs)
|
||||
|
||||
if self._tunnel_host is not None:
|
||||
raise NotImplementedError("Tunneling isn't supported with HTTP/2")
|
||||
|
||||
def _new_h2_conn(self) -> _LockedObject[h2.connection.H2Connection]:
|
||||
config = h2.config.H2Configuration(client_side=True)
|
||||
return _LockedObject(h2.connection.H2Connection(config=config))
|
||||
|
||||
def connect(self) -> None:
|
||||
super().connect()
|
||||
with self._h2_conn as conn:
|
||||
conn.initiate_connection()
|
||||
if data_to_send := conn.data_to_send():
|
||||
self.sock.sendall(data_to_send)
|
||||
|
||||
def putrequest( # type: ignore[override]
|
||||
self,
|
||||
method: str,
|
||||
url: str,
|
||||
**kwargs: typing.Any,
|
||||
) -> None:
|
||||
"""putrequest
|
||||
This deviates from the HTTPConnection method signature since we never need to override
|
||||
sending accept-encoding headers or the host header.
|
||||
"""
|
||||
if "skip_host" in kwargs:
|
||||
raise NotImplementedError("`skip_host` isn't supported")
|
||||
if "skip_accept_encoding" in kwargs:
|
||||
raise NotImplementedError("`skip_accept_encoding` isn't supported")
|
||||
|
||||
self._request_url = url or "/"
|
||||
self._validate_path(url) # type: ignore[attr-defined]
|
||||
|
||||
if ":" in self.host:
|
||||
authority = f"[{self.host}]:{self.port or 443}"
|
||||
else:
|
||||
authority = f"{self.host}:{self.port or 443}"
|
||||
|
||||
self._headers.append((b":scheme", b"https"))
|
||||
self._headers.append((b":method", method.encode()))
|
||||
self._headers.append((b":authority", authority.encode()))
|
||||
self._headers.append((b":path", url.encode()))
|
||||
|
||||
with self._h2_conn as conn:
|
||||
self._h2_stream = conn.get_next_available_stream_id()
|
||||
|
||||
def putheader(self, header: str | bytes, *values: str | bytes) -> None: # type: ignore[override]
|
||||
# TODO SKIPPABLE_HEADERS from urllib3 are ignored.
|
||||
header = header.encode() if isinstance(header, str) else header
|
||||
header = header.lower() # A lot of upstream code uses capitalized headers.
|
||||
if not _is_legal_header_name(header):
|
||||
raise ValueError(f"Illegal header name {str(header)}")
|
||||
|
||||
for value in values:
|
||||
value = value.encode() if isinstance(value, str) else value
|
||||
if _is_illegal_header_value(value):
|
||||
raise ValueError(f"Illegal header value {str(value)}")
|
||||
self._headers.append((header, value))
|
||||
|
||||
def endheaders(self, message_body: typing.Any = None) -> None: # type: ignore[override]
|
||||
if self._h2_stream is None:
|
||||
raise ConnectionError("Must call `putrequest` first.")
|
||||
|
||||
with self._h2_conn as conn:
|
||||
conn.send_headers(
|
||||
stream_id=self._h2_stream,
|
||||
headers=self._headers,
|
||||
end_stream=(message_body is None),
|
||||
)
|
||||
if data_to_send := conn.data_to_send():
|
||||
self.sock.sendall(data_to_send)
|
||||
self._headers = [] # Reset headers for the next request.
|
||||
|
||||
def send(self, data: typing.Any) -> None:
|
||||
"""Send data to the server.
|
||||
`data` can be: `str`, `bytes`, an iterable, or file-like objects
|
||||
that support a .read() method.
|
||||
"""
|
||||
if self._h2_stream is None:
|
||||
raise ConnectionError("Must call `putrequest` first.")
|
||||
|
||||
with self._h2_conn as conn:
|
||||
if data_to_send := conn.data_to_send():
|
||||
self.sock.sendall(data_to_send)
|
||||
|
||||
if hasattr(data, "read"): # file-like objects
|
||||
while True:
|
||||
chunk = data.read(self.blocksize)
|
||||
if not chunk:
|
||||
break
|
||||
if isinstance(chunk, str):
|
||||
chunk = chunk.encode()
|
||||
conn.send_data(self._h2_stream, chunk, end_stream=False)
|
||||
if data_to_send := conn.data_to_send():
|
||||
self.sock.sendall(data_to_send)
|
||||
conn.end_stream(self._h2_stream)
|
||||
return
|
||||
|
||||
if isinstance(data, str): # str -> bytes
|
||||
data = data.encode()
|
||||
|
||||
try:
|
||||
if isinstance(data, bytes):
|
||||
conn.send_data(self._h2_stream, data, end_stream=True)
|
||||
if data_to_send := conn.data_to_send():
|
||||
self.sock.sendall(data_to_send)
|
||||
else:
|
||||
for chunk in data:
|
||||
conn.send_data(self._h2_stream, chunk, end_stream=False)
|
||||
if data_to_send := conn.data_to_send():
|
||||
self.sock.sendall(data_to_send)
|
||||
conn.end_stream(self._h2_stream)
|
||||
except TypeError:
|
||||
raise TypeError(
|
||||
"`data` should be str, bytes, iterable, or file. got %r"
|
||||
% type(data)
|
||||
)
|
||||
|
||||
def set_tunnel(
|
||||
self,
|
||||
host: str,
|
||||
port: int | None = None,
|
||||
headers: typing.Mapping[str, str] | None = None,
|
||||
scheme: str = "http",
|
||||
) -> None:
|
||||
raise NotImplementedError(
|
||||
"HTTP/2 does not support setting up a tunnel through a proxy"
|
||||
)
|
||||
|
||||
def getresponse( # type: ignore[override]
|
||||
self,
|
||||
) -> HTTP2Response:
|
||||
status = None
|
||||
data = bytearray()
|
||||
with self._h2_conn as conn:
|
||||
end_stream = False
|
||||
while not end_stream:
|
||||
# TODO: Arbitrary read value.
|
||||
if received_data := self.sock.recv(65535):
|
||||
events = conn.receive_data(received_data)
|
||||
for event in events:
|
||||
if isinstance(event, h2.events.ResponseReceived):
|
||||
headers = HTTPHeaderDict()
|
||||
for header, value in event.headers:
|
||||
if header == b":status":
|
||||
status = int(value.decode())
|
||||
else:
|
||||
headers.add(
|
||||
header.decode("ascii"), value.decode("ascii")
|
||||
)
|
||||
|
||||
elif isinstance(event, h2.events.DataReceived):
|
||||
data += event.data
|
||||
conn.acknowledge_received_data(
|
||||
event.flow_controlled_length, event.stream_id
|
||||
)
|
||||
|
||||
elif isinstance(event, h2.events.StreamEnded):
|
||||
end_stream = True
|
||||
|
||||
if data_to_send := conn.data_to_send():
|
||||
self.sock.sendall(data_to_send)
|
||||
|
||||
assert status is not None
|
||||
return HTTP2Response(
|
||||
status=status,
|
||||
headers=headers,
|
||||
request_url=self._request_url,
|
||||
data=bytes(data),
|
||||
)
|
||||
|
||||
def request( # type: ignore[override]
|
||||
self,
|
||||
method: str,
|
||||
url: str,
|
||||
body: _TYPE_BODY | None = None,
|
||||
headers: typing.Mapping[str, str] | None = None,
|
||||
*,
|
||||
preload_content: bool = True,
|
||||
decode_content: bool = True,
|
||||
enforce_content_length: bool = True,
|
||||
**kwargs: typing.Any,
|
||||
) -> None:
|
||||
"""Send an HTTP/2 request"""
|
||||
if "chunked" in kwargs:
|
||||
# TODO this is often present from upstream.
|
||||
# raise NotImplementedError("`chunked` isn't supported with HTTP/2")
|
||||
pass
|
||||
|
||||
if self.sock is not None:
|
||||
self.sock.settimeout(self.timeout)
|
||||
|
||||
self.putrequest(method, url)
|
||||
|
||||
headers = headers or {}
|
||||
for k, v in headers.items():
|
||||
if k.lower() == "transfer-encoding" and v == "chunked":
|
||||
continue
|
||||
else:
|
||||
self.putheader(k, v)
|
||||
|
||||
if b"user-agent" not in dict(self._headers):
|
||||
self.putheader(b"user-agent", _get_default_user_agent())
|
||||
|
||||
if body:
|
||||
self.endheaders(message_body=body)
|
||||
self.send(body)
|
||||
else:
|
||||
self.endheaders()
|
||||
|
||||
def close(self) -> None:
|
||||
with self._h2_conn as conn:
|
||||
try:
|
||||
conn.close_connection()
|
||||
if data := conn.data_to_send():
|
||||
self.sock.sendall(data)
|
||||
except Exception:
|
||||
pass
|
||||
|
||||
# Reset all our HTTP/2 connection state.
|
||||
self._h2_conn = self._new_h2_conn()
|
||||
self._h2_stream = None
|
||||
self._headers = []
|
||||
|
||||
super().close()
|
||||
|
||||
|
||||
class HTTP2Response(BaseHTTPResponse):
|
||||
# TODO: This is a woefully incomplete response object, but works for non-streaming.
|
||||
def __init__(
|
||||
self,
|
||||
status: int,
|
||||
headers: HTTPHeaderDict,
|
||||
request_url: str,
|
||||
data: bytes,
|
||||
decode_content: bool = False, # TODO: support decoding
|
||||
) -> None:
|
||||
super().__init__(
|
||||
status=status,
|
||||
headers=headers,
|
||||
# Following CPython, we map HTTP versions to major * 10 + minor integers
|
||||
version=20,
|
||||
version_string="HTTP/2",
|
||||
# No reason phrase in HTTP/2
|
||||
reason=None,
|
||||
decode_content=decode_content,
|
||||
request_url=request_url,
|
||||
)
|
||||
self._data = data
|
||||
self.length_remaining = 0
|
||||
|
||||
@property
|
||||
def data(self) -> bytes:
|
||||
return self._data
|
||||
|
||||
def get_redirect_location(self) -> None:
|
||||
return None
|
||||
|
||||
def close(self) -> None:
|
||||
pass
|
||||
@@ -0,0 +1,87 @@
|
||||
from __future__ import annotations
|
||||
|
||||
import threading
|
||||
|
||||
|
||||
class _HTTP2ProbeCache:
|
||||
__slots__ = (
|
||||
"_lock",
|
||||
"_cache_locks",
|
||||
"_cache_values",
|
||||
)
|
||||
|
||||
def __init__(self) -> None:
|
||||
self._lock = threading.Lock()
|
||||
self._cache_locks: dict[tuple[str, int], threading.RLock] = {}
|
||||
self._cache_values: dict[tuple[str, int], bool | None] = {}
|
||||
|
||||
def acquire_and_get(self, host: str, port: int) -> bool | None:
|
||||
# By the end of this block we know that
|
||||
# _cache_[values,locks] is available.
|
||||
value = None
|
||||
with self._lock:
|
||||
key = (host, port)
|
||||
try:
|
||||
value = self._cache_values[key]
|
||||
# If it's a known value we return right away.
|
||||
if value is not None:
|
||||
return value
|
||||
except KeyError:
|
||||
self._cache_locks[key] = threading.RLock()
|
||||
self._cache_values[key] = None
|
||||
|
||||
# If the value is unknown, we acquire the lock to signal
|
||||
# to the requesting thread that the probe is in progress
|
||||
# or that the current thread needs to return their findings.
|
||||
key_lock = self._cache_locks[key]
|
||||
key_lock.acquire()
|
||||
try:
|
||||
# If the by the time we get the lock the value has been
|
||||
# updated we want to return the updated value.
|
||||
value = self._cache_values[key]
|
||||
|
||||
# In case an exception like KeyboardInterrupt is raised here.
|
||||
except BaseException as e: # Defensive:
|
||||
assert not isinstance(e, KeyError) # KeyError shouldn't be possible.
|
||||
key_lock.release()
|
||||
raise
|
||||
|
||||
return value
|
||||
|
||||
def set_and_release(
|
||||
self, host: str, port: int, supports_http2: bool | None
|
||||
) -> None:
|
||||
key = (host, port)
|
||||
key_lock = self._cache_locks[key]
|
||||
with key_lock: # Uses an RLock, so can be locked again from same thread.
|
||||
if supports_http2 is None and self._cache_values[key] is not None:
|
||||
raise ValueError(
|
||||
"Cannot reset HTTP/2 support for origin after value has been set."
|
||||
) # Defensive: not expected in normal usage
|
||||
|
||||
self._cache_values[key] = supports_http2
|
||||
key_lock.release()
|
||||
|
||||
def _values(self) -> dict[tuple[str, int], bool | None]:
|
||||
"""This function is for testing purposes only. Gets the current state of the probe cache"""
|
||||
with self._lock:
|
||||
return {k: v for k, v in self._cache_values.items()}
|
||||
|
||||
def _reset(self) -> None:
|
||||
"""This function is for testing purposes only. Reset the cache values"""
|
||||
with self._lock:
|
||||
self._cache_locks = {}
|
||||
self._cache_values = {}
|
||||
|
||||
|
||||
_HTTP2_PROBE_CACHE = _HTTP2ProbeCache()
|
||||
|
||||
set_and_release = _HTTP2_PROBE_CACHE.set_and_release
|
||||
acquire_and_get = _HTTP2_PROBE_CACHE.acquire_and_get
|
||||
_values = _HTTP2_PROBE_CACHE._values
|
||||
_reset = _HTTP2_PROBE_CACHE._reset
|
||||
|
||||
__all__ = [
|
||||
"set_and_release",
|
||||
"acquire_and_get",
|
||||
]
|
||||
651
path/to/venv/lib/python3.12/site-packages/urllib3/poolmanager.py
Normal file
651
path/to/venv/lib/python3.12/site-packages/urllib3/poolmanager.py
Normal file
@@ -0,0 +1,651 @@
|
||||
from __future__ import annotations
|
||||
|
||||
import functools
|
||||
import logging
|
||||
import typing
|
||||
import warnings
|
||||
from types import TracebackType
|
||||
from urllib.parse import urljoin
|
||||
|
||||
from ._collections import HTTPHeaderDict, RecentlyUsedContainer
|
||||
from ._request_methods import RequestMethods
|
||||
from .connection import ProxyConfig
|
||||
from .connectionpool import HTTPConnectionPool, HTTPSConnectionPool, port_by_scheme
|
||||
from .exceptions import (
|
||||
LocationValueError,
|
||||
MaxRetryError,
|
||||
ProxySchemeUnknown,
|
||||
URLSchemeUnknown,
|
||||
)
|
||||
from .response import BaseHTTPResponse
|
||||
from .util.connection import _TYPE_SOCKET_OPTIONS
|
||||
from .util.proxy import connection_requires_http_tunnel
|
||||
from .util.retry import Retry
|
||||
from .util.timeout import Timeout
|
||||
from .util.url import Url, parse_url
|
||||
|
||||
if typing.TYPE_CHECKING:
|
||||
import ssl
|
||||
|
||||
from typing_extensions import Self
|
||||
|
||||
__all__ = ["PoolManager", "ProxyManager", "proxy_from_url"]
|
||||
|
||||
|
||||
log = logging.getLogger(__name__)
|
||||
|
||||
SSL_KEYWORDS = (
|
||||
"key_file",
|
||||
"cert_file",
|
||||
"cert_reqs",
|
||||
"ca_certs",
|
||||
"ca_cert_data",
|
||||
"ssl_version",
|
||||
"ssl_minimum_version",
|
||||
"ssl_maximum_version",
|
||||
"ca_cert_dir",
|
||||
"ssl_context",
|
||||
"key_password",
|
||||
"server_hostname",
|
||||
)
|
||||
# Default value for `blocksize` - a new parameter introduced to
|
||||
# http.client.HTTPConnection & http.client.HTTPSConnection in Python 3.7
|
||||
_DEFAULT_BLOCKSIZE = 16384
|
||||
|
||||
|
||||
class PoolKey(typing.NamedTuple):
|
||||
"""
|
||||
All known keyword arguments that could be provided to the pool manager, its
|
||||
pools, or the underlying connections.
|
||||
|
||||
All custom key schemes should include the fields in this key at a minimum.
|
||||
"""
|
||||
|
||||
key_scheme: str
|
||||
key_host: str
|
||||
key_port: int | None
|
||||
key_timeout: Timeout | float | int | None
|
||||
key_retries: Retry | bool | int | None
|
||||
key_block: bool | None
|
||||
key_source_address: tuple[str, int] | None
|
||||
key_key_file: str | None
|
||||
key_key_password: str | None
|
||||
key_cert_file: str | None
|
||||
key_cert_reqs: str | None
|
||||
key_ca_certs: str | None
|
||||
key_ca_cert_data: str | bytes | None
|
||||
key_ssl_version: int | str | None
|
||||
key_ssl_minimum_version: ssl.TLSVersion | None
|
||||
key_ssl_maximum_version: ssl.TLSVersion | None
|
||||
key_ca_cert_dir: str | None
|
||||
key_ssl_context: ssl.SSLContext | None
|
||||
key_maxsize: int | None
|
||||
key_headers: frozenset[tuple[str, str]] | None
|
||||
key__proxy: Url | None
|
||||
key__proxy_headers: frozenset[tuple[str, str]] | None
|
||||
key__proxy_config: ProxyConfig | None
|
||||
key_socket_options: _TYPE_SOCKET_OPTIONS | None
|
||||
key__socks_options: frozenset[tuple[str, str]] | None
|
||||
key_assert_hostname: bool | str | None
|
||||
key_assert_fingerprint: str | None
|
||||
key_server_hostname: str | None
|
||||
key_blocksize: int | None
|
||||
|
||||
|
||||
def _default_key_normalizer(
|
||||
key_class: type[PoolKey], request_context: dict[str, typing.Any]
|
||||
) -> PoolKey:
|
||||
"""
|
||||
Create a pool key out of a request context dictionary.
|
||||
|
||||
According to RFC 3986, both the scheme and host are case-insensitive.
|
||||
Therefore, this function normalizes both before constructing the pool
|
||||
key for an HTTPS request. If you wish to change this behaviour, provide
|
||||
alternate callables to ``key_fn_by_scheme``.
|
||||
|
||||
:param key_class:
|
||||
The class to use when constructing the key. This should be a namedtuple
|
||||
with the ``scheme`` and ``host`` keys at a minimum.
|
||||
:type key_class: namedtuple
|
||||
:param request_context:
|
||||
A dictionary-like object that contain the context for a request.
|
||||
:type request_context: dict
|
||||
|
||||
:return: A namedtuple that can be used as a connection pool key.
|
||||
:rtype: PoolKey
|
||||
"""
|
||||
# Since we mutate the dictionary, make a copy first
|
||||
context = request_context.copy()
|
||||
context["scheme"] = context["scheme"].lower()
|
||||
context["host"] = context["host"].lower()
|
||||
|
||||
# These are both dictionaries and need to be transformed into frozensets
|
||||
for key in ("headers", "_proxy_headers", "_socks_options"):
|
||||
if key in context and context[key] is not None:
|
||||
context[key] = frozenset(context[key].items())
|
||||
|
||||
# The socket_options key may be a list and needs to be transformed into a
|
||||
# tuple.
|
||||
socket_opts = context.get("socket_options")
|
||||
if socket_opts is not None:
|
||||
context["socket_options"] = tuple(socket_opts)
|
||||
|
||||
# Map the kwargs to the names in the namedtuple - this is necessary since
|
||||
# namedtuples can't have fields starting with '_'.
|
||||
for key in list(context.keys()):
|
||||
context["key_" + key] = context.pop(key)
|
||||
|
||||
# Default to ``None`` for keys missing from the context
|
||||
for field in key_class._fields:
|
||||
if field not in context:
|
||||
context[field] = None
|
||||
|
||||
# Default key_blocksize to _DEFAULT_BLOCKSIZE if missing from the context
|
||||
if context.get("key_blocksize") is None:
|
||||
context["key_blocksize"] = _DEFAULT_BLOCKSIZE
|
||||
|
||||
return key_class(**context)
|
||||
|
||||
|
||||
#: A dictionary that maps a scheme to a callable that creates a pool key.
|
||||
#: This can be used to alter the way pool keys are constructed, if desired.
|
||||
#: Each PoolManager makes a copy of this dictionary so they can be configured
|
||||
#: globally here, or individually on the instance.
|
||||
key_fn_by_scheme = {
|
||||
"http": functools.partial(_default_key_normalizer, PoolKey),
|
||||
"https": functools.partial(_default_key_normalizer, PoolKey),
|
||||
}
|
||||
|
||||
pool_classes_by_scheme = {"http": HTTPConnectionPool, "https": HTTPSConnectionPool}
|
||||
|
||||
|
||||
class PoolManager(RequestMethods):
|
||||
"""
|
||||
Allows for arbitrary requests while transparently keeping track of
|
||||
necessary connection pools for you.
|
||||
|
||||
:param num_pools:
|
||||
Number of connection pools to cache before discarding the least
|
||||
recently used pool.
|
||||
|
||||
:param headers:
|
||||
Headers to include with all requests, unless other headers are given
|
||||
explicitly.
|
||||
|
||||
:param \\**connection_pool_kw:
|
||||
Additional parameters are used to create fresh
|
||||
:class:`urllib3.connectionpool.ConnectionPool` instances.
|
||||
|
||||
Example:
|
||||
|
||||
.. code-block:: python
|
||||
|
||||
import urllib3
|
||||
|
||||
http = urllib3.PoolManager(num_pools=2)
|
||||
|
||||
resp1 = http.request("GET", "https://google.com/")
|
||||
resp2 = http.request("GET", "https://google.com/mail")
|
||||
resp3 = http.request("GET", "https://yahoo.com/")
|
||||
|
||||
print(len(http.pools))
|
||||
# 2
|
||||
|
||||
"""
|
||||
|
||||
proxy: Url | None = None
|
||||
proxy_config: ProxyConfig | None = None
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
num_pools: int = 10,
|
||||
headers: typing.Mapping[str, str] | None = None,
|
||||
**connection_pool_kw: typing.Any,
|
||||
) -> None:
|
||||
super().__init__(headers)
|
||||
# PoolManager handles redirects itself in PoolManager.urlopen().
|
||||
# It always passes redirect=False to the underlying connection pool to
|
||||
# suppress per-pool redirect handling. If the user supplied a non-Retry
|
||||
# value (int/bool/etc) for retries and we let the pool normalize it
|
||||
# while redirect=False, the resulting Retry object would have redirect
|
||||
# handling disabled, which can interfere with PoolManager's own
|
||||
# redirect logic. Normalize here so redirects remain governed solely by
|
||||
# PoolManager logic.
|
||||
if "retries" in connection_pool_kw:
|
||||
retries = connection_pool_kw["retries"]
|
||||
if not isinstance(retries, Retry):
|
||||
retries = Retry.from_int(retries)
|
||||
connection_pool_kw = connection_pool_kw.copy()
|
||||
connection_pool_kw["retries"] = retries
|
||||
self.connection_pool_kw = connection_pool_kw
|
||||
|
||||
self.pools: RecentlyUsedContainer[PoolKey, HTTPConnectionPool]
|
||||
self.pools = RecentlyUsedContainer(num_pools)
|
||||
|
||||
# Locally set the pool classes and keys so other PoolManagers can
|
||||
# override them.
|
||||
self.pool_classes_by_scheme = pool_classes_by_scheme
|
||||
self.key_fn_by_scheme = key_fn_by_scheme.copy()
|
||||
|
||||
def __enter__(self) -> Self:
|
||||
return self
|
||||
|
||||
def __exit__(
|
||||
self,
|
||||
exc_type: type[BaseException] | None,
|
||||
exc_val: BaseException | None,
|
||||
exc_tb: TracebackType | None,
|
||||
) -> typing.Literal[False]:
|
||||
self.clear()
|
||||
# Return False to re-raise any potential exceptions
|
||||
return False
|
||||
|
||||
def _new_pool(
|
||||
self,
|
||||
scheme: str,
|
||||
host: str,
|
||||
port: int,
|
||||
request_context: dict[str, typing.Any] | None = None,
|
||||
) -> HTTPConnectionPool:
|
||||
"""
|
||||
Create a new :class:`urllib3.connectionpool.ConnectionPool` based on host, port, scheme, and
|
||||
any additional pool keyword arguments.
|
||||
|
||||
If ``request_context`` is provided, it is provided as keyword arguments
|
||||
to the pool class used. This method is used to actually create the
|
||||
connection pools handed out by :meth:`connection_from_url` and
|
||||
companion methods. It is intended to be overridden for customization.
|
||||
"""
|
||||
pool_cls: type[HTTPConnectionPool] = self.pool_classes_by_scheme[scheme]
|
||||
if request_context is None:
|
||||
request_context = self.connection_pool_kw.copy()
|
||||
|
||||
# Default blocksize to _DEFAULT_BLOCKSIZE if missing or explicitly
|
||||
# set to 'None' in the request_context.
|
||||
if request_context.get("blocksize") is None:
|
||||
request_context["blocksize"] = _DEFAULT_BLOCKSIZE
|
||||
|
||||
# Although the context has everything necessary to create the pool,
|
||||
# this function has historically only used the scheme, host, and port
|
||||
# in the positional args. When an API change is acceptable these can
|
||||
# be removed.
|
||||
for key in ("scheme", "host", "port"):
|
||||
request_context.pop(key, None)
|
||||
|
||||
if scheme == "http":
|
||||
for kw in SSL_KEYWORDS:
|
||||
request_context.pop(kw, None)
|
||||
|
||||
return pool_cls(host, port, **request_context)
|
||||
|
||||
def clear(self) -> None:
|
||||
"""
|
||||
Empty our store of pools and direct them all to close.
|
||||
|
||||
This will not affect in-flight connections, but they will not be
|
||||
re-used after completion.
|
||||
"""
|
||||
self.pools.clear()
|
||||
|
||||
def connection_from_host(
|
||||
self,
|
||||
host: str | None,
|
||||
port: int | None = None,
|
||||
scheme: str | None = "http",
|
||||
pool_kwargs: dict[str, typing.Any] | None = None,
|
||||
) -> HTTPConnectionPool:
|
||||
"""
|
||||
Get a :class:`urllib3.connectionpool.ConnectionPool` based on the host, port, and scheme.
|
||||
|
||||
If ``port`` isn't given, it will be derived from the ``scheme`` using
|
||||
``urllib3.connectionpool.port_by_scheme``. If ``pool_kwargs`` is
|
||||
provided, it is merged with the instance's ``connection_pool_kw``
|
||||
variable and used to create the new connection pool, if one is
|
||||
needed.
|
||||
"""
|
||||
|
||||
if not host:
|
||||
raise LocationValueError("No host specified.")
|
||||
|
||||
request_context = self._merge_pool_kwargs(pool_kwargs)
|
||||
request_context["scheme"] = scheme or "http"
|
||||
if not port:
|
||||
port = port_by_scheme.get(request_context["scheme"].lower(), 80)
|
||||
request_context["port"] = port
|
||||
request_context["host"] = host
|
||||
|
||||
return self.connection_from_context(request_context)
|
||||
|
||||
def connection_from_context(
|
||||
self, request_context: dict[str, typing.Any]
|
||||
) -> HTTPConnectionPool:
|
||||
"""
|
||||
Get a :class:`urllib3.connectionpool.ConnectionPool` based on the request context.
|
||||
|
||||
``request_context`` must at least contain the ``scheme`` key and its
|
||||
value must be a key in ``key_fn_by_scheme`` instance variable.
|
||||
"""
|
||||
if "strict" in request_context:
|
||||
warnings.warn(
|
||||
"The 'strict' parameter is no longer needed on Python 3+. "
|
||||
"This will raise an error in urllib3 v2.1.0.",
|
||||
DeprecationWarning,
|
||||
)
|
||||
request_context.pop("strict")
|
||||
|
||||
scheme = request_context["scheme"].lower()
|
||||
pool_key_constructor = self.key_fn_by_scheme.get(scheme)
|
||||
if not pool_key_constructor:
|
||||
raise URLSchemeUnknown(scheme)
|
||||
pool_key = pool_key_constructor(request_context)
|
||||
|
||||
return self.connection_from_pool_key(pool_key, request_context=request_context)
|
||||
|
||||
def connection_from_pool_key(
|
||||
self, pool_key: PoolKey, request_context: dict[str, typing.Any]
|
||||
) -> HTTPConnectionPool:
|
||||
"""
|
||||
Get a :class:`urllib3.connectionpool.ConnectionPool` based on the provided pool key.
|
||||
|
||||
``pool_key`` should be a namedtuple that only contains immutable
|
||||
objects. At a minimum it must have the ``scheme``, ``host``, and
|
||||
``port`` fields.
|
||||
"""
|
||||
with self.pools.lock:
|
||||
# If the scheme, host, or port doesn't match existing open
|
||||
# connections, open a new ConnectionPool.
|
||||
pool = self.pools.get(pool_key)
|
||||
if pool:
|
||||
return pool
|
||||
|
||||
# Make a fresh ConnectionPool of the desired type
|
||||
scheme = request_context["scheme"]
|
||||
host = request_context["host"]
|
||||
port = request_context["port"]
|
||||
pool = self._new_pool(scheme, host, port, request_context=request_context)
|
||||
self.pools[pool_key] = pool
|
||||
|
||||
return pool
|
||||
|
||||
def connection_from_url(
|
||||
self, url: str, pool_kwargs: dict[str, typing.Any] | None = None
|
||||
) -> HTTPConnectionPool:
|
||||
"""
|
||||
Similar to :func:`urllib3.connectionpool.connection_from_url`.
|
||||
|
||||
If ``pool_kwargs`` is not provided and a new pool needs to be
|
||||
constructed, ``self.connection_pool_kw`` is used to initialize
|
||||
the :class:`urllib3.connectionpool.ConnectionPool`. If ``pool_kwargs``
|
||||
is provided, it is used instead. Note that if a new pool does not
|
||||
need to be created for the request, the provided ``pool_kwargs`` are
|
||||
not used.
|
||||
"""
|
||||
u = parse_url(url)
|
||||
return self.connection_from_host(
|
||||
u.host, port=u.port, scheme=u.scheme, pool_kwargs=pool_kwargs
|
||||
)
|
||||
|
||||
def _merge_pool_kwargs(
|
||||
self, override: dict[str, typing.Any] | None
|
||||
) -> dict[str, typing.Any]:
|
||||
"""
|
||||
Merge a dictionary of override values for self.connection_pool_kw.
|
||||
|
||||
This does not modify self.connection_pool_kw and returns a new dict.
|
||||
Any keys in the override dictionary with a value of ``None`` are
|
||||
removed from the merged dictionary.
|
||||
"""
|
||||
base_pool_kwargs = self.connection_pool_kw.copy()
|
||||
if override:
|
||||
for key, value in override.items():
|
||||
if value is None:
|
||||
try:
|
||||
del base_pool_kwargs[key]
|
||||
except KeyError:
|
||||
pass
|
||||
else:
|
||||
base_pool_kwargs[key] = value
|
||||
return base_pool_kwargs
|
||||
|
||||
def _proxy_requires_url_absolute_form(self, parsed_url: Url) -> bool:
|
||||
"""
|
||||
Indicates if the proxy requires the complete destination URL in the
|
||||
request. Normally this is only needed when not using an HTTP CONNECT
|
||||
tunnel.
|
||||
"""
|
||||
if self.proxy is None:
|
||||
return False
|
||||
|
||||
return not connection_requires_http_tunnel(
|
||||
self.proxy, self.proxy_config, parsed_url.scheme
|
||||
)
|
||||
|
||||
def urlopen( # type: ignore[override]
|
||||
self, method: str, url: str, redirect: bool = True, **kw: typing.Any
|
||||
) -> BaseHTTPResponse:
|
||||
"""
|
||||
Same as :meth:`urllib3.HTTPConnectionPool.urlopen`
|
||||
with custom cross-host redirect logic and only sends the request-uri
|
||||
portion of the ``url``.
|
||||
|
||||
The given ``url`` parameter must be absolute, such that an appropriate
|
||||
:class:`urllib3.connectionpool.ConnectionPool` can be chosen for it.
|
||||
"""
|
||||
u = parse_url(url)
|
||||
|
||||
if u.scheme is None:
|
||||
warnings.warn(
|
||||
"URLs without a scheme (ie 'https://') are deprecated and will raise an error "
|
||||
"in a future version of urllib3. To avoid this DeprecationWarning ensure all URLs "
|
||||
"start with 'https://' or 'http://'. Read more in this issue: "
|
||||
"https://github.com/urllib3/urllib3/issues/2920",
|
||||
category=DeprecationWarning,
|
||||
stacklevel=2,
|
||||
)
|
||||
|
||||
conn = self.connection_from_host(u.host, port=u.port, scheme=u.scheme)
|
||||
|
||||
kw["assert_same_host"] = False
|
||||
kw["redirect"] = False
|
||||
|
||||
if "headers" not in kw:
|
||||
kw["headers"] = self.headers
|
||||
|
||||
if self._proxy_requires_url_absolute_form(u):
|
||||
response = conn.urlopen(method, url, **kw)
|
||||
else:
|
||||
response = conn.urlopen(method, u.request_uri, **kw)
|
||||
|
||||
redirect_location = redirect and response.get_redirect_location()
|
||||
if not redirect_location:
|
||||
return response
|
||||
|
||||
# Support relative URLs for redirecting.
|
||||
redirect_location = urljoin(url, redirect_location)
|
||||
|
||||
if response.status == 303:
|
||||
# Change the method according to RFC 9110, Section 15.4.4.
|
||||
method = "GET"
|
||||
# And lose the body not to transfer anything sensitive.
|
||||
kw["body"] = None
|
||||
kw["headers"] = HTTPHeaderDict(kw["headers"])._prepare_for_method_change()
|
||||
|
||||
retries = kw.get("retries", response.retries)
|
||||
if not isinstance(retries, Retry):
|
||||
retries = Retry.from_int(retries, redirect=redirect)
|
||||
|
||||
# Strip headers marked as unsafe to forward to the redirected location.
|
||||
# Check remove_headers_on_redirect to avoid a potential network call within
|
||||
# conn.is_same_host() which may use socket.gethostbyname() in the future.
|
||||
if retries.remove_headers_on_redirect and not conn.is_same_host(
|
||||
redirect_location
|
||||
):
|
||||
new_headers = kw["headers"].copy()
|
||||
for header in kw["headers"]:
|
||||
if header.lower() in retries.remove_headers_on_redirect:
|
||||
new_headers.pop(header, None)
|
||||
kw["headers"] = new_headers
|
||||
|
||||
try:
|
||||
retries = retries.increment(method, url, response=response, _pool=conn)
|
||||
except MaxRetryError:
|
||||
if retries.raise_on_redirect:
|
||||
response.drain_conn()
|
||||
raise
|
||||
return response
|
||||
|
||||
kw["retries"] = retries
|
||||
kw["redirect"] = redirect
|
||||
|
||||
log.info("Redirecting %s -> %s", url, redirect_location)
|
||||
|
||||
response.drain_conn()
|
||||
return self.urlopen(method, redirect_location, **kw)
|
||||
|
||||
|
||||
class ProxyManager(PoolManager):
|
||||
"""
|
||||
Behaves just like :class:`PoolManager`, but sends all requests through
|
||||
the defined proxy, using the CONNECT method for HTTPS URLs.
|
||||
|
||||
:param proxy_url:
|
||||
The URL of the proxy to be used.
|
||||
|
||||
:param proxy_headers:
|
||||
A dictionary containing headers that will be sent to the proxy. In case
|
||||
of HTTP they are being sent with each request, while in the
|
||||
HTTPS/CONNECT case they are sent only once. Could be used for proxy
|
||||
authentication.
|
||||
|
||||
:param proxy_ssl_context:
|
||||
The proxy SSL context is used to establish the TLS connection to the
|
||||
proxy when using HTTPS proxies.
|
||||
|
||||
:param use_forwarding_for_https:
|
||||
(Defaults to False) If set to True will forward requests to the HTTPS
|
||||
proxy to be made on behalf of the client instead of creating a TLS
|
||||
tunnel via the CONNECT method. **Enabling this flag means that request
|
||||
and response headers and content will be visible from the HTTPS proxy**
|
||||
whereas tunneling keeps request and response headers and content
|
||||
private. IP address, target hostname, SNI, and port are always visible
|
||||
to an HTTPS proxy even when this flag is disabled.
|
||||
|
||||
:param proxy_assert_hostname:
|
||||
The hostname of the certificate to verify against.
|
||||
|
||||
:param proxy_assert_fingerprint:
|
||||
The fingerprint of the certificate to verify against.
|
||||
|
||||
Example:
|
||||
|
||||
.. code-block:: python
|
||||
|
||||
import urllib3
|
||||
|
||||
proxy = urllib3.ProxyManager("https://localhost:3128/")
|
||||
|
||||
resp1 = proxy.request("GET", "https://google.com/")
|
||||
resp2 = proxy.request("GET", "https://httpbin.org/")
|
||||
|
||||
print(len(proxy.pools))
|
||||
# 1
|
||||
|
||||
resp3 = proxy.request("GET", "https://httpbin.org/")
|
||||
resp4 = proxy.request("GET", "https://twitter.com/")
|
||||
|
||||
print(len(proxy.pools))
|
||||
# 3
|
||||
|
||||
"""
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
proxy_url: str,
|
||||
num_pools: int = 10,
|
||||
headers: typing.Mapping[str, str] | None = None,
|
||||
proxy_headers: typing.Mapping[str, str] | None = None,
|
||||
proxy_ssl_context: ssl.SSLContext | None = None,
|
||||
use_forwarding_for_https: bool = False,
|
||||
proxy_assert_hostname: None | str | typing.Literal[False] = None,
|
||||
proxy_assert_fingerprint: str | None = None,
|
||||
**connection_pool_kw: typing.Any,
|
||||
) -> None:
|
||||
if isinstance(proxy_url, HTTPConnectionPool):
|
||||
str_proxy_url = f"{proxy_url.scheme}://{proxy_url.host}:{proxy_url.port}"
|
||||
else:
|
||||
str_proxy_url = proxy_url
|
||||
proxy = parse_url(str_proxy_url)
|
||||
|
||||
if proxy.scheme not in ("http", "https"):
|
||||
raise ProxySchemeUnknown(proxy.scheme)
|
||||
|
||||
if not proxy.port:
|
||||
port = port_by_scheme.get(proxy.scheme, 80)
|
||||
proxy = proxy._replace(port=port)
|
||||
|
||||
self.proxy = proxy
|
||||
self.proxy_headers = proxy_headers or {}
|
||||
self.proxy_ssl_context = proxy_ssl_context
|
||||
self.proxy_config = ProxyConfig(
|
||||
proxy_ssl_context,
|
||||
use_forwarding_for_https,
|
||||
proxy_assert_hostname,
|
||||
proxy_assert_fingerprint,
|
||||
)
|
||||
|
||||
connection_pool_kw["_proxy"] = self.proxy
|
||||
connection_pool_kw["_proxy_headers"] = self.proxy_headers
|
||||
connection_pool_kw["_proxy_config"] = self.proxy_config
|
||||
|
||||
super().__init__(num_pools, headers, **connection_pool_kw)
|
||||
|
||||
def connection_from_host(
|
||||
self,
|
||||
host: str | None,
|
||||
port: int | None = None,
|
||||
scheme: str | None = "http",
|
||||
pool_kwargs: dict[str, typing.Any] | None = None,
|
||||
) -> HTTPConnectionPool:
|
||||
if scheme == "https":
|
||||
return super().connection_from_host(
|
||||
host, port, scheme, pool_kwargs=pool_kwargs
|
||||
)
|
||||
|
||||
return super().connection_from_host(
|
||||
self.proxy.host, self.proxy.port, self.proxy.scheme, pool_kwargs=pool_kwargs # type: ignore[union-attr]
|
||||
)
|
||||
|
||||
def _set_proxy_headers(
|
||||
self, url: str, headers: typing.Mapping[str, str] | None = None
|
||||
) -> typing.Mapping[str, str]:
|
||||
"""
|
||||
Sets headers needed by proxies: specifically, the Accept and Host
|
||||
headers. Only sets headers not provided by the user.
|
||||
"""
|
||||
headers_ = {"Accept": "*/*"}
|
||||
|
||||
netloc = parse_url(url).netloc
|
||||
if netloc:
|
||||
headers_["Host"] = netloc
|
||||
|
||||
if headers:
|
||||
headers_.update(headers)
|
||||
return headers_
|
||||
|
||||
def urlopen( # type: ignore[override]
|
||||
self, method: str, url: str, redirect: bool = True, **kw: typing.Any
|
||||
) -> BaseHTTPResponse:
|
||||
"Same as HTTP(S)ConnectionPool.urlopen, ``url`` must be absolute."
|
||||
u = parse_url(url)
|
||||
if not connection_requires_http_tunnel(self.proxy, self.proxy_config, u.scheme):
|
||||
# For connections using HTTP CONNECT, httplib sets the necessary
|
||||
# headers on the CONNECT to the proxy. If we're not using CONNECT,
|
||||
# we'll definitely need to set 'Host' at the very least.
|
||||
headers = kw.get("headers", self.headers)
|
||||
kw["headers"] = self._set_proxy_headers(url, headers)
|
||||
|
||||
return super().urlopen(method, url, redirect=redirect, **kw)
|
||||
|
||||
|
||||
def proxy_from_url(url: str, **kw: typing.Any) -> ProxyManager:
|
||||
return ProxyManager(proxy_url=url, **kw)
|
||||
@@ -0,0 +1,2 @@
|
||||
# Instruct type checkers to look for inline type annotations in this package.
|
||||
# See PEP 561.
|
||||
1472
path/to/venv/lib/python3.12/site-packages/urllib3/response.py
Normal file
1472
path/to/venv/lib/python3.12/site-packages/urllib3/response.py
Normal file
File diff suppressed because it is too large
Load Diff
@@ -0,0 +1,42 @@
|
||||
# For backwards compatibility, provide imports that used to be here.
|
||||
from __future__ import annotations
|
||||
|
||||
from .connection import is_connection_dropped
|
||||
from .request import SKIP_HEADER, SKIPPABLE_HEADERS, make_headers
|
||||
from .response import is_fp_closed
|
||||
from .retry import Retry
|
||||
from .ssl_ import (
|
||||
ALPN_PROTOCOLS,
|
||||
IS_PYOPENSSL,
|
||||
SSLContext,
|
||||
assert_fingerprint,
|
||||
create_urllib3_context,
|
||||
resolve_cert_reqs,
|
||||
resolve_ssl_version,
|
||||
ssl_wrap_socket,
|
||||
)
|
||||
from .timeout import Timeout
|
||||
from .url import Url, parse_url
|
||||
from .wait import wait_for_read, wait_for_write
|
||||
|
||||
__all__ = (
|
||||
"IS_PYOPENSSL",
|
||||
"SSLContext",
|
||||
"ALPN_PROTOCOLS",
|
||||
"Retry",
|
||||
"Timeout",
|
||||
"Url",
|
||||
"assert_fingerprint",
|
||||
"create_urllib3_context",
|
||||
"is_connection_dropped",
|
||||
"is_fp_closed",
|
||||
"parse_url",
|
||||
"make_headers",
|
||||
"resolve_cert_reqs",
|
||||
"resolve_ssl_version",
|
||||
"ssl_wrap_socket",
|
||||
"wait_for_read",
|
||||
"wait_for_write",
|
||||
"SKIP_HEADER",
|
||||
"SKIPPABLE_HEADERS",
|
||||
)
|
||||
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
Binary file not shown.
@@ -0,0 +1,137 @@
|
||||
from __future__ import annotations
|
||||
|
||||
import socket
|
||||
import typing
|
||||
|
||||
from ..exceptions import LocationParseError
|
||||
from .timeout import _DEFAULT_TIMEOUT, _TYPE_TIMEOUT
|
||||
|
||||
_TYPE_SOCKET_OPTIONS = list[tuple[int, int, typing.Union[int, bytes]]]
|
||||
|
||||
if typing.TYPE_CHECKING:
|
||||
from .._base_connection import BaseHTTPConnection
|
||||
|
||||
|
||||
def is_connection_dropped(conn: BaseHTTPConnection) -> bool: # Platform-specific
|
||||
"""
|
||||
Returns True if the connection is dropped and should be closed.
|
||||
:param conn: :class:`urllib3.connection.HTTPConnection` object.
|
||||
"""
|
||||
return not conn.is_connected
|
||||
|
||||
|
||||
# This function is copied from socket.py in the Python 2.7 standard
|
||||
# library test suite. Added to its signature is only `socket_options`.
|
||||
# One additional modification is that we avoid binding to IPv6 servers
|
||||
# discovered in DNS if the system doesn't have IPv6 functionality.
|
||||
def create_connection(
|
||||
address: tuple[str, int],
|
||||
timeout: _TYPE_TIMEOUT = _DEFAULT_TIMEOUT,
|
||||
source_address: tuple[str, int] | None = None,
|
||||
socket_options: _TYPE_SOCKET_OPTIONS | None = None,
|
||||
) -> socket.socket:
|
||||
"""Connect to *address* and return the socket object.
|
||||
|
||||
Convenience function. Connect to *address* (a 2-tuple ``(host,
|
||||
port)``) and return the socket object. Passing the optional
|
||||
*timeout* parameter will set the timeout on the socket instance
|
||||
before attempting to connect. If no *timeout* is supplied, the
|
||||
global default timeout setting returned by :func:`socket.getdefaulttimeout`
|
||||
is used. If *source_address* is set it must be a tuple of (host, port)
|
||||
for the socket to bind as a source address before making the connection.
|
||||
An host of '' or port 0 tells the OS to use the default.
|
||||
"""
|
||||
|
||||
host, port = address
|
||||
if host.startswith("["):
|
||||
host = host.strip("[]")
|
||||
err = None
|
||||
|
||||
# Using the value from allowed_gai_family() in the context of getaddrinfo lets
|
||||
# us select whether to work with IPv4 DNS records, IPv6 records, or both.
|
||||
# The original create_connection function always returns all records.
|
||||
family = allowed_gai_family()
|
||||
|
||||
try:
|
||||
host.encode("idna")
|
||||
except UnicodeError:
|
||||
raise LocationParseError(f"'{host}', label empty or too long") from None
|
||||
|
||||
for res in socket.getaddrinfo(host, port, family, socket.SOCK_STREAM):
|
||||
af, socktype, proto, canonname, sa = res
|
||||
sock = None
|
||||
try:
|
||||
sock = socket.socket(af, socktype, proto)
|
||||
|
||||
# If provided, set socket level options before connecting.
|
||||
_set_socket_options(sock, socket_options)
|
||||
|
||||
if timeout is not _DEFAULT_TIMEOUT:
|
||||
sock.settimeout(timeout)
|
||||
if source_address:
|
||||
sock.bind(source_address)
|
||||
sock.connect(sa)
|
||||
# Break explicitly a reference cycle
|
||||
err = None
|
||||
return sock
|
||||
|
||||
except OSError as _:
|
||||
err = _
|
||||
if sock is not None:
|
||||
sock.close()
|
||||
|
||||
if err is not None:
|
||||
try:
|
||||
raise err
|
||||
finally:
|
||||
# Break explicitly a reference cycle
|
||||
err = None
|
||||
else:
|
||||
raise OSError("getaddrinfo returns an empty list")
|
||||
|
||||
|
||||
def _set_socket_options(
|
||||
sock: socket.socket, options: _TYPE_SOCKET_OPTIONS | None
|
||||
) -> None:
|
||||
if options is None:
|
||||
return
|
||||
|
||||
for opt in options:
|
||||
sock.setsockopt(*opt)
|
||||
|
||||
|
||||
def allowed_gai_family() -> socket.AddressFamily:
|
||||
"""This function is designed to work in the context of
|
||||
getaddrinfo, where family=socket.AF_UNSPEC is the default and
|
||||
will perform a DNS search for both IPv6 and IPv4 records."""
|
||||
|
||||
family = socket.AF_INET
|
||||
if HAS_IPV6:
|
||||
family = socket.AF_UNSPEC
|
||||
return family
|
||||
|
||||
|
||||
def _has_ipv6(host: str) -> bool:
|
||||
"""Returns True if the system can bind an IPv6 address."""
|
||||
sock = None
|
||||
has_ipv6 = False
|
||||
|
||||
if socket.has_ipv6:
|
||||
# has_ipv6 returns true if cPython was compiled with IPv6 support.
|
||||
# It does not tell us if the system has IPv6 support enabled. To
|
||||
# determine that we must bind to an IPv6 address.
|
||||
# https://github.com/urllib3/urllib3/pull/611
|
||||
# https://bugs.python.org/issue658327
|
||||
try:
|
||||
sock = socket.socket(socket.AF_INET6)
|
||||
sock.bind((host, 0))
|
||||
has_ipv6 = True
|
||||
except Exception:
|
||||
pass
|
||||
|
||||
if sock:
|
||||
sock.close()
|
||||
return has_ipv6
|
||||
|
||||
|
||||
HAS_IPV6 = _has_ipv6("::1")
|
||||
@@ -0,0 +1,43 @@
|
||||
from __future__ import annotations
|
||||
|
||||
import typing
|
||||
|
||||
from .url import Url
|
||||
|
||||
if typing.TYPE_CHECKING:
|
||||
from ..connection import ProxyConfig
|
||||
|
||||
|
||||
def connection_requires_http_tunnel(
|
||||
proxy_url: Url | None = None,
|
||||
proxy_config: ProxyConfig | None = None,
|
||||
destination_scheme: str | None = None,
|
||||
) -> bool:
|
||||
"""
|
||||
Returns True if the connection requires an HTTP CONNECT through the proxy.
|
||||
|
||||
:param URL proxy_url:
|
||||
URL of the proxy.
|
||||
:param ProxyConfig proxy_config:
|
||||
Proxy configuration from poolmanager.py
|
||||
:param str destination_scheme:
|
||||
The scheme of the destination. (i.e https, http, etc)
|
||||
"""
|
||||
# If we're not using a proxy, no way to use a tunnel.
|
||||
if proxy_url is None:
|
||||
return False
|
||||
|
||||
# HTTP destinations never require tunneling, we always forward.
|
||||
if destination_scheme == "http":
|
||||
return False
|
||||
|
||||
# Support for forwarding with HTTPS proxies and HTTPS destinations.
|
||||
if (
|
||||
proxy_url.scheme == "https"
|
||||
and proxy_config
|
||||
and proxy_config.use_forwarding_for_https
|
||||
):
|
||||
return False
|
||||
|
||||
# Otherwise always use a tunnel.
|
||||
return True
|
||||
@@ -0,0 +1,263 @@
|
||||
from __future__ import annotations
|
||||
|
||||
import io
|
||||
import sys
|
||||
import typing
|
||||
from base64 import b64encode
|
||||
from enum import Enum
|
||||
|
||||
from ..exceptions import UnrewindableBodyError
|
||||
from .util import to_bytes
|
||||
|
||||
if typing.TYPE_CHECKING:
|
||||
from typing import Final
|
||||
|
||||
# Pass as a value within ``headers`` to skip
|
||||
# emitting some HTTP headers that are added automatically.
|
||||
# The only headers that are supported are ``Accept-Encoding``,
|
||||
# ``Host``, and ``User-Agent``.
|
||||
SKIP_HEADER = "@@@SKIP_HEADER@@@"
|
||||
SKIPPABLE_HEADERS = frozenset(["accept-encoding", "host", "user-agent"])
|
||||
|
||||
ACCEPT_ENCODING = "gzip,deflate"
|
||||
try:
|
||||
try:
|
||||
import brotlicffi as _unused_module_brotli # type: ignore[import-not-found] # noqa: F401
|
||||
except ImportError:
|
||||
import brotli as _unused_module_brotli # type: ignore[import-not-found] # noqa: F401
|
||||
except ImportError:
|
||||
pass
|
||||
else:
|
||||
ACCEPT_ENCODING += ",br"
|
||||
|
||||
try:
|
||||
if sys.version_info >= (3, 14):
|
||||
from compression import zstd as _unused_module_zstd # noqa: F401
|
||||
else:
|
||||
from backports import zstd as _unused_module_zstd # noqa: F401
|
||||
except ImportError:
|
||||
pass
|
||||
else:
|
||||
ACCEPT_ENCODING += ",zstd"
|
||||
|
||||
|
||||
class _TYPE_FAILEDTELL(Enum):
|
||||
token = 0
|
||||
|
||||
|
||||
_FAILEDTELL: Final[_TYPE_FAILEDTELL] = _TYPE_FAILEDTELL.token
|
||||
|
||||
_TYPE_BODY_POSITION = typing.Union[int, _TYPE_FAILEDTELL]
|
||||
|
||||
# When sending a request with these methods we aren't expecting
|
||||
# a body so don't need to set an explicit 'Content-Length: 0'
|
||||
# The reason we do this in the negative instead of tracking methods
|
||||
# which 'should' have a body is because unknown methods should be
|
||||
# treated as if they were 'POST' which *does* expect a body.
|
||||
_METHODS_NOT_EXPECTING_BODY = {"GET", "HEAD", "DELETE", "TRACE", "OPTIONS", "CONNECT"}
|
||||
|
||||
|
||||
def make_headers(
|
||||
keep_alive: bool | None = None,
|
||||
accept_encoding: bool | list[str] | str | None = None,
|
||||
user_agent: str | None = None,
|
||||
basic_auth: str | None = None,
|
||||
proxy_basic_auth: str | None = None,
|
||||
disable_cache: bool | None = None,
|
||||
) -> dict[str, str]:
|
||||
"""
|
||||
Shortcuts for generating request headers.
|
||||
|
||||
:param keep_alive:
|
||||
If ``True``, adds 'connection: keep-alive' header.
|
||||
|
||||
:param accept_encoding:
|
||||
Can be a boolean, list, or string.
|
||||
``True`` translates to 'gzip,deflate'. If the dependencies for
|
||||
Brotli (either the ``brotli`` or ``brotlicffi`` package) and/or
|
||||
Zstandard (the ``backports.zstd`` package for Python before 3.14)
|
||||
algorithms are installed, then their encodings are
|
||||
included in the string ('br' and 'zstd', respectively).
|
||||
List will get joined by comma.
|
||||
String will be used as provided.
|
||||
|
||||
:param user_agent:
|
||||
String representing the user-agent you want, such as
|
||||
"python-urllib3/0.6"
|
||||
|
||||
:param basic_auth:
|
||||
Colon-separated username:password string for 'authorization: basic ...'
|
||||
auth header.
|
||||
|
||||
:param proxy_basic_auth:
|
||||
Colon-separated username:password string for 'proxy-authorization: basic ...'
|
||||
auth header.
|
||||
|
||||
:param disable_cache:
|
||||
If ``True``, adds 'cache-control: no-cache' header.
|
||||
|
||||
Example:
|
||||
|
||||
.. code-block:: python
|
||||
|
||||
import urllib3
|
||||
|
||||
print(urllib3.util.make_headers(keep_alive=True, user_agent="Batman/1.0"))
|
||||
# {'connection': 'keep-alive', 'user-agent': 'Batman/1.0'}
|
||||
print(urllib3.util.make_headers(accept_encoding=True))
|
||||
# {'accept-encoding': 'gzip,deflate'}
|
||||
"""
|
||||
headers: dict[str, str] = {}
|
||||
if accept_encoding:
|
||||
if isinstance(accept_encoding, str):
|
||||
pass
|
||||
elif isinstance(accept_encoding, list):
|
||||
accept_encoding = ",".join(accept_encoding)
|
||||
else:
|
||||
accept_encoding = ACCEPT_ENCODING
|
||||
headers["accept-encoding"] = accept_encoding
|
||||
|
||||
if user_agent:
|
||||
headers["user-agent"] = user_agent
|
||||
|
||||
if keep_alive:
|
||||
headers["connection"] = "keep-alive"
|
||||
|
||||
if basic_auth:
|
||||
headers["authorization"] = (
|
||||
f"Basic {b64encode(basic_auth.encode('latin-1')).decode()}"
|
||||
)
|
||||
|
||||
if proxy_basic_auth:
|
||||
headers["proxy-authorization"] = (
|
||||
f"Basic {b64encode(proxy_basic_auth.encode('latin-1')).decode()}"
|
||||
)
|
||||
|
||||
if disable_cache:
|
||||
headers["cache-control"] = "no-cache"
|
||||
|
||||
return headers
|
||||
|
||||
|
||||
def set_file_position(
|
||||
body: typing.Any, pos: _TYPE_BODY_POSITION | None
|
||||
) -> _TYPE_BODY_POSITION | None:
|
||||
"""
|
||||
If a position is provided, move file to that point.
|
||||
Otherwise, we'll attempt to record a position for future use.
|
||||
"""
|
||||
if pos is not None:
|
||||
rewind_body(body, pos)
|
||||
elif getattr(body, "tell", None) is not None:
|
||||
try:
|
||||
pos = body.tell()
|
||||
except OSError:
|
||||
# This differentiates from None, allowing us to catch
|
||||
# a failed `tell()` later when trying to rewind the body.
|
||||
pos = _FAILEDTELL
|
||||
|
||||
return pos
|
||||
|
||||
|
||||
def rewind_body(body: typing.IO[typing.AnyStr], body_pos: _TYPE_BODY_POSITION) -> None:
|
||||
"""
|
||||
Attempt to rewind body to a certain position.
|
||||
Primarily used for request redirects and retries.
|
||||
|
||||
:param body:
|
||||
File-like object that supports seek.
|
||||
|
||||
:param int pos:
|
||||
Position to seek to in file.
|
||||
"""
|
||||
body_seek = getattr(body, "seek", None)
|
||||
if body_seek is not None and isinstance(body_pos, int):
|
||||
try:
|
||||
body_seek(body_pos)
|
||||
except OSError as e:
|
||||
raise UnrewindableBodyError(
|
||||
"An error occurred when rewinding request body for redirect/retry."
|
||||
) from e
|
||||
elif body_pos is _FAILEDTELL:
|
||||
raise UnrewindableBodyError(
|
||||
"Unable to record file position for rewinding "
|
||||
"request body during a redirect/retry."
|
||||
)
|
||||
else:
|
||||
raise ValueError(
|
||||
f"body_pos must be of type integer, instead it was {type(body_pos)}."
|
||||
)
|
||||
|
||||
|
||||
class ChunksAndContentLength(typing.NamedTuple):
|
||||
chunks: typing.Iterable[bytes] | None
|
||||
content_length: int | None
|
||||
|
||||
|
||||
def body_to_chunks(
|
||||
body: typing.Any | None, method: str, blocksize: int
|
||||
) -> ChunksAndContentLength:
|
||||
"""Takes the HTTP request method, body, and blocksize and
|
||||
transforms them into an iterable of chunks to pass to
|
||||
socket.sendall() and an optional 'Content-Length' header.
|
||||
|
||||
A 'Content-Length' of 'None' indicates the length of the body
|
||||
can't be determined so should use 'Transfer-Encoding: chunked'
|
||||
for framing instead.
|
||||
"""
|
||||
|
||||
chunks: typing.Iterable[bytes] | None
|
||||
content_length: int | None
|
||||
|
||||
# No body, we need to make a recommendation on 'Content-Length'
|
||||
# based on whether that request method is expected to have
|
||||
# a body or not.
|
||||
if body is None:
|
||||
chunks = None
|
||||
if method.upper() not in _METHODS_NOT_EXPECTING_BODY:
|
||||
content_length = 0
|
||||
else:
|
||||
content_length = None
|
||||
|
||||
# Bytes or strings become bytes
|
||||
elif isinstance(body, (str, bytes)):
|
||||
chunks = (to_bytes(body),)
|
||||
content_length = len(chunks[0])
|
||||
|
||||
# File-like object, TODO: use seek() and tell() for length?
|
||||
elif hasattr(body, "read"):
|
||||
|
||||
def chunk_readable() -> typing.Iterable[bytes]:
|
||||
encode = isinstance(body, io.TextIOBase)
|
||||
while True:
|
||||
datablock = body.read(blocksize)
|
||||
if not datablock:
|
||||
break
|
||||
if encode:
|
||||
datablock = datablock.encode("utf-8")
|
||||
yield datablock
|
||||
|
||||
chunks = chunk_readable()
|
||||
content_length = None
|
||||
|
||||
# Otherwise we need to start checking via duck-typing.
|
||||
else:
|
||||
try:
|
||||
# Check if the body implements the buffer API.
|
||||
mv = memoryview(body)
|
||||
except TypeError:
|
||||
try:
|
||||
# Check if the body is an iterable
|
||||
chunks = iter(body)
|
||||
content_length = None
|
||||
except TypeError:
|
||||
raise TypeError(
|
||||
f"'body' must be a bytes-like object, file-like "
|
||||
f"object, or iterable. Instead was {body!r}"
|
||||
) from None
|
||||
else:
|
||||
# Since it implements the buffer API can be passed directly to socket.sendall()
|
||||
chunks = (body,)
|
||||
content_length = mv.nbytes
|
||||
|
||||
return ChunksAndContentLength(chunks=chunks, content_length=content_length)
|
||||
@@ -0,0 +1,101 @@
|
||||
from __future__ import annotations
|
||||
|
||||
import http.client as httplib
|
||||
from email.errors import MultipartInvariantViolationDefect, StartBoundaryNotFoundDefect
|
||||
|
||||
from ..exceptions import HeaderParsingError
|
||||
|
||||
|
||||
def is_fp_closed(obj: object) -> bool:
|
||||
"""
|
||||
Checks whether a given file-like object is closed.
|
||||
|
||||
:param obj:
|
||||
The file-like object to check.
|
||||
"""
|
||||
|
||||
try:
|
||||
# Check `isclosed()` first, in case Python3 doesn't set `closed`.
|
||||
# GH Issue #928
|
||||
return obj.isclosed() # type: ignore[no-any-return, attr-defined]
|
||||
except AttributeError:
|
||||
pass
|
||||
|
||||
try:
|
||||
# Check via the official file-like-object way.
|
||||
return obj.closed # type: ignore[no-any-return, attr-defined]
|
||||
except AttributeError:
|
||||
pass
|
||||
|
||||
try:
|
||||
# Check if the object is a container for another file-like object that
|
||||
# gets released on exhaustion (e.g. HTTPResponse).
|
||||
return obj.fp is None # type: ignore[attr-defined]
|
||||
except AttributeError:
|
||||
pass
|
||||
|
||||
raise ValueError("Unable to determine whether fp is closed.")
|
||||
|
||||
|
||||
def assert_header_parsing(headers: httplib.HTTPMessage) -> None:
|
||||
"""
|
||||
Asserts whether all headers have been successfully parsed.
|
||||
Extracts encountered errors from the result of parsing headers.
|
||||
|
||||
Only works on Python 3.
|
||||
|
||||
:param http.client.HTTPMessage headers: Headers to verify.
|
||||
|
||||
:raises urllib3.exceptions.HeaderParsingError:
|
||||
If parsing errors are found.
|
||||
"""
|
||||
|
||||
# This will fail silently if we pass in the wrong kind of parameter.
|
||||
# To make debugging easier add an explicit check.
|
||||
if not isinstance(headers, httplib.HTTPMessage):
|
||||
raise TypeError(f"expected httplib.Message, got {type(headers)}.")
|
||||
|
||||
unparsed_data = None
|
||||
|
||||
# get_payload is actually email.message.Message.get_payload;
|
||||
# we're only interested in the result if it's not a multipart message
|
||||
if not headers.is_multipart():
|
||||
payload = headers.get_payload()
|
||||
|
||||
if isinstance(payload, (bytes, str)):
|
||||
unparsed_data = payload
|
||||
|
||||
# httplib is assuming a response body is available
|
||||
# when parsing headers even when httplib only sends
|
||||
# header data to parse_headers() This results in
|
||||
# defects on multipart responses in particular.
|
||||
# See: https://github.com/urllib3/urllib3/issues/800
|
||||
|
||||
# So we ignore the following defects:
|
||||
# - StartBoundaryNotFoundDefect:
|
||||
# The claimed start boundary was never found.
|
||||
# - MultipartInvariantViolationDefect:
|
||||
# A message claimed to be a multipart but no subparts were found.
|
||||
defects = [
|
||||
defect
|
||||
for defect in headers.defects
|
||||
if not isinstance(
|
||||
defect, (StartBoundaryNotFoundDefect, MultipartInvariantViolationDefect)
|
||||
)
|
||||
]
|
||||
|
||||
if defects or unparsed_data:
|
||||
raise HeaderParsingError(defects=defects, unparsed_data=unparsed_data)
|
||||
|
||||
|
||||
def is_response_to_head(response: httplib.HTTPResponse) -> bool:
|
||||
"""
|
||||
Checks whether the request of a response has been a HEAD-request.
|
||||
|
||||
:param http.client.HTTPResponse response:
|
||||
Response to check if the originating request
|
||||
used 'HEAD' as a method.
|
||||
"""
|
||||
# FIXME: Can we do this somehow without accessing private httplib _method?
|
||||
method_str = response._method # type: str # type: ignore[attr-defined]
|
||||
return method_str.upper() == "HEAD"
|
||||
533
path/to/venv/lib/python3.12/site-packages/urllib3/util/retry.py
Normal file
533
path/to/venv/lib/python3.12/site-packages/urllib3/util/retry.py
Normal file
@@ -0,0 +1,533 @@
|
||||
from __future__ import annotations
|
||||
|
||||
import email
|
||||
import logging
|
||||
import random
|
||||
import re
|
||||
import time
|
||||
import typing
|
||||
from itertools import takewhile
|
||||
from types import TracebackType
|
||||
|
||||
from ..exceptions import (
|
||||
ConnectTimeoutError,
|
||||
InvalidHeader,
|
||||
MaxRetryError,
|
||||
ProtocolError,
|
||||
ProxyError,
|
||||
ReadTimeoutError,
|
||||
ResponseError,
|
||||
)
|
||||
from .util import reraise
|
||||
|
||||
if typing.TYPE_CHECKING:
|
||||
from typing_extensions import Self
|
||||
|
||||
from ..connectionpool import ConnectionPool
|
||||
from ..response import BaseHTTPResponse
|
||||
|
||||
log = logging.getLogger(__name__)
|
||||
|
||||
|
||||
# Data structure for representing the metadata of requests that result in a retry.
|
||||
class RequestHistory(typing.NamedTuple):
|
||||
method: str | None
|
||||
url: str | None
|
||||
error: Exception | None
|
||||
status: int | None
|
||||
redirect_location: str | None
|
||||
|
||||
|
||||
class Retry:
|
||||
"""Retry configuration.
|
||||
|
||||
Each retry attempt will create a new Retry object with updated values, so
|
||||
they can be safely reused.
|
||||
|
||||
Retries can be defined as a default for a pool:
|
||||
|
||||
.. code-block:: python
|
||||
|
||||
retries = Retry(connect=5, read=2, redirect=5)
|
||||
http = PoolManager(retries=retries)
|
||||
response = http.request("GET", "https://example.com/")
|
||||
|
||||
Or per-request (which overrides the default for the pool):
|
||||
|
||||
.. code-block:: python
|
||||
|
||||
response = http.request("GET", "https://example.com/", retries=Retry(10))
|
||||
|
||||
Retries can be disabled by passing ``False``:
|
||||
|
||||
.. code-block:: python
|
||||
|
||||
response = http.request("GET", "https://example.com/", retries=False)
|
||||
|
||||
Errors will be wrapped in :class:`~urllib3.exceptions.MaxRetryError` unless
|
||||
retries are disabled, in which case the causing exception will be raised.
|
||||
|
||||
:param int total:
|
||||
Total number of retries to allow. Takes precedence over other counts.
|
||||
|
||||
Set to ``None`` to remove this constraint and fall back on other
|
||||
counts.
|
||||
|
||||
Set to ``0`` to fail on the first retry.
|
||||
|
||||
Set to ``False`` to disable and imply ``raise_on_redirect=False``.
|
||||
|
||||
:param int connect:
|
||||
How many connection-related errors to retry on.
|
||||
|
||||
These are errors raised before the request is sent to the remote server,
|
||||
which we assume has not triggered the server to process the request.
|
||||
|
||||
Set to ``0`` to fail on the first retry of this type.
|
||||
|
||||
:param int read:
|
||||
How many times to retry on read errors.
|
||||
|
||||
These errors are raised after the request was sent to the server, so the
|
||||
request may have side-effects.
|
||||
|
||||
Set to ``0`` to fail on the first retry of this type.
|
||||
|
||||
:param int redirect:
|
||||
How many redirects to perform. Limit this to avoid infinite redirect
|
||||
loops.
|
||||
|
||||
A redirect is a HTTP response with a status code 301, 302, 303, 307 or
|
||||
308.
|
||||
|
||||
Set to ``0`` to fail on the first retry of this type.
|
||||
|
||||
Set to ``False`` to disable and imply ``raise_on_redirect=False``.
|
||||
|
||||
:param int status:
|
||||
How many times to retry on bad status codes.
|
||||
|
||||
These are retries made on responses, where status code matches
|
||||
``status_forcelist``.
|
||||
|
||||
Set to ``0`` to fail on the first retry of this type.
|
||||
|
||||
:param int other:
|
||||
How many times to retry on other errors.
|
||||
|
||||
Other errors are errors that are not connect, read, redirect or status errors.
|
||||
These errors might be raised after the request was sent to the server, so the
|
||||
request might have side-effects.
|
||||
|
||||
Set to ``0`` to fail on the first retry of this type.
|
||||
|
||||
If ``total`` is not set, it's a good idea to set this to 0 to account
|
||||
for unexpected edge cases and avoid infinite retry loops.
|
||||
|
||||
:param Collection allowed_methods:
|
||||
Set of uppercased HTTP method verbs that we should retry on.
|
||||
|
||||
By default, we only retry on methods which are considered to be
|
||||
idempotent (multiple requests with the same parameters end with the
|
||||
same state). See :attr:`Retry.DEFAULT_ALLOWED_METHODS`.
|
||||
|
||||
Set to a ``None`` value to retry on any verb.
|
||||
|
||||
:param Collection status_forcelist:
|
||||
A set of integer HTTP status codes that we should force a retry on.
|
||||
A retry is initiated if the request method is in ``allowed_methods``
|
||||
and the response status code is in ``status_forcelist``.
|
||||
|
||||
By default, this is disabled with ``None``.
|
||||
|
||||
:param float backoff_factor:
|
||||
A backoff factor to apply between attempts after the second try
|
||||
(most errors are resolved immediately by a second try without a
|
||||
delay). urllib3 will sleep for::
|
||||
|
||||
{backoff factor} * (2 ** ({number of previous retries}))
|
||||
|
||||
seconds. If `backoff_jitter` is non-zero, this sleep is extended by::
|
||||
|
||||
random.uniform(0, {backoff jitter})
|
||||
|
||||
seconds. For example, if the backoff_factor is 0.1, then :func:`Retry.sleep` will
|
||||
sleep for [0.0s, 0.2s, 0.4s, 0.8s, ...] between retries. No backoff will ever
|
||||
be longer than `backoff_max`.
|
||||
|
||||
By default, backoff is disabled (factor set to 0).
|
||||
|
||||
:param bool raise_on_redirect: Whether, if the number of redirects is
|
||||
exhausted, to raise a MaxRetryError, or to return a response with a
|
||||
response code in the 3xx range.
|
||||
|
||||
:param bool raise_on_status: Similar meaning to ``raise_on_redirect``:
|
||||
whether we should raise an exception, or return a response,
|
||||
if status falls in ``status_forcelist`` range and retries have
|
||||
been exhausted.
|
||||
|
||||
:param tuple history: The history of the request encountered during
|
||||
each call to :meth:`~Retry.increment`. The list is in the order
|
||||
the requests occurred. Each list item is of class :class:`RequestHistory`.
|
||||
|
||||
:param bool respect_retry_after_header:
|
||||
Whether to respect Retry-After header on status codes defined as
|
||||
:attr:`Retry.RETRY_AFTER_STATUS_CODES` or not.
|
||||
|
||||
:param Collection remove_headers_on_redirect:
|
||||
Sequence of headers to remove from the request when a response
|
||||
indicating a redirect is returned before firing off the redirected
|
||||
request.
|
||||
"""
|
||||
|
||||
#: Default methods to be used for ``allowed_methods``
|
||||
DEFAULT_ALLOWED_METHODS = frozenset(
|
||||
["HEAD", "GET", "PUT", "DELETE", "OPTIONS", "TRACE"]
|
||||
)
|
||||
|
||||
#: Default status codes to be used for ``status_forcelist``
|
||||
RETRY_AFTER_STATUS_CODES = frozenset([413, 429, 503])
|
||||
|
||||
#: Default headers to be used for ``remove_headers_on_redirect``
|
||||
DEFAULT_REMOVE_HEADERS_ON_REDIRECT = frozenset(
|
||||
["Cookie", "Authorization", "Proxy-Authorization"]
|
||||
)
|
||||
|
||||
#: Default maximum backoff time.
|
||||
DEFAULT_BACKOFF_MAX = 120
|
||||
|
||||
# Backward compatibility; assigned outside of the class.
|
||||
DEFAULT: typing.ClassVar[Retry]
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
total: bool | int | None = 10,
|
||||
connect: int | None = None,
|
||||
read: int | None = None,
|
||||
redirect: bool | int | None = None,
|
||||
status: int | None = None,
|
||||
other: int | None = None,
|
||||
allowed_methods: typing.Collection[str] | None = DEFAULT_ALLOWED_METHODS,
|
||||
status_forcelist: typing.Collection[int] | None = None,
|
||||
backoff_factor: float = 0,
|
||||
backoff_max: float = DEFAULT_BACKOFF_MAX,
|
||||
raise_on_redirect: bool = True,
|
||||
raise_on_status: bool = True,
|
||||
history: tuple[RequestHistory, ...] | None = None,
|
||||
respect_retry_after_header: bool = True,
|
||||
remove_headers_on_redirect: typing.Collection[
|
||||
str
|
||||
] = DEFAULT_REMOVE_HEADERS_ON_REDIRECT,
|
||||
backoff_jitter: float = 0.0,
|
||||
) -> None:
|
||||
self.total = total
|
||||
self.connect = connect
|
||||
self.read = read
|
||||
self.status = status
|
||||
self.other = other
|
||||
|
||||
if redirect is False or total is False:
|
||||
redirect = 0
|
||||
raise_on_redirect = False
|
||||
|
||||
self.redirect = redirect
|
||||
self.status_forcelist = status_forcelist or set()
|
||||
self.allowed_methods = allowed_methods
|
||||
self.backoff_factor = backoff_factor
|
||||
self.backoff_max = backoff_max
|
||||
self.raise_on_redirect = raise_on_redirect
|
||||
self.raise_on_status = raise_on_status
|
||||
self.history = history or ()
|
||||
self.respect_retry_after_header = respect_retry_after_header
|
||||
self.remove_headers_on_redirect = frozenset(
|
||||
h.lower() for h in remove_headers_on_redirect
|
||||
)
|
||||
self.backoff_jitter = backoff_jitter
|
||||
|
||||
def new(self, **kw: typing.Any) -> Self:
|
||||
params = dict(
|
||||
total=self.total,
|
||||
connect=self.connect,
|
||||
read=self.read,
|
||||
redirect=self.redirect,
|
||||
status=self.status,
|
||||
other=self.other,
|
||||
allowed_methods=self.allowed_methods,
|
||||
status_forcelist=self.status_forcelist,
|
||||
backoff_factor=self.backoff_factor,
|
||||
backoff_max=self.backoff_max,
|
||||
raise_on_redirect=self.raise_on_redirect,
|
||||
raise_on_status=self.raise_on_status,
|
||||
history=self.history,
|
||||
remove_headers_on_redirect=self.remove_headers_on_redirect,
|
||||
respect_retry_after_header=self.respect_retry_after_header,
|
||||
backoff_jitter=self.backoff_jitter,
|
||||
)
|
||||
|
||||
params.update(kw)
|
||||
return type(self)(**params) # type: ignore[arg-type]
|
||||
|
||||
@classmethod
|
||||
def from_int(
|
||||
cls,
|
||||
retries: Retry | bool | int | None,
|
||||
redirect: bool | int | None = True,
|
||||
default: Retry | bool | int | None = None,
|
||||
) -> Retry:
|
||||
"""Backwards-compatibility for the old retries format."""
|
||||
if retries is None:
|
||||
retries = default if default is not None else cls.DEFAULT
|
||||
|
||||
if isinstance(retries, Retry):
|
||||
return retries
|
||||
|
||||
redirect = bool(redirect) and None
|
||||
new_retries = cls(retries, redirect=redirect)
|
||||
log.debug("Converted retries value: %r -> %r", retries, new_retries)
|
||||
return new_retries
|
||||
|
||||
def get_backoff_time(self) -> float:
|
||||
"""Formula for computing the current backoff
|
||||
|
||||
:rtype: float
|
||||
"""
|
||||
# We want to consider only the last consecutive errors sequence (Ignore redirects).
|
||||
consecutive_errors_len = len(
|
||||
list(
|
||||
takewhile(lambda x: x.redirect_location is None, reversed(self.history))
|
||||
)
|
||||
)
|
||||
if consecutive_errors_len <= 1:
|
||||
return 0
|
||||
|
||||
backoff_value = self.backoff_factor * (2 ** (consecutive_errors_len - 1))
|
||||
if self.backoff_jitter != 0.0:
|
||||
backoff_value += random.random() * self.backoff_jitter
|
||||
return float(max(0, min(self.backoff_max, backoff_value)))
|
||||
|
||||
def parse_retry_after(self, retry_after: str) -> float:
|
||||
seconds: float
|
||||
# Whitespace: https://tools.ietf.org/html/rfc7230#section-3.2.4
|
||||
if re.match(r"^\s*[0-9]+\s*$", retry_after):
|
||||
seconds = int(retry_after)
|
||||
else:
|
||||
retry_date_tuple = email.utils.parsedate_tz(retry_after)
|
||||
if retry_date_tuple is None:
|
||||
raise InvalidHeader(f"Invalid Retry-After header: {retry_after}")
|
||||
|
||||
retry_date = email.utils.mktime_tz(retry_date_tuple)
|
||||
seconds = retry_date - time.time()
|
||||
|
||||
seconds = max(seconds, 0)
|
||||
|
||||
return seconds
|
||||
|
||||
def get_retry_after(self, response: BaseHTTPResponse) -> float | None:
|
||||
"""Get the value of Retry-After in seconds."""
|
||||
|
||||
retry_after = response.headers.get("Retry-After")
|
||||
|
||||
if retry_after is None:
|
||||
return None
|
||||
|
||||
return self.parse_retry_after(retry_after)
|
||||
|
||||
def sleep_for_retry(self, response: BaseHTTPResponse) -> bool:
|
||||
retry_after = self.get_retry_after(response)
|
||||
if retry_after:
|
||||
time.sleep(retry_after)
|
||||
return True
|
||||
|
||||
return False
|
||||
|
||||
def _sleep_backoff(self) -> None:
|
||||
backoff = self.get_backoff_time()
|
||||
if backoff <= 0:
|
||||
return
|
||||
time.sleep(backoff)
|
||||
|
||||
def sleep(self, response: BaseHTTPResponse | None = None) -> None:
|
||||
"""Sleep between retry attempts.
|
||||
|
||||
This method will respect a server's ``Retry-After`` response header
|
||||
and sleep the duration of the time requested. If that is not present, it
|
||||
will use an exponential backoff. By default, the backoff factor is 0 and
|
||||
this method will return immediately.
|
||||
"""
|
||||
|
||||
if self.respect_retry_after_header and response:
|
||||
slept = self.sleep_for_retry(response)
|
||||
if slept:
|
||||
return
|
||||
|
||||
self._sleep_backoff()
|
||||
|
||||
def _is_connection_error(self, err: Exception) -> bool:
|
||||
"""Errors when we're fairly sure that the server did not receive the
|
||||
request, so it should be safe to retry.
|
||||
"""
|
||||
if isinstance(err, ProxyError):
|
||||
err = err.original_error
|
||||
return isinstance(err, ConnectTimeoutError)
|
||||
|
||||
def _is_read_error(self, err: Exception) -> bool:
|
||||
"""Errors that occur after the request has been started, so we should
|
||||
assume that the server began processing it.
|
||||
"""
|
||||
return isinstance(err, (ReadTimeoutError, ProtocolError))
|
||||
|
||||
def _is_method_retryable(self, method: str) -> bool:
|
||||
"""Checks if a given HTTP method should be retried upon, depending if
|
||||
it is included in the allowed_methods
|
||||
"""
|
||||
if self.allowed_methods and method.upper() not in self.allowed_methods:
|
||||
return False
|
||||
return True
|
||||
|
||||
def is_retry(
|
||||
self, method: str, status_code: int, has_retry_after: bool = False
|
||||
) -> bool:
|
||||
"""Is this method/status code retryable? (Based on allowlists and control
|
||||
variables such as the number of total retries to allow, whether to
|
||||
respect the Retry-After header, whether this header is present, and
|
||||
whether the returned status code is on the list of status codes to
|
||||
be retried upon on the presence of the aforementioned header)
|
||||
"""
|
||||
if not self._is_method_retryable(method):
|
||||
return False
|
||||
|
||||
if self.status_forcelist and status_code in self.status_forcelist:
|
||||
return True
|
||||
|
||||
return bool(
|
||||
self.total
|
||||
and self.respect_retry_after_header
|
||||
and has_retry_after
|
||||
and (status_code in self.RETRY_AFTER_STATUS_CODES)
|
||||
)
|
||||
|
||||
def is_exhausted(self) -> bool:
|
||||
"""Are we out of retries?"""
|
||||
retry_counts = [
|
||||
x
|
||||
for x in (
|
||||
self.total,
|
||||
self.connect,
|
||||
self.read,
|
||||
self.redirect,
|
||||
self.status,
|
||||
self.other,
|
||||
)
|
||||
if x
|
||||
]
|
||||
if not retry_counts:
|
||||
return False
|
||||
|
||||
return min(retry_counts) < 0
|
||||
|
||||
def increment(
|
||||
self,
|
||||
method: str | None = None,
|
||||
url: str | None = None,
|
||||
response: BaseHTTPResponse | None = None,
|
||||
error: Exception | None = None,
|
||||
_pool: ConnectionPool | None = None,
|
||||
_stacktrace: TracebackType | None = None,
|
||||
) -> Self:
|
||||
"""Return a new Retry object with incremented retry counters.
|
||||
|
||||
:param response: A response object, or None, if the server did not
|
||||
return a response.
|
||||
:type response: :class:`~urllib3.response.BaseHTTPResponse`
|
||||
:param Exception error: An error encountered during the request, or
|
||||
None if the response was received successfully.
|
||||
|
||||
:return: A new ``Retry`` object.
|
||||
"""
|
||||
if self.total is False and error:
|
||||
# Disabled, indicate to re-raise the error.
|
||||
raise reraise(type(error), error, _stacktrace)
|
||||
|
||||
total = self.total
|
||||
if total is not None:
|
||||
total -= 1
|
||||
|
||||
connect = self.connect
|
||||
read = self.read
|
||||
redirect = self.redirect
|
||||
status_count = self.status
|
||||
other = self.other
|
||||
cause = "unknown"
|
||||
status = None
|
||||
redirect_location = None
|
||||
|
||||
if error and self._is_connection_error(error):
|
||||
# Connect retry?
|
||||
if connect is False:
|
||||
raise reraise(type(error), error, _stacktrace)
|
||||
elif connect is not None:
|
||||
connect -= 1
|
||||
|
||||
elif error and self._is_read_error(error):
|
||||
# Read retry?
|
||||
if read is False or method is None or not self._is_method_retryable(method):
|
||||
raise reraise(type(error), error, _stacktrace)
|
||||
elif read is not None:
|
||||
read -= 1
|
||||
|
||||
elif error:
|
||||
# Other retry?
|
||||
if other is not None:
|
||||
other -= 1
|
||||
|
||||
elif response and response.get_redirect_location():
|
||||
# Redirect retry?
|
||||
if redirect is not None:
|
||||
redirect -= 1
|
||||
cause = "too many redirects"
|
||||
response_redirect_location = response.get_redirect_location()
|
||||
if response_redirect_location:
|
||||
redirect_location = response_redirect_location
|
||||
status = response.status
|
||||
|
||||
else:
|
||||
# Incrementing because of a server error like a 500 in
|
||||
# status_forcelist and the given method is in the allowed_methods
|
||||
cause = ResponseError.GENERIC_ERROR
|
||||
if response and response.status:
|
||||
if status_count is not None:
|
||||
status_count -= 1
|
||||
cause = ResponseError.SPECIFIC_ERROR.format(status_code=response.status)
|
||||
status = response.status
|
||||
|
||||
history = self.history + (
|
||||
RequestHistory(method, url, error, status, redirect_location),
|
||||
)
|
||||
|
||||
new_retry = self.new(
|
||||
total=total,
|
||||
connect=connect,
|
||||
read=read,
|
||||
redirect=redirect,
|
||||
status=status_count,
|
||||
other=other,
|
||||
history=history,
|
||||
)
|
||||
|
||||
if new_retry.is_exhausted():
|
||||
reason = error or ResponseError(cause)
|
||||
raise MaxRetryError(_pool, url, reason) from reason # type: ignore[arg-type]
|
||||
|
||||
log.debug("Incremented Retry for (url='%s'): %r", url, new_retry)
|
||||
|
||||
return new_retry
|
||||
|
||||
def __repr__(self) -> str:
|
||||
return (
|
||||
f"{type(self).__name__}(total={self.total}, connect={self.connect}, "
|
||||
f"read={self.read}, redirect={self.redirect}, status={self.status})"
|
||||
)
|
||||
|
||||
|
||||
# For backwards compatibility (equivalent to pre-v1.9):
|
||||
Retry.DEFAULT = Retry(3)
|
||||
527
path/to/venv/lib/python3.12/site-packages/urllib3/util/ssl_.py
Normal file
527
path/to/venv/lib/python3.12/site-packages/urllib3/util/ssl_.py
Normal file
@@ -0,0 +1,527 @@
|
||||
from __future__ import annotations
|
||||
|
||||
import hashlib
|
||||
import hmac
|
||||
import os
|
||||
import socket
|
||||
import sys
|
||||
import typing
|
||||
import warnings
|
||||
from binascii import unhexlify
|
||||
|
||||
from ..exceptions import ProxySchemeUnsupported, SSLError
|
||||
from .url import _BRACELESS_IPV6_ADDRZ_RE, _IPV4_RE
|
||||
|
||||
SSLContext = None
|
||||
SSLTransport = None
|
||||
HAS_NEVER_CHECK_COMMON_NAME = False
|
||||
IS_PYOPENSSL = False
|
||||
ALPN_PROTOCOLS = ["http/1.1"]
|
||||
|
||||
_TYPE_VERSION_INFO = tuple[int, int, int, str, int]
|
||||
|
||||
# Maps the length of a digest to a possible hash function producing this digest
|
||||
HASHFUNC_MAP = {
|
||||
length: getattr(hashlib, algorithm, None)
|
||||
for length, algorithm in ((32, "md5"), (40, "sha1"), (64, "sha256"))
|
||||
}
|
||||
|
||||
|
||||
def _is_bpo_43522_fixed(
|
||||
implementation_name: str,
|
||||
version_info: _TYPE_VERSION_INFO,
|
||||
pypy_version_info: _TYPE_VERSION_INFO | None,
|
||||
) -> bool:
|
||||
"""Return True for CPython 3.9.3+ or 3.10+ and PyPy 7.3.8+ where
|
||||
setting SSLContext.hostname_checks_common_name to False works.
|
||||
|
||||
Outside of CPython and PyPy we don't know which implementations work
|
||||
or not so we conservatively use our hostname matching as we know that works
|
||||
on all implementations.
|
||||
|
||||
https://github.com/urllib3/urllib3/issues/2192#issuecomment-821832963
|
||||
https://foss.heptapod.net/pypy/pypy/-/issues/3539
|
||||
"""
|
||||
if implementation_name == "pypy":
|
||||
# https://foss.heptapod.net/pypy/pypy/-/issues/3129
|
||||
return pypy_version_info >= (7, 3, 8) # type: ignore[operator]
|
||||
elif implementation_name == "cpython":
|
||||
major_minor = version_info[:2]
|
||||
micro = version_info[2]
|
||||
return (major_minor == (3, 9) and micro >= 3) or major_minor >= (3, 10)
|
||||
else: # Defensive:
|
||||
return False
|
||||
|
||||
|
||||
def _is_has_never_check_common_name_reliable(
|
||||
openssl_version: str,
|
||||
openssl_version_number: int,
|
||||
implementation_name: str,
|
||||
version_info: _TYPE_VERSION_INFO,
|
||||
pypy_version_info: _TYPE_VERSION_INFO | None,
|
||||
) -> bool:
|
||||
# As of May 2023, all released versions of LibreSSL fail to reject certificates with
|
||||
# only common names, see https://github.com/urllib3/urllib3/pull/3024
|
||||
is_openssl = openssl_version.startswith("OpenSSL ")
|
||||
# Before fixing OpenSSL issue #14579, the SSL_new() API was not copying hostflags
|
||||
# like X509_CHECK_FLAG_NEVER_CHECK_SUBJECT, which tripped up CPython.
|
||||
# https://github.com/openssl/openssl/issues/14579
|
||||
# This was released in OpenSSL 1.1.1l+ (>=0x101010cf)
|
||||
is_openssl_issue_14579_fixed = openssl_version_number >= 0x101010CF
|
||||
|
||||
return is_openssl and (
|
||||
is_openssl_issue_14579_fixed
|
||||
or _is_bpo_43522_fixed(implementation_name, version_info, pypy_version_info)
|
||||
)
|
||||
|
||||
|
||||
if typing.TYPE_CHECKING:
|
||||
from ssl import VerifyMode
|
||||
from typing import TypedDict
|
||||
|
||||
from .ssltransport import SSLTransport as SSLTransportType
|
||||
|
||||
class _TYPE_PEER_CERT_RET_DICT(TypedDict, total=False):
|
||||
subjectAltName: tuple[tuple[str, str], ...]
|
||||
subject: tuple[tuple[tuple[str, str], ...], ...]
|
||||
serialNumber: str
|
||||
|
||||
|
||||
# Mapping from 'ssl.PROTOCOL_TLSX' to 'TLSVersion.X'
|
||||
_SSL_VERSION_TO_TLS_VERSION: dict[int, int] = {}
|
||||
|
||||
try: # Do we have ssl at all?
|
||||
import ssl
|
||||
from ssl import ( # type: ignore[assignment]
|
||||
CERT_REQUIRED,
|
||||
HAS_NEVER_CHECK_COMMON_NAME,
|
||||
OP_NO_COMPRESSION,
|
||||
OP_NO_TICKET,
|
||||
OPENSSL_VERSION,
|
||||
OPENSSL_VERSION_NUMBER,
|
||||
PROTOCOL_TLS,
|
||||
PROTOCOL_TLS_CLIENT,
|
||||
VERIFY_X509_STRICT,
|
||||
OP_NO_SSLv2,
|
||||
OP_NO_SSLv3,
|
||||
SSLContext,
|
||||
TLSVersion,
|
||||
)
|
||||
|
||||
PROTOCOL_SSLv23 = PROTOCOL_TLS
|
||||
|
||||
# Needed for Python 3.9 which does not define this
|
||||
VERIFY_X509_PARTIAL_CHAIN = getattr(ssl, "VERIFY_X509_PARTIAL_CHAIN", 0x80000)
|
||||
|
||||
# Setting SSLContext.hostname_checks_common_name = False didn't work before CPython
|
||||
# 3.9.3, and 3.10 (but OK on PyPy) or OpenSSL 1.1.1l+
|
||||
if HAS_NEVER_CHECK_COMMON_NAME and not _is_has_never_check_common_name_reliable(
|
||||
OPENSSL_VERSION,
|
||||
OPENSSL_VERSION_NUMBER,
|
||||
sys.implementation.name,
|
||||
sys.version_info,
|
||||
sys.pypy_version_info if sys.implementation.name == "pypy" else None, # type: ignore[attr-defined]
|
||||
): # Defensive: for Python < 3.9.3
|
||||
HAS_NEVER_CHECK_COMMON_NAME = False
|
||||
|
||||
# Need to be careful here in case old TLS versions get
|
||||
# removed in future 'ssl' module implementations.
|
||||
for attr in ("TLSv1", "TLSv1_1", "TLSv1_2"):
|
||||
try:
|
||||
_SSL_VERSION_TO_TLS_VERSION[getattr(ssl, f"PROTOCOL_{attr}")] = getattr(
|
||||
TLSVersion, attr
|
||||
)
|
||||
except AttributeError: # Defensive:
|
||||
continue
|
||||
|
||||
from .ssltransport import SSLTransport # type: ignore[assignment]
|
||||
except ImportError:
|
||||
OP_NO_COMPRESSION = 0x20000 # type: ignore[assignment, misc]
|
||||
OP_NO_TICKET = 0x4000 # type: ignore[assignment, misc]
|
||||
OP_NO_SSLv2 = 0x1000000 # type: ignore[assignment, misc]
|
||||
OP_NO_SSLv3 = 0x2000000 # type: ignore[assignment, misc]
|
||||
PROTOCOL_SSLv23 = PROTOCOL_TLS = 2 # type: ignore[assignment, misc]
|
||||
PROTOCOL_TLS_CLIENT = 16 # type: ignore[assignment, misc]
|
||||
VERIFY_X509_PARTIAL_CHAIN = 0x80000
|
||||
VERIFY_X509_STRICT = 0x20 # type: ignore[assignment, misc]
|
||||
|
||||
|
||||
_TYPE_PEER_CERT_RET = typing.Union["_TYPE_PEER_CERT_RET_DICT", bytes, None]
|
||||
|
||||
|
||||
def assert_fingerprint(cert: bytes | None, fingerprint: str) -> None:
|
||||
"""
|
||||
Checks if given fingerprint matches the supplied certificate.
|
||||
|
||||
:param cert:
|
||||
Certificate as bytes object.
|
||||
:param fingerprint:
|
||||
Fingerprint as string of hexdigits, can be interspersed by colons.
|
||||
"""
|
||||
|
||||
if cert is None:
|
||||
raise SSLError("No certificate for the peer.")
|
||||
|
||||
fingerprint = fingerprint.replace(":", "").lower()
|
||||
digest_length = len(fingerprint)
|
||||
if digest_length not in HASHFUNC_MAP:
|
||||
raise SSLError(f"Fingerprint of invalid length: {fingerprint}")
|
||||
hashfunc = HASHFUNC_MAP.get(digest_length)
|
||||
if hashfunc is None:
|
||||
raise SSLError(
|
||||
f"Hash function implementation unavailable for fingerprint length: {digest_length}"
|
||||
)
|
||||
|
||||
# We need encode() here for py32; works on py2 and p33.
|
||||
fingerprint_bytes = unhexlify(fingerprint.encode())
|
||||
|
||||
cert_digest = hashfunc(cert).digest()
|
||||
|
||||
if not hmac.compare_digest(cert_digest, fingerprint_bytes):
|
||||
raise SSLError(
|
||||
f'Fingerprints did not match. Expected "{fingerprint}", got "{cert_digest.hex()}"'
|
||||
)
|
||||
|
||||
|
||||
def resolve_cert_reqs(candidate: None | int | str) -> VerifyMode:
|
||||
"""
|
||||
Resolves the argument to a numeric constant, which can be passed to
|
||||
the wrap_socket function/method from the ssl module.
|
||||
Defaults to :data:`ssl.CERT_REQUIRED`.
|
||||
If given a string it is assumed to be the name of the constant in the
|
||||
:mod:`ssl` module or its abbreviation.
|
||||
(So you can specify `REQUIRED` instead of `CERT_REQUIRED`.
|
||||
If it's neither `None` nor a string we assume it is already the numeric
|
||||
constant which can directly be passed to wrap_socket.
|
||||
"""
|
||||
if candidate is None:
|
||||
return CERT_REQUIRED
|
||||
|
||||
if isinstance(candidate, str):
|
||||
res = getattr(ssl, candidate, None)
|
||||
if res is None:
|
||||
res = getattr(ssl, "CERT_" + candidate)
|
||||
return res # type: ignore[no-any-return]
|
||||
|
||||
return candidate # type: ignore[return-value]
|
||||
|
||||
|
||||
def resolve_ssl_version(candidate: None | int | str) -> int:
|
||||
"""
|
||||
like resolve_cert_reqs
|
||||
"""
|
||||
if candidate is None:
|
||||
return PROTOCOL_TLS
|
||||
|
||||
if isinstance(candidate, str):
|
||||
res = getattr(ssl, candidate, None)
|
||||
if res is None:
|
||||
res = getattr(ssl, "PROTOCOL_" + candidate)
|
||||
return typing.cast(int, res)
|
||||
|
||||
return candidate
|
||||
|
||||
|
||||
def create_urllib3_context(
|
||||
ssl_version: int | None = None,
|
||||
cert_reqs: int | None = None,
|
||||
options: int | None = None,
|
||||
ciphers: str | None = None,
|
||||
ssl_minimum_version: int | None = None,
|
||||
ssl_maximum_version: int | None = None,
|
||||
verify_flags: int | None = None,
|
||||
) -> ssl.SSLContext:
|
||||
"""Creates and configures an :class:`ssl.SSLContext` instance for use with urllib3.
|
||||
|
||||
:param ssl_version:
|
||||
The desired protocol version to use. This will default to
|
||||
PROTOCOL_SSLv23 which will negotiate the highest protocol that both
|
||||
the server and your installation of OpenSSL support.
|
||||
|
||||
This parameter is deprecated instead use 'ssl_minimum_version'.
|
||||
:param ssl_minimum_version:
|
||||
The minimum version of TLS to be used. Use the 'ssl.TLSVersion' enum for specifying the value.
|
||||
:param ssl_maximum_version:
|
||||
The maximum version of TLS to be used. Use the 'ssl.TLSVersion' enum for specifying the value.
|
||||
Not recommended to set to anything other than 'ssl.TLSVersion.MAXIMUM_SUPPORTED' which is the
|
||||
default value.
|
||||
:param cert_reqs:
|
||||
Whether to require the certificate verification. This defaults to
|
||||
``ssl.CERT_REQUIRED``.
|
||||
:param options:
|
||||
Specific OpenSSL options. These default to ``ssl.OP_NO_SSLv2``,
|
||||
``ssl.OP_NO_SSLv3``, ``ssl.OP_NO_COMPRESSION``, and ``ssl.OP_NO_TICKET``.
|
||||
:param ciphers:
|
||||
Which cipher suites to allow the server to select. Defaults to either system configured
|
||||
ciphers if OpenSSL 1.1.1+, otherwise uses a secure default set of ciphers.
|
||||
:param verify_flags:
|
||||
The flags for certificate verification operations. These default to
|
||||
``ssl.VERIFY_X509_PARTIAL_CHAIN`` and ``ssl.VERIFY_X509_STRICT`` for Python 3.13+.
|
||||
:returns:
|
||||
Constructed SSLContext object with specified options
|
||||
:rtype: SSLContext
|
||||
"""
|
||||
if SSLContext is None:
|
||||
raise TypeError("Can't create an SSLContext object without an ssl module")
|
||||
|
||||
# This means 'ssl_version' was specified as an exact value.
|
||||
if ssl_version not in (None, PROTOCOL_TLS, PROTOCOL_TLS_CLIENT):
|
||||
# Disallow setting 'ssl_version' and 'ssl_minimum|maximum_version'
|
||||
# to avoid conflicts.
|
||||
if ssl_minimum_version is not None or ssl_maximum_version is not None:
|
||||
raise ValueError(
|
||||
"Can't specify both 'ssl_version' and either "
|
||||
"'ssl_minimum_version' or 'ssl_maximum_version'"
|
||||
)
|
||||
|
||||
# 'ssl_version' is deprecated and will be removed in the future.
|
||||
else:
|
||||
# Use 'ssl_minimum_version' and 'ssl_maximum_version' instead.
|
||||
ssl_minimum_version = _SSL_VERSION_TO_TLS_VERSION.get(
|
||||
ssl_version, TLSVersion.MINIMUM_SUPPORTED
|
||||
)
|
||||
ssl_maximum_version = _SSL_VERSION_TO_TLS_VERSION.get(
|
||||
ssl_version, TLSVersion.MAXIMUM_SUPPORTED
|
||||
)
|
||||
|
||||
# This warning message is pushing users to use 'ssl_minimum_version'
|
||||
# instead of both min/max. Best practice is to only set the minimum version and
|
||||
# keep the maximum version to be it's default value: 'TLSVersion.MAXIMUM_SUPPORTED'
|
||||
warnings.warn(
|
||||
"'ssl_version' option is deprecated and will be "
|
||||
"removed in urllib3 v2.6.0. Instead use 'ssl_minimum_version'",
|
||||
category=DeprecationWarning,
|
||||
stacklevel=2,
|
||||
)
|
||||
|
||||
# PROTOCOL_TLS is deprecated in Python 3.10 so we always use PROTOCOL_TLS_CLIENT
|
||||
context = SSLContext(PROTOCOL_TLS_CLIENT)
|
||||
|
||||
if ssl_minimum_version is not None:
|
||||
context.minimum_version = ssl_minimum_version
|
||||
else: # Python <3.10 defaults to 'MINIMUM_SUPPORTED' so explicitly set TLSv1.2 here
|
||||
context.minimum_version = TLSVersion.TLSv1_2
|
||||
|
||||
if ssl_maximum_version is not None:
|
||||
context.maximum_version = ssl_maximum_version
|
||||
|
||||
# Unless we're given ciphers defer to either system ciphers in
|
||||
# the case of OpenSSL 1.1.1+ or use our own secure default ciphers.
|
||||
if ciphers:
|
||||
context.set_ciphers(ciphers)
|
||||
|
||||
# Setting the default here, as we may have no ssl module on import
|
||||
cert_reqs = ssl.CERT_REQUIRED if cert_reqs is None else cert_reqs
|
||||
|
||||
if options is None:
|
||||
options = 0
|
||||
# SSLv2 is easily broken and is considered harmful and dangerous
|
||||
options |= OP_NO_SSLv2
|
||||
# SSLv3 has several problems and is now dangerous
|
||||
options |= OP_NO_SSLv3
|
||||
# Disable compression to prevent CRIME attacks for OpenSSL 1.0+
|
||||
# (issue #309)
|
||||
options |= OP_NO_COMPRESSION
|
||||
# TLSv1.2 only. Unless set explicitly, do not request tickets.
|
||||
# This may save some bandwidth on wire, and although the ticket is encrypted,
|
||||
# there is a risk associated with it being on wire,
|
||||
# if the server is not rotating its ticketing keys properly.
|
||||
options |= OP_NO_TICKET
|
||||
|
||||
context.options |= options
|
||||
|
||||
if verify_flags is None:
|
||||
verify_flags = 0
|
||||
# In Python 3.13+ ssl.create_default_context() sets VERIFY_X509_PARTIAL_CHAIN
|
||||
# and VERIFY_X509_STRICT so we do the same
|
||||
if sys.version_info >= (3, 13):
|
||||
verify_flags |= VERIFY_X509_PARTIAL_CHAIN
|
||||
verify_flags |= VERIFY_X509_STRICT
|
||||
|
||||
context.verify_flags |= verify_flags
|
||||
|
||||
# Enable post-handshake authentication for TLS 1.3, see GH #1634. PHA is
|
||||
# necessary for conditional client cert authentication with TLS 1.3.
|
||||
# The attribute is None for OpenSSL <= 1.1.0 or does not exist when using
|
||||
# an SSLContext created by pyOpenSSL.
|
||||
if getattr(context, "post_handshake_auth", None) is not None:
|
||||
context.post_handshake_auth = True
|
||||
|
||||
# The order of the below lines setting verify_mode and check_hostname
|
||||
# matter due to safe-guards SSLContext has to prevent an SSLContext with
|
||||
# check_hostname=True, verify_mode=NONE/OPTIONAL.
|
||||
# We always set 'check_hostname=False' for pyOpenSSL so we rely on our own
|
||||
# 'ssl.match_hostname()' implementation.
|
||||
if cert_reqs == ssl.CERT_REQUIRED and not IS_PYOPENSSL:
|
||||
context.verify_mode = cert_reqs
|
||||
context.check_hostname = True
|
||||
else:
|
||||
context.check_hostname = False
|
||||
context.verify_mode = cert_reqs
|
||||
|
||||
try:
|
||||
context.hostname_checks_common_name = False
|
||||
except AttributeError: # Defensive: for CPython < 3.9.3; for PyPy < 7.3.8
|
||||
pass
|
||||
|
||||
if "SSLKEYLOGFILE" in os.environ:
|
||||
sslkeylogfile = os.path.expandvars(os.environ.get("SSLKEYLOGFILE"))
|
||||
else:
|
||||
sslkeylogfile = None
|
||||
if sslkeylogfile:
|
||||
context.keylog_filename = sslkeylogfile
|
||||
|
||||
return context
|
||||
|
||||
|
||||
@typing.overload
|
||||
def ssl_wrap_socket(
|
||||
sock: socket.socket,
|
||||
keyfile: str | None = ...,
|
||||
certfile: str | None = ...,
|
||||
cert_reqs: int | None = ...,
|
||||
ca_certs: str | None = ...,
|
||||
server_hostname: str | None = ...,
|
||||
ssl_version: int | None = ...,
|
||||
ciphers: str | None = ...,
|
||||
ssl_context: ssl.SSLContext | None = ...,
|
||||
ca_cert_dir: str | None = ...,
|
||||
key_password: str | None = ...,
|
||||
ca_cert_data: None | str | bytes = ...,
|
||||
tls_in_tls: typing.Literal[False] = ...,
|
||||
) -> ssl.SSLSocket: ...
|
||||
|
||||
|
||||
@typing.overload
|
||||
def ssl_wrap_socket(
|
||||
sock: socket.socket,
|
||||
keyfile: str | None = ...,
|
||||
certfile: str | None = ...,
|
||||
cert_reqs: int | None = ...,
|
||||
ca_certs: str | None = ...,
|
||||
server_hostname: str | None = ...,
|
||||
ssl_version: int | None = ...,
|
||||
ciphers: str | None = ...,
|
||||
ssl_context: ssl.SSLContext | None = ...,
|
||||
ca_cert_dir: str | None = ...,
|
||||
key_password: str | None = ...,
|
||||
ca_cert_data: None | str | bytes = ...,
|
||||
tls_in_tls: bool = ...,
|
||||
) -> ssl.SSLSocket | SSLTransportType: ...
|
||||
|
||||
|
||||
def ssl_wrap_socket(
|
||||
sock: socket.socket,
|
||||
keyfile: str | None = None,
|
||||
certfile: str | None = None,
|
||||
cert_reqs: int | None = None,
|
||||
ca_certs: str | None = None,
|
||||
server_hostname: str | None = None,
|
||||
ssl_version: int | None = None,
|
||||
ciphers: str | None = None,
|
||||
ssl_context: ssl.SSLContext | None = None,
|
||||
ca_cert_dir: str | None = None,
|
||||
key_password: str | None = None,
|
||||
ca_cert_data: None | str | bytes = None,
|
||||
tls_in_tls: bool = False,
|
||||
) -> ssl.SSLSocket | SSLTransportType:
|
||||
"""
|
||||
All arguments except for server_hostname, ssl_context, tls_in_tls, ca_cert_data and
|
||||
ca_cert_dir have the same meaning as they do when using
|
||||
:func:`ssl.create_default_context`, :meth:`ssl.SSLContext.load_cert_chain`,
|
||||
:meth:`ssl.SSLContext.set_ciphers` and :meth:`ssl.SSLContext.wrap_socket`.
|
||||
|
||||
:param server_hostname:
|
||||
When SNI is supported, the expected hostname of the certificate
|
||||
:param ssl_context:
|
||||
A pre-made :class:`SSLContext` object. If none is provided, one will
|
||||
be created using :func:`create_urllib3_context`.
|
||||
:param ciphers:
|
||||
A string of ciphers we wish the client to support.
|
||||
:param ca_cert_dir:
|
||||
A directory containing CA certificates in multiple separate files, as
|
||||
supported by OpenSSL's -CApath flag or the capath argument to
|
||||
SSLContext.load_verify_locations().
|
||||
:param key_password:
|
||||
Optional password if the keyfile is encrypted.
|
||||
:param ca_cert_data:
|
||||
Optional string containing CA certificates in PEM format suitable for
|
||||
passing as the cadata parameter to SSLContext.load_verify_locations()
|
||||
:param tls_in_tls:
|
||||
Use SSLTransport to wrap the existing socket.
|
||||
"""
|
||||
context = ssl_context
|
||||
if context is None:
|
||||
# Note: This branch of code and all the variables in it are only used in tests.
|
||||
# We should consider deprecating and removing this code.
|
||||
context = create_urllib3_context(ssl_version, cert_reqs, ciphers=ciphers)
|
||||
|
||||
if ca_certs or ca_cert_dir or ca_cert_data:
|
||||
try:
|
||||
context.load_verify_locations(ca_certs, ca_cert_dir, ca_cert_data)
|
||||
except OSError as e:
|
||||
raise SSLError(e) from e
|
||||
|
||||
elif ssl_context is None and hasattr(context, "load_default_certs"):
|
||||
# try to load OS default certs; works well on Windows.
|
||||
context.load_default_certs()
|
||||
|
||||
# Attempt to detect if we get the goofy behavior of the
|
||||
# keyfile being encrypted and OpenSSL asking for the
|
||||
# passphrase via the terminal and instead error out.
|
||||
if keyfile and key_password is None and _is_key_file_encrypted(keyfile):
|
||||
raise SSLError("Client private key is encrypted, password is required")
|
||||
|
||||
if certfile:
|
||||
if key_password is None:
|
||||
context.load_cert_chain(certfile, keyfile)
|
||||
else:
|
||||
context.load_cert_chain(certfile, keyfile, key_password)
|
||||
|
||||
context.set_alpn_protocols(ALPN_PROTOCOLS)
|
||||
|
||||
ssl_sock = _ssl_wrap_socket_impl(sock, context, tls_in_tls, server_hostname)
|
||||
return ssl_sock
|
||||
|
||||
|
||||
def is_ipaddress(hostname: str | bytes) -> bool:
|
||||
"""Detects whether the hostname given is an IPv4 or IPv6 address.
|
||||
Also detects IPv6 addresses with Zone IDs.
|
||||
|
||||
:param str hostname: Hostname to examine.
|
||||
:return: True if the hostname is an IP address, False otherwise.
|
||||
"""
|
||||
if isinstance(hostname, bytes):
|
||||
# IDN A-label bytes are ASCII compatible.
|
||||
hostname = hostname.decode("ascii")
|
||||
return bool(_IPV4_RE.match(hostname) or _BRACELESS_IPV6_ADDRZ_RE.match(hostname))
|
||||
|
||||
|
||||
def _is_key_file_encrypted(key_file: str) -> bool:
|
||||
"""Detects if a key file is encrypted or not."""
|
||||
with open(key_file) as f:
|
||||
for line in f:
|
||||
# Look for Proc-Type: 4,ENCRYPTED
|
||||
if "ENCRYPTED" in line:
|
||||
return True
|
||||
|
||||
return False
|
||||
|
||||
|
||||
def _ssl_wrap_socket_impl(
|
||||
sock: socket.socket,
|
||||
ssl_context: ssl.SSLContext,
|
||||
tls_in_tls: bool,
|
||||
server_hostname: str | None = None,
|
||||
) -> ssl.SSLSocket | SSLTransportType:
|
||||
if tls_in_tls:
|
||||
if not SSLTransport:
|
||||
# Import error, ssl is not available.
|
||||
raise ProxySchemeUnsupported(
|
||||
"TLS in TLS requires support for the 'ssl' module"
|
||||
)
|
||||
|
||||
SSLTransport._validate_ssl_context_for_tls_in_tls(ssl_context)
|
||||
return SSLTransport(sock, ssl_context, server_hostname)
|
||||
|
||||
return ssl_context.wrap_socket(sock, server_hostname=server_hostname)
|
||||
@@ -0,0 +1,159 @@
|
||||
"""The match_hostname() function from Python 3.5, essential when using SSL."""
|
||||
|
||||
# Note: This file is under the PSF license as the code comes from the python
|
||||
# stdlib. http://docs.python.org/3/license.html
|
||||
# It is modified to remove commonName support.
|
||||
|
||||
from __future__ import annotations
|
||||
|
||||
import ipaddress
|
||||
import re
|
||||
import typing
|
||||
from ipaddress import IPv4Address, IPv6Address
|
||||
|
||||
if typing.TYPE_CHECKING:
|
||||
from .ssl_ import _TYPE_PEER_CERT_RET_DICT
|
||||
|
||||
__version__ = "3.5.0.1"
|
||||
|
||||
|
||||
class CertificateError(ValueError):
|
||||
pass
|
||||
|
||||
|
||||
def _dnsname_match(
|
||||
dn: typing.Any, hostname: str, max_wildcards: int = 1
|
||||
) -> typing.Match[str] | None | bool:
|
||||
"""Matching according to RFC 6125, section 6.4.3
|
||||
|
||||
http://tools.ietf.org/html/rfc6125#section-6.4.3
|
||||
"""
|
||||
pats = []
|
||||
if not dn:
|
||||
return False
|
||||
|
||||
# Ported from python3-syntax:
|
||||
# leftmost, *remainder = dn.split(r'.')
|
||||
parts = dn.split(r".")
|
||||
leftmost = parts[0]
|
||||
remainder = parts[1:]
|
||||
|
||||
wildcards = leftmost.count("*")
|
||||
if wildcards > max_wildcards:
|
||||
# Issue #17980: avoid denials of service by refusing more
|
||||
# than one wildcard per fragment. A survey of established
|
||||
# policy among SSL implementations showed it to be a
|
||||
# reasonable choice.
|
||||
raise CertificateError(
|
||||
"too many wildcards in certificate DNS name: " + repr(dn)
|
||||
)
|
||||
|
||||
# speed up common case w/o wildcards
|
||||
if not wildcards:
|
||||
return bool(dn.lower() == hostname.lower())
|
||||
|
||||
# RFC 6125, section 6.4.3, subitem 1.
|
||||
# The client SHOULD NOT attempt to match a presented identifier in which
|
||||
# the wildcard character comprises a label other than the left-most label.
|
||||
if leftmost == "*":
|
||||
# When '*' is a fragment by itself, it matches a non-empty dotless
|
||||
# fragment.
|
||||
pats.append("[^.]+")
|
||||
elif leftmost.startswith("xn--") or hostname.startswith("xn--"):
|
||||
# RFC 6125, section 6.4.3, subitem 3.
|
||||
# The client SHOULD NOT attempt to match a presented identifier
|
||||
# where the wildcard character is embedded within an A-label or
|
||||
# U-label of an internationalized domain name.
|
||||
pats.append(re.escape(leftmost))
|
||||
else:
|
||||
# Otherwise, '*' matches any dotless string, e.g. www*
|
||||
pats.append(re.escape(leftmost).replace(r"\*", "[^.]*"))
|
||||
|
||||
# add the remaining fragments, ignore any wildcards
|
||||
for frag in remainder:
|
||||
pats.append(re.escape(frag))
|
||||
|
||||
pat = re.compile(r"\A" + r"\.".join(pats) + r"\Z", re.IGNORECASE)
|
||||
return pat.match(hostname)
|
||||
|
||||
|
||||
def _ipaddress_match(ipname: str, host_ip: IPv4Address | IPv6Address) -> bool:
|
||||
"""Exact matching of IP addresses.
|
||||
|
||||
RFC 9110 section 4.3.5: "A reference identity of IP-ID contains the decoded
|
||||
bytes of the IP address. An IP version 4 address is 4 octets, and an IP
|
||||
version 6 address is 16 octets. [...] A reference identity of type IP-ID
|
||||
matches if the address is identical to an iPAddress value of the
|
||||
subjectAltName extension of the certificate."
|
||||
"""
|
||||
# OpenSSL may add a trailing newline to a subjectAltName's IP address
|
||||
# Divergence from upstream: ipaddress can't handle byte str
|
||||
ip = ipaddress.ip_address(ipname.rstrip())
|
||||
return bool(ip.packed == host_ip.packed)
|
||||
|
||||
|
||||
def match_hostname(
|
||||
cert: _TYPE_PEER_CERT_RET_DICT | None,
|
||||
hostname: str,
|
||||
hostname_checks_common_name: bool = False,
|
||||
) -> None:
|
||||
"""Verify that *cert* (in decoded format as returned by
|
||||
SSLSocket.getpeercert()) matches the *hostname*. RFC 2818 and RFC 6125
|
||||
rules are followed, but IP addresses are not accepted for *hostname*.
|
||||
|
||||
CertificateError is raised on failure. On success, the function
|
||||
returns nothing.
|
||||
"""
|
||||
if not cert:
|
||||
raise ValueError(
|
||||
"empty or no certificate, match_hostname needs a "
|
||||
"SSL socket or SSL context with either "
|
||||
"CERT_OPTIONAL or CERT_REQUIRED"
|
||||
)
|
||||
try:
|
||||
# Divergence from upstream: ipaddress can't handle byte str
|
||||
#
|
||||
# The ipaddress module shipped with Python < 3.9 does not support
|
||||
# scoped IPv6 addresses so we unconditionally strip the Zone IDs for
|
||||
# now. Once we drop support for Python 3.9 we can remove this branch.
|
||||
if "%" in hostname:
|
||||
host_ip = ipaddress.ip_address(hostname[: hostname.rfind("%")])
|
||||
else:
|
||||
host_ip = ipaddress.ip_address(hostname)
|
||||
|
||||
except ValueError:
|
||||
# Not an IP address (common case)
|
||||
host_ip = None
|
||||
dnsnames = []
|
||||
san: tuple[tuple[str, str], ...] = cert.get("subjectAltName", ())
|
||||
key: str
|
||||
value: str
|
||||
for key, value in san:
|
||||
if key == "DNS":
|
||||
if host_ip is None and _dnsname_match(value, hostname):
|
||||
return
|
||||
dnsnames.append(value)
|
||||
elif key == "IP Address":
|
||||
if host_ip is not None and _ipaddress_match(value, host_ip):
|
||||
return
|
||||
dnsnames.append(value)
|
||||
|
||||
# We only check 'commonName' if it's enabled and we're not verifying
|
||||
# an IP address. IP addresses aren't valid within 'commonName'.
|
||||
if hostname_checks_common_name and host_ip is None and not dnsnames:
|
||||
for sub in cert.get("subject", ()):
|
||||
for key, value in sub:
|
||||
if key == "commonName":
|
||||
if _dnsname_match(value, hostname):
|
||||
return
|
||||
dnsnames.append(value) # Defensive: for Python < 3.9.3
|
||||
|
||||
if len(dnsnames) > 1:
|
||||
raise CertificateError(
|
||||
"hostname %r "
|
||||
"doesn't match either of %s" % (hostname, ", ".join(map(repr, dnsnames)))
|
||||
)
|
||||
elif len(dnsnames) == 1:
|
||||
raise CertificateError(f"hostname {hostname!r} doesn't match {dnsnames[0]!r}")
|
||||
else:
|
||||
raise CertificateError("no appropriate subjectAltName fields were found")
|
||||
@@ -0,0 +1,271 @@
|
||||
from __future__ import annotations
|
||||
|
||||
import io
|
||||
import socket
|
||||
import ssl
|
||||
import typing
|
||||
|
||||
from ..exceptions import ProxySchemeUnsupported
|
||||
|
||||
if typing.TYPE_CHECKING:
|
||||
from typing_extensions import Self
|
||||
|
||||
from .ssl_ import _TYPE_PEER_CERT_RET, _TYPE_PEER_CERT_RET_DICT
|
||||
|
||||
|
||||
_WriteBuffer = typing.Union[bytearray, memoryview]
|
||||
_ReturnValue = typing.TypeVar("_ReturnValue")
|
||||
|
||||
SSL_BLOCKSIZE = 16384
|
||||
|
||||
|
||||
class SSLTransport:
|
||||
"""
|
||||
The SSLTransport wraps an existing socket and establishes an SSL connection.
|
||||
|
||||
Contrary to Python's implementation of SSLSocket, it allows you to chain
|
||||
multiple TLS connections together. It's particularly useful if you need to
|
||||
implement TLS within TLS.
|
||||
|
||||
The class supports most of the socket API operations.
|
||||
"""
|
||||
|
||||
@staticmethod
|
||||
def _validate_ssl_context_for_tls_in_tls(ssl_context: ssl.SSLContext) -> None:
|
||||
"""
|
||||
Raises a ProxySchemeUnsupported if the provided ssl_context can't be used
|
||||
for TLS in TLS.
|
||||
|
||||
The only requirement is that the ssl_context provides the 'wrap_bio'
|
||||
methods.
|
||||
"""
|
||||
|
||||
if not hasattr(ssl_context, "wrap_bio"):
|
||||
raise ProxySchemeUnsupported(
|
||||
"TLS in TLS requires SSLContext.wrap_bio() which isn't "
|
||||
"available on non-native SSLContext"
|
||||
)
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
socket: socket.socket,
|
||||
ssl_context: ssl.SSLContext,
|
||||
server_hostname: str | None = None,
|
||||
suppress_ragged_eofs: bool = True,
|
||||
) -> None:
|
||||
"""
|
||||
Create an SSLTransport around socket using the provided ssl_context.
|
||||
"""
|
||||
self.incoming = ssl.MemoryBIO()
|
||||
self.outgoing = ssl.MemoryBIO()
|
||||
|
||||
self.suppress_ragged_eofs = suppress_ragged_eofs
|
||||
self.socket = socket
|
||||
|
||||
self.sslobj = ssl_context.wrap_bio(
|
||||
self.incoming, self.outgoing, server_hostname=server_hostname
|
||||
)
|
||||
|
||||
# Perform initial handshake.
|
||||
self._ssl_io_loop(self.sslobj.do_handshake)
|
||||
|
||||
def __enter__(self) -> Self:
|
||||
return self
|
||||
|
||||
def __exit__(self, *_: typing.Any) -> None:
|
||||
self.close()
|
||||
|
||||
def fileno(self) -> int:
|
||||
return self.socket.fileno()
|
||||
|
||||
def read(self, len: int = 1024, buffer: typing.Any | None = None) -> int | bytes:
|
||||
return self._wrap_ssl_read(len, buffer)
|
||||
|
||||
def recv(self, buflen: int = 1024, flags: int = 0) -> int | bytes:
|
||||
if flags != 0:
|
||||
raise ValueError("non-zero flags not allowed in calls to recv")
|
||||
return self._wrap_ssl_read(buflen)
|
||||
|
||||
def recv_into(
|
||||
self,
|
||||
buffer: _WriteBuffer,
|
||||
nbytes: int | None = None,
|
||||
flags: int = 0,
|
||||
) -> None | int | bytes:
|
||||
if flags != 0:
|
||||
raise ValueError("non-zero flags not allowed in calls to recv_into")
|
||||
if nbytes is None:
|
||||
nbytes = len(buffer)
|
||||
return self.read(nbytes, buffer)
|
||||
|
||||
def sendall(self, data: bytes, flags: int = 0) -> None:
|
||||
if flags != 0:
|
||||
raise ValueError("non-zero flags not allowed in calls to sendall")
|
||||
count = 0
|
||||
with memoryview(data) as view, view.cast("B") as byte_view:
|
||||
amount = len(byte_view)
|
||||
while count < amount:
|
||||
v = self.send(byte_view[count:])
|
||||
count += v
|
||||
|
||||
def send(self, data: bytes, flags: int = 0) -> int:
|
||||
if flags != 0:
|
||||
raise ValueError("non-zero flags not allowed in calls to send")
|
||||
return self._ssl_io_loop(self.sslobj.write, data)
|
||||
|
||||
def makefile(
|
||||
self,
|
||||
mode: str,
|
||||
buffering: int | None = None,
|
||||
*,
|
||||
encoding: str | None = None,
|
||||
errors: str | None = None,
|
||||
newline: str | None = None,
|
||||
) -> typing.BinaryIO | typing.TextIO | socket.SocketIO:
|
||||
"""
|
||||
Python's httpclient uses makefile and buffered io when reading HTTP
|
||||
messages and we need to support it.
|
||||
|
||||
This is unfortunately a copy and paste of socket.py makefile with small
|
||||
changes to point to the socket directly.
|
||||
"""
|
||||
if not set(mode) <= {"r", "w", "b"}:
|
||||
raise ValueError(f"invalid mode {mode!r} (only r, w, b allowed)")
|
||||
|
||||
writing = "w" in mode
|
||||
reading = "r" in mode or not writing
|
||||
assert reading or writing
|
||||
binary = "b" in mode
|
||||
rawmode = ""
|
||||
if reading:
|
||||
rawmode += "r"
|
||||
if writing:
|
||||
rawmode += "w"
|
||||
raw = socket.SocketIO(self, rawmode) # type: ignore[arg-type]
|
||||
self.socket._io_refs += 1 # type: ignore[attr-defined]
|
||||
if buffering is None:
|
||||
buffering = -1
|
||||
if buffering < 0:
|
||||
buffering = io.DEFAULT_BUFFER_SIZE
|
||||
if buffering == 0:
|
||||
if not binary:
|
||||
raise ValueError("unbuffered streams must be binary")
|
||||
return raw
|
||||
buffer: typing.BinaryIO
|
||||
if reading and writing:
|
||||
buffer = io.BufferedRWPair(raw, raw, buffering) # type: ignore[assignment]
|
||||
elif reading:
|
||||
buffer = io.BufferedReader(raw, buffering)
|
||||
else:
|
||||
assert writing
|
||||
buffer = io.BufferedWriter(raw, buffering)
|
||||
if binary:
|
||||
return buffer
|
||||
text = io.TextIOWrapper(buffer, encoding, errors, newline)
|
||||
text.mode = mode # type: ignore[misc]
|
||||
return text
|
||||
|
||||
def unwrap(self) -> None:
|
||||
self._ssl_io_loop(self.sslobj.unwrap)
|
||||
|
||||
def close(self) -> None:
|
||||
self.socket.close()
|
||||
|
||||
@typing.overload
|
||||
def getpeercert(
|
||||
self, binary_form: typing.Literal[False] = ...
|
||||
) -> _TYPE_PEER_CERT_RET_DICT | None: ...
|
||||
|
||||
@typing.overload
|
||||
def getpeercert(self, binary_form: typing.Literal[True]) -> bytes | None: ...
|
||||
|
||||
def getpeercert(self, binary_form: bool = False) -> _TYPE_PEER_CERT_RET:
|
||||
return self.sslobj.getpeercert(binary_form) # type: ignore[return-value]
|
||||
|
||||
def version(self) -> str | None:
|
||||
return self.sslobj.version()
|
||||
|
||||
def cipher(self) -> tuple[str, str, int] | None:
|
||||
return self.sslobj.cipher()
|
||||
|
||||
def selected_alpn_protocol(self) -> str | None:
|
||||
return self.sslobj.selected_alpn_protocol()
|
||||
|
||||
def shared_ciphers(self) -> list[tuple[str, str, int]] | None:
|
||||
return self.sslobj.shared_ciphers()
|
||||
|
||||
def compression(self) -> str | None:
|
||||
return self.sslobj.compression()
|
||||
|
||||
def settimeout(self, value: float | None) -> None:
|
||||
self.socket.settimeout(value)
|
||||
|
||||
def gettimeout(self) -> float | None:
|
||||
return self.socket.gettimeout()
|
||||
|
||||
def _decref_socketios(self) -> None:
|
||||
self.socket._decref_socketios() # type: ignore[attr-defined]
|
||||
|
||||
def _wrap_ssl_read(self, len: int, buffer: bytearray | None = None) -> int | bytes:
|
||||
try:
|
||||
return self._ssl_io_loop(self.sslobj.read, len, buffer)
|
||||
except ssl.SSLError as e:
|
||||
if e.errno == ssl.SSL_ERROR_EOF and self.suppress_ragged_eofs:
|
||||
return 0 # eof, return 0.
|
||||
else:
|
||||
raise
|
||||
|
||||
# func is sslobj.do_handshake or sslobj.unwrap
|
||||
@typing.overload
|
||||
def _ssl_io_loop(self, func: typing.Callable[[], None]) -> None: ...
|
||||
|
||||
# func is sslobj.write, arg1 is data
|
||||
@typing.overload
|
||||
def _ssl_io_loop(self, func: typing.Callable[[bytes], int], arg1: bytes) -> int: ...
|
||||
|
||||
# func is sslobj.read, arg1 is len, arg2 is buffer
|
||||
@typing.overload
|
||||
def _ssl_io_loop(
|
||||
self,
|
||||
func: typing.Callable[[int, bytearray | None], bytes],
|
||||
arg1: int,
|
||||
arg2: bytearray | None,
|
||||
) -> bytes: ...
|
||||
|
||||
def _ssl_io_loop(
|
||||
self,
|
||||
func: typing.Callable[..., _ReturnValue],
|
||||
arg1: None | bytes | int = None,
|
||||
arg2: bytearray | None = None,
|
||||
) -> _ReturnValue:
|
||||
"""Performs an I/O loop between incoming/outgoing and the socket."""
|
||||
should_loop = True
|
||||
ret = None
|
||||
|
||||
while should_loop:
|
||||
errno = None
|
||||
try:
|
||||
if arg1 is None and arg2 is None:
|
||||
ret = func()
|
||||
elif arg2 is None:
|
||||
ret = func(arg1)
|
||||
else:
|
||||
ret = func(arg1, arg2)
|
||||
except ssl.SSLError as e:
|
||||
if e.errno not in (ssl.SSL_ERROR_WANT_READ, ssl.SSL_ERROR_WANT_WRITE):
|
||||
# WANT_READ, and WANT_WRITE are expected, others are not.
|
||||
raise e
|
||||
errno = e.errno
|
||||
|
||||
buf = self.outgoing.read()
|
||||
self.socket.sendall(buf)
|
||||
|
||||
if errno is None:
|
||||
should_loop = False
|
||||
elif errno == ssl.SSL_ERROR_WANT_READ:
|
||||
buf = self.socket.recv(SSL_BLOCKSIZE)
|
||||
if buf:
|
||||
self.incoming.write(buf)
|
||||
else:
|
||||
self.incoming.write_eof()
|
||||
return typing.cast(_ReturnValue, ret)
|
||||
@@ -0,0 +1,275 @@
|
||||
from __future__ import annotations
|
||||
|
||||
import time
|
||||
import typing
|
||||
from enum import Enum
|
||||
from socket import getdefaulttimeout
|
||||
|
||||
from ..exceptions import TimeoutStateError
|
||||
|
||||
if typing.TYPE_CHECKING:
|
||||
from typing import Final
|
||||
|
||||
|
||||
class _TYPE_DEFAULT(Enum):
|
||||
# This value should never be passed to socket.settimeout() so for safety we use a -1.
|
||||
# socket.settimout() raises a ValueError for negative values.
|
||||
token = -1
|
||||
|
||||
|
||||
_DEFAULT_TIMEOUT: Final[_TYPE_DEFAULT] = _TYPE_DEFAULT.token
|
||||
|
||||
_TYPE_TIMEOUT = typing.Optional[typing.Union[float, _TYPE_DEFAULT]]
|
||||
|
||||
|
||||
class Timeout:
|
||||
"""Timeout configuration.
|
||||
|
||||
Timeouts can be defined as a default for a pool:
|
||||
|
||||
.. code-block:: python
|
||||
|
||||
import urllib3
|
||||
|
||||
timeout = urllib3.util.Timeout(connect=2.0, read=7.0)
|
||||
|
||||
http = urllib3.PoolManager(timeout=timeout)
|
||||
|
||||
resp = http.request("GET", "https://example.com/")
|
||||
|
||||
print(resp.status)
|
||||
|
||||
Or per-request (which overrides the default for the pool):
|
||||
|
||||
.. code-block:: python
|
||||
|
||||
response = http.request("GET", "https://example.com/", timeout=Timeout(10))
|
||||
|
||||
Timeouts can be disabled by setting all the parameters to ``None``:
|
||||
|
||||
.. code-block:: python
|
||||
|
||||
no_timeout = Timeout(connect=None, read=None)
|
||||
response = http.request("GET", "https://example.com/", timeout=no_timeout)
|
||||
|
||||
|
||||
:param total:
|
||||
This combines the connect and read timeouts into one; the read timeout
|
||||
will be set to the time leftover from the connect attempt. In the
|
||||
event that both a connect timeout and a total are specified, or a read
|
||||
timeout and a total are specified, the shorter timeout will be applied.
|
||||
|
||||
Defaults to None.
|
||||
|
||||
:type total: int, float, or None
|
||||
|
||||
:param connect:
|
||||
The maximum amount of time (in seconds) to wait for a connection
|
||||
attempt to a server to succeed. Omitting the parameter will default the
|
||||
connect timeout to the system default, probably `the global default
|
||||
timeout in socket.py
|
||||
<http://hg.python.org/cpython/file/603b4d593758/Lib/socket.py#l535>`_.
|
||||
None will set an infinite timeout for connection attempts.
|
||||
|
||||
:type connect: int, float, or None
|
||||
|
||||
:param read:
|
||||
The maximum amount of time (in seconds) to wait between consecutive
|
||||
read operations for a response from the server. Omitting the parameter
|
||||
will default the read timeout to the system default, probably `the
|
||||
global default timeout in socket.py
|
||||
<http://hg.python.org/cpython/file/603b4d593758/Lib/socket.py#l535>`_.
|
||||
None will set an infinite timeout.
|
||||
|
||||
:type read: int, float, or None
|
||||
|
||||
.. note::
|
||||
|
||||
Many factors can affect the total amount of time for urllib3 to return
|
||||
an HTTP response.
|
||||
|
||||
For example, Python's DNS resolver does not obey the timeout specified
|
||||
on the socket. Other factors that can affect total request time include
|
||||
high CPU load, high swap, the program running at a low priority level,
|
||||
or other behaviors.
|
||||
|
||||
In addition, the read and total timeouts only measure the time between
|
||||
read operations on the socket connecting the client and the server,
|
||||
not the total amount of time for the request to return a complete
|
||||
response. For most requests, the timeout is raised because the server
|
||||
has not sent the first byte in the specified time. This is not always
|
||||
the case; if a server streams one byte every fifteen seconds, a timeout
|
||||
of 20 seconds will not trigger, even though the request will take
|
||||
several minutes to complete.
|
||||
"""
|
||||
|
||||
#: A sentinel object representing the default timeout value
|
||||
DEFAULT_TIMEOUT: _TYPE_TIMEOUT = _DEFAULT_TIMEOUT
|
||||
|
||||
def __init__(
|
||||
self,
|
||||
total: _TYPE_TIMEOUT = None,
|
||||
connect: _TYPE_TIMEOUT = _DEFAULT_TIMEOUT,
|
||||
read: _TYPE_TIMEOUT = _DEFAULT_TIMEOUT,
|
||||
) -> None:
|
||||
self._connect = self._validate_timeout(connect, "connect")
|
||||
self._read = self._validate_timeout(read, "read")
|
||||
self.total = self._validate_timeout(total, "total")
|
||||
self._start_connect: float | None = None
|
||||
|
||||
def __repr__(self) -> str:
|
||||
return f"{type(self).__name__}(connect={self._connect!r}, read={self._read!r}, total={self.total!r})"
|
||||
|
||||
# __str__ provided for backwards compatibility
|
||||
__str__ = __repr__
|
||||
|
||||
@staticmethod
|
||||
def resolve_default_timeout(timeout: _TYPE_TIMEOUT) -> float | None:
|
||||
return getdefaulttimeout() if timeout is _DEFAULT_TIMEOUT else timeout
|
||||
|
||||
@classmethod
|
||||
def _validate_timeout(cls, value: _TYPE_TIMEOUT, name: str) -> _TYPE_TIMEOUT:
|
||||
"""Check that a timeout attribute is valid.
|
||||
|
||||
:param value: The timeout value to validate
|
||||
:param name: The name of the timeout attribute to validate. This is
|
||||
used to specify in error messages.
|
||||
:return: The validated and casted version of the given value.
|
||||
:raises ValueError: If it is a numeric value less than or equal to
|
||||
zero, or the type is not an integer, float, or None.
|
||||
"""
|
||||
if value is None or value is _DEFAULT_TIMEOUT:
|
||||
return value
|
||||
|
||||
if isinstance(value, bool):
|
||||
raise ValueError(
|
||||
"Timeout cannot be a boolean value. It must "
|
||||
"be an int, float or None."
|
||||
)
|
||||
try:
|
||||
float(value)
|
||||
except (TypeError, ValueError):
|
||||
raise ValueError(
|
||||
"Timeout value %s was %s, but it must be an "
|
||||
"int, float or None." % (name, value)
|
||||
) from None
|
||||
|
||||
try:
|
||||
if value <= 0:
|
||||
raise ValueError(
|
||||
"Attempted to set %s timeout to %s, but the "
|
||||
"timeout cannot be set to a value less "
|
||||
"than or equal to 0." % (name, value)
|
||||
)
|
||||
except TypeError:
|
||||
raise ValueError(
|
||||
"Timeout value %s was %s, but it must be an "
|
||||
"int, float or None." % (name, value)
|
||||
) from None
|
||||
|
||||
return value
|
||||
|
||||
@classmethod
|
||||
def from_float(cls, timeout: _TYPE_TIMEOUT) -> Timeout:
|
||||
"""Create a new Timeout from a legacy timeout value.
|
||||
|
||||
The timeout value used by httplib.py sets the same timeout on the
|
||||
connect(), and recv() socket requests. This creates a :class:`Timeout`
|
||||
object that sets the individual timeouts to the ``timeout`` value
|
||||
passed to this function.
|
||||
|
||||
:param timeout: The legacy timeout value.
|
||||
:type timeout: integer, float, :attr:`urllib3.util.Timeout.DEFAULT_TIMEOUT`, or None
|
||||
:return: Timeout object
|
||||
:rtype: :class:`Timeout`
|
||||
"""
|
||||
return Timeout(read=timeout, connect=timeout)
|
||||
|
||||
def clone(self) -> Timeout:
|
||||
"""Create a copy of the timeout object
|
||||
|
||||
Timeout properties are stored per-pool but each request needs a fresh
|
||||
Timeout object to ensure each one has its own start/stop configured.
|
||||
|
||||
:return: a copy of the timeout object
|
||||
:rtype: :class:`Timeout`
|
||||
"""
|
||||
# We can't use copy.deepcopy because that will also create a new object
|
||||
# for _GLOBAL_DEFAULT_TIMEOUT, which socket.py uses as a sentinel to
|
||||
# detect the user default.
|
||||
return Timeout(connect=self._connect, read=self._read, total=self.total)
|
||||
|
||||
def start_connect(self) -> float:
|
||||
"""Start the timeout clock, used during a connect() attempt
|
||||
|
||||
:raises urllib3.exceptions.TimeoutStateError: if you attempt
|
||||
to start a timer that has been started already.
|
||||
"""
|
||||
if self._start_connect is not None:
|
||||
raise TimeoutStateError("Timeout timer has already been started.")
|
||||
self._start_connect = time.monotonic()
|
||||
return self._start_connect
|
||||
|
||||
def get_connect_duration(self) -> float:
|
||||
"""Gets the time elapsed since the call to :meth:`start_connect`.
|
||||
|
||||
:return: Elapsed time in seconds.
|
||||
:rtype: float
|
||||
:raises urllib3.exceptions.TimeoutStateError: if you attempt
|
||||
to get duration for a timer that hasn't been started.
|
||||
"""
|
||||
if self._start_connect is None:
|
||||
raise TimeoutStateError(
|
||||
"Can't get connect duration for timer that has not started."
|
||||
)
|
||||
return time.monotonic() - self._start_connect
|
||||
|
||||
@property
|
||||
def connect_timeout(self) -> _TYPE_TIMEOUT:
|
||||
"""Get the value to use when setting a connection timeout.
|
||||
|
||||
This will be a positive float or integer, the value None
|
||||
(never timeout), or the default system timeout.
|
||||
|
||||
:return: Connect timeout.
|
||||
:rtype: int, float, :attr:`Timeout.DEFAULT_TIMEOUT` or None
|
||||
"""
|
||||
if self.total is None:
|
||||
return self._connect
|
||||
|
||||
if self._connect is None or self._connect is _DEFAULT_TIMEOUT:
|
||||
return self.total
|
||||
|
||||
return min(self._connect, self.total) # type: ignore[type-var]
|
||||
|
||||
@property
|
||||
def read_timeout(self) -> float | None:
|
||||
"""Get the value for the read timeout.
|
||||
|
||||
This assumes some time has elapsed in the connection timeout and
|
||||
computes the read timeout appropriately.
|
||||
|
||||
If self.total is set, the read timeout is dependent on the amount of
|
||||
time taken by the connect timeout. If the connection time has not been
|
||||
established, a :exc:`~urllib3.exceptions.TimeoutStateError` will be
|
||||
raised.
|
||||
|
||||
:return: Value to use for the read timeout.
|
||||
:rtype: int, float or None
|
||||
:raises urllib3.exceptions.TimeoutStateError: If :meth:`start_connect`
|
||||
has not yet been called on this object.
|
||||
"""
|
||||
if (
|
||||
self.total is not None
|
||||
and self.total is not _DEFAULT_TIMEOUT
|
||||
and self._read is not None
|
||||
and self._read is not _DEFAULT_TIMEOUT
|
||||
):
|
||||
# In case the connect timeout has not yet been established.
|
||||
if self._start_connect is None:
|
||||
return self._read
|
||||
return max(0, min(self.total - self.get_connect_duration(), self._read))
|
||||
elif self.total is not None and self.total is not _DEFAULT_TIMEOUT:
|
||||
return max(0, self.total - self.get_connect_duration())
|
||||
else:
|
||||
return self.resolve_default_timeout(self._read)
|
||||
469
path/to/venv/lib/python3.12/site-packages/urllib3/util/url.py
Normal file
469
path/to/venv/lib/python3.12/site-packages/urllib3/util/url.py
Normal file
@@ -0,0 +1,469 @@
|
||||
from __future__ import annotations
|
||||
|
||||
import re
|
||||
import typing
|
||||
|
||||
from ..exceptions import LocationParseError
|
||||
from .util import to_str
|
||||
|
||||
# We only want to normalize urls with an HTTP(S) scheme.
|
||||
# urllib3 infers URLs without a scheme (None) to be http.
|
||||
_NORMALIZABLE_SCHEMES = ("http", "https", None)
|
||||
|
||||
# Almost all of these patterns were derived from the
|
||||
# 'rfc3986' module: https://github.com/python-hyper/rfc3986
|
||||
_PERCENT_RE = re.compile(r"%[a-fA-F0-9]{2}")
|
||||
_SCHEME_RE = re.compile(r"^(?:[a-zA-Z][a-zA-Z0-9+-]*:|/)")
|
||||
_URI_RE = re.compile(
|
||||
r"^(?:([a-zA-Z][a-zA-Z0-9+.-]*):)?"
|
||||
r"(?://([^\\/?#]*))?"
|
||||
r"([^?#]*)"
|
||||
r"(?:\?([^#]*))?"
|
||||
r"(?:#(.*))?$",
|
||||
re.UNICODE | re.DOTALL,
|
||||
)
|
||||
|
||||
_IPV4_PAT = r"(?:[0-9]{1,3}\.){3}[0-9]{1,3}"
|
||||
_HEX_PAT = "[0-9A-Fa-f]{1,4}"
|
||||
_LS32_PAT = "(?:{hex}:{hex}|{ipv4})".format(hex=_HEX_PAT, ipv4=_IPV4_PAT)
|
||||
_subs = {"hex": _HEX_PAT, "ls32": _LS32_PAT}
|
||||
_variations = [
|
||||
# 6( h16 ":" ) ls32
|
||||
"(?:%(hex)s:){6}%(ls32)s",
|
||||
# "::" 5( h16 ":" ) ls32
|
||||
"::(?:%(hex)s:){5}%(ls32)s",
|
||||
# [ h16 ] "::" 4( h16 ":" ) ls32
|
||||
"(?:%(hex)s)?::(?:%(hex)s:){4}%(ls32)s",
|
||||
# [ *1( h16 ":" ) h16 ] "::" 3( h16 ":" ) ls32
|
||||
"(?:(?:%(hex)s:)?%(hex)s)?::(?:%(hex)s:){3}%(ls32)s",
|
||||
# [ *2( h16 ":" ) h16 ] "::" 2( h16 ":" ) ls32
|
||||
"(?:(?:%(hex)s:){0,2}%(hex)s)?::(?:%(hex)s:){2}%(ls32)s",
|
||||
# [ *3( h16 ":" ) h16 ] "::" h16 ":" ls32
|
||||
"(?:(?:%(hex)s:){0,3}%(hex)s)?::%(hex)s:%(ls32)s",
|
||||
# [ *4( h16 ":" ) h16 ] "::" ls32
|
||||
"(?:(?:%(hex)s:){0,4}%(hex)s)?::%(ls32)s",
|
||||
# [ *5( h16 ":" ) h16 ] "::" h16
|
||||
"(?:(?:%(hex)s:){0,5}%(hex)s)?::%(hex)s",
|
||||
# [ *6( h16 ":" ) h16 ] "::"
|
||||
"(?:(?:%(hex)s:){0,6}%(hex)s)?::",
|
||||
]
|
||||
|
||||
_UNRESERVED_PAT = r"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789._\-~"
|
||||
_IPV6_PAT = "(?:" + "|".join([x % _subs for x in _variations]) + ")"
|
||||
_ZONE_ID_PAT = "(?:%25|%)(?:[" + _UNRESERVED_PAT + "]|%[a-fA-F0-9]{2})+"
|
||||
_IPV6_ADDRZ_PAT = r"\[" + _IPV6_PAT + r"(?:" + _ZONE_ID_PAT + r")?\]"
|
||||
_REG_NAME_PAT = r"(?:[^\[\]%:/?#]|%[a-fA-F0-9]{2})*"
|
||||
_TARGET_RE = re.compile(r"^(/[^?#]*)(?:\?([^#]*))?(?:#.*)?$")
|
||||
|
||||
_IPV4_RE = re.compile("^" + _IPV4_PAT + "$")
|
||||
_IPV6_RE = re.compile("^" + _IPV6_PAT + "$")
|
||||
_IPV6_ADDRZ_RE = re.compile("^" + _IPV6_ADDRZ_PAT + "$")
|
||||
_BRACELESS_IPV6_ADDRZ_RE = re.compile("^" + _IPV6_ADDRZ_PAT[2:-2] + "$")
|
||||
_ZONE_ID_RE = re.compile("(" + _ZONE_ID_PAT + r")\]$")
|
||||
|
||||
_HOST_PORT_PAT = ("^(%s|%s|%s)(?::0*?(|0|[1-9][0-9]{0,4}))?$") % (
|
||||
_REG_NAME_PAT,
|
||||
_IPV4_PAT,
|
||||
_IPV6_ADDRZ_PAT,
|
||||
)
|
||||
_HOST_PORT_RE = re.compile(_HOST_PORT_PAT, re.UNICODE | re.DOTALL)
|
||||
|
||||
_UNRESERVED_CHARS = set(
|
||||
"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789._-~"
|
||||
)
|
||||
_SUB_DELIM_CHARS = set("!$&'()*+,;=")
|
||||
_USERINFO_CHARS = _UNRESERVED_CHARS | _SUB_DELIM_CHARS | {":"}
|
||||
_PATH_CHARS = _USERINFO_CHARS | {"@", "/"}
|
||||
_QUERY_CHARS = _FRAGMENT_CHARS = _PATH_CHARS | {"?"}
|
||||
|
||||
|
||||
class Url(
|
||||
typing.NamedTuple(
|
||||
"Url",
|
||||
[
|
||||
("scheme", typing.Optional[str]),
|
||||
("auth", typing.Optional[str]),
|
||||
("host", typing.Optional[str]),
|
||||
("port", typing.Optional[int]),
|
||||
("path", typing.Optional[str]),
|
||||
("query", typing.Optional[str]),
|
||||
("fragment", typing.Optional[str]),
|
||||
],
|
||||
)
|
||||
):
|
||||
"""
|
||||
Data structure for representing an HTTP URL. Used as a return value for
|
||||
:func:`parse_url`. Both the scheme and host are normalized as they are
|
||||
both case-insensitive according to RFC 3986.
|
||||
"""
|
||||
|
||||
def __new__( # type: ignore[no-untyped-def]
|
||||
cls,
|
||||
scheme: str | None = None,
|
||||
auth: str | None = None,
|
||||
host: str | None = None,
|
||||
port: int | None = None,
|
||||
path: str | None = None,
|
||||
query: str | None = None,
|
||||
fragment: str | None = None,
|
||||
):
|
||||
if path and not path.startswith("/"):
|
||||
path = "/" + path
|
||||
if scheme is not None:
|
||||
scheme = scheme.lower()
|
||||
return super().__new__(cls, scheme, auth, host, port, path, query, fragment)
|
||||
|
||||
@property
|
||||
def hostname(self) -> str | None:
|
||||
"""For backwards-compatibility with urlparse. We're nice like that."""
|
||||
return self.host
|
||||
|
||||
@property
|
||||
def request_uri(self) -> str:
|
||||
"""Absolute path including the query string."""
|
||||
uri = self.path or "/"
|
||||
|
||||
if self.query is not None:
|
||||
uri += "?" + self.query
|
||||
|
||||
return uri
|
||||
|
||||
@property
|
||||
def authority(self) -> str | None:
|
||||
"""
|
||||
Authority component as defined in RFC 3986 3.2.
|
||||
This includes userinfo (auth), host and port.
|
||||
|
||||
i.e.
|
||||
userinfo@host:port
|
||||
"""
|
||||
userinfo = self.auth
|
||||
netloc = self.netloc
|
||||
if netloc is None or userinfo is None:
|
||||
return netloc
|
||||
else:
|
||||
return f"{userinfo}@{netloc}"
|
||||
|
||||
@property
|
||||
def netloc(self) -> str | None:
|
||||
"""
|
||||
Network location including host and port.
|
||||
|
||||
If you need the equivalent of urllib.parse's ``netloc``,
|
||||
use the ``authority`` property instead.
|
||||
"""
|
||||
if self.host is None:
|
||||
return None
|
||||
if self.port:
|
||||
return f"{self.host}:{self.port}"
|
||||
return self.host
|
||||
|
||||
@property
|
||||
def url(self) -> str:
|
||||
"""
|
||||
Convert self into a url
|
||||
|
||||
This function should more or less round-trip with :func:`.parse_url`. The
|
||||
returned url may not be exactly the same as the url inputted to
|
||||
:func:`.parse_url`, but it should be equivalent by the RFC (e.g., urls
|
||||
with a blank port will have : removed).
|
||||
|
||||
Example:
|
||||
|
||||
.. code-block:: python
|
||||
|
||||
import urllib3
|
||||
|
||||
U = urllib3.util.parse_url("https://google.com/mail/")
|
||||
|
||||
print(U.url)
|
||||
# "https://google.com/mail/"
|
||||
|
||||
print( urllib3.util.Url("https", "username:password",
|
||||
"host.com", 80, "/path", "query", "fragment"
|
||||
).url
|
||||
)
|
||||
# "https://username:password@host.com:80/path?query#fragment"
|
||||
"""
|
||||
scheme, auth, host, port, path, query, fragment = self
|
||||
url = ""
|
||||
|
||||
# We use "is not None" we want things to happen with empty strings (or 0 port)
|
||||
if scheme is not None:
|
||||
url += scheme + "://"
|
||||
if auth is not None:
|
||||
url += auth + "@"
|
||||
if host is not None:
|
||||
url += host
|
||||
if port is not None:
|
||||
url += ":" + str(port)
|
||||
if path is not None:
|
||||
url += path
|
||||
if query is not None:
|
||||
url += "?" + query
|
||||
if fragment is not None:
|
||||
url += "#" + fragment
|
||||
|
||||
return url
|
||||
|
||||
def __str__(self) -> str:
|
||||
return self.url
|
||||
|
||||
|
||||
@typing.overload
|
||||
def _encode_invalid_chars(
|
||||
component: str, allowed_chars: typing.Container[str]
|
||||
) -> str: # Abstract
|
||||
...
|
||||
|
||||
|
||||
@typing.overload
|
||||
def _encode_invalid_chars(
|
||||
component: None, allowed_chars: typing.Container[str]
|
||||
) -> None: # Abstract
|
||||
...
|
||||
|
||||
|
||||
def _encode_invalid_chars(
|
||||
component: str | None, allowed_chars: typing.Container[str]
|
||||
) -> str | None:
|
||||
"""Percent-encodes a URI component without reapplying
|
||||
onto an already percent-encoded component.
|
||||
"""
|
||||
if component is None:
|
||||
return component
|
||||
|
||||
component = to_str(component)
|
||||
|
||||
# Normalize existing percent-encoded bytes.
|
||||
# Try to see if the component we're encoding is already percent-encoded
|
||||
# so we can skip all '%' characters but still encode all others.
|
||||
component, percent_encodings = _PERCENT_RE.subn(
|
||||
lambda match: match.group(0).upper(), component
|
||||
)
|
||||
|
||||
uri_bytes = component.encode("utf-8", "surrogatepass")
|
||||
is_percent_encoded = percent_encodings == uri_bytes.count(b"%")
|
||||
encoded_component = bytearray()
|
||||
|
||||
for i in range(0, len(uri_bytes)):
|
||||
# Will return a single character bytestring
|
||||
byte = uri_bytes[i : i + 1]
|
||||
byte_ord = ord(byte)
|
||||
if (is_percent_encoded and byte == b"%") or (
|
||||
byte_ord < 128 and byte.decode() in allowed_chars
|
||||
):
|
||||
encoded_component += byte
|
||||
continue
|
||||
encoded_component.extend(b"%" + (hex(byte_ord)[2:].encode().zfill(2).upper()))
|
||||
|
||||
return encoded_component.decode()
|
||||
|
||||
|
||||
def _remove_path_dot_segments(path: str) -> str:
|
||||
# See http://tools.ietf.org/html/rfc3986#section-5.2.4 for pseudo-code
|
||||
segments = path.split("/") # Turn the path into a list of segments
|
||||
output = [] # Initialize the variable to use to store output
|
||||
|
||||
for segment in segments:
|
||||
# '.' is the current directory, so ignore it, it is superfluous
|
||||
if segment == ".":
|
||||
continue
|
||||
# Anything other than '..', should be appended to the output
|
||||
if segment != "..":
|
||||
output.append(segment)
|
||||
# In this case segment == '..', if we can, we should pop the last
|
||||
# element
|
||||
elif output:
|
||||
output.pop()
|
||||
|
||||
# If the path starts with '/' and the output is empty or the first string
|
||||
# is non-empty
|
||||
if path.startswith("/") and (not output or output[0]):
|
||||
output.insert(0, "")
|
||||
|
||||
# If the path starts with '/.' or '/..' ensure we add one more empty
|
||||
# string to add a trailing '/'
|
||||
if path.endswith(("/.", "/..")):
|
||||
output.append("")
|
||||
|
||||
return "/".join(output)
|
||||
|
||||
|
||||
@typing.overload
|
||||
def _normalize_host(host: None, scheme: str | None) -> None: ...
|
||||
|
||||
|
||||
@typing.overload
|
||||
def _normalize_host(host: str, scheme: str | None) -> str: ...
|
||||
|
||||
|
||||
def _normalize_host(host: str | None, scheme: str | None) -> str | None:
|
||||
if host:
|
||||
if scheme in _NORMALIZABLE_SCHEMES:
|
||||
is_ipv6 = _IPV6_ADDRZ_RE.match(host)
|
||||
if is_ipv6:
|
||||
# IPv6 hosts of the form 'a::b%zone' are encoded in a URL as
|
||||
# such per RFC 6874: 'a::b%25zone'. Unquote the ZoneID
|
||||
# separator as necessary to return a valid RFC 4007 scoped IP.
|
||||
match = _ZONE_ID_RE.search(host)
|
||||
if match:
|
||||
start, end = match.span(1)
|
||||
zone_id = host[start:end]
|
||||
|
||||
if zone_id.startswith("%25") and zone_id != "%25":
|
||||
zone_id = zone_id[3:]
|
||||
else:
|
||||
zone_id = zone_id[1:]
|
||||
zone_id = _encode_invalid_chars(zone_id, _UNRESERVED_CHARS)
|
||||
return f"{host[:start].lower()}%{zone_id}{host[end:]}"
|
||||
else:
|
||||
return host.lower()
|
||||
elif not _IPV4_RE.match(host):
|
||||
return to_str(
|
||||
b".".join([_idna_encode(label) for label in host.split(".")]),
|
||||
"ascii",
|
||||
)
|
||||
return host
|
||||
|
||||
|
||||
def _idna_encode(name: str) -> bytes:
|
||||
if not name.isascii():
|
||||
try:
|
||||
import idna
|
||||
except ImportError:
|
||||
raise LocationParseError(
|
||||
"Unable to parse URL without the 'idna' module"
|
||||
) from None
|
||||
|
||||
try:
|
||||
return idna.encode(name.lower(), strict=True, std3_rules=True)
|
||||
except idna.IDNAError:
|
||||
raise LocationParseError(
|
||||
f"Name '{name}' is not a valid IDNA label"
|
||||
) from None
|
||||
|
||||
return name.lower().encode("ascii")
|
||||
|
||||
|
||||
def _encode_target(target: str) -> str:
|
||||
"""Percent-encodes a request target so that there are no invalid characters
|
||||
|
||||
Pre-condition for this function is that 'target' must start with '/'.
|
||||
If that is the case then _TARGET_RE will always produce a match.
|
||||
"""
|
||||
match = _TARGET_RE.match(target)
|
||||
if not match: # Defensive:
|
||||
raise LocationParseError(f"{target!r} is not a valid request URI")
|
||||
|
||||
path, query = match.groups()
|
||||
encoded_target = _encode_invalid_chars(path, _PATH_CHARS)
|
||||
if query is not None:
|
||||
query = _encode_invalid_chars(query, _QUERY_CHARS)
|
||||
encoded_target += "?" + query
|
||||
return encoded_target
|
||||
|
||||
|
||||
def parse_url(url: str) -> Url:
|
||||
"""
|
||||
Given a url, return a parsed :class:`.Url` namedtuple. Best-effort is
|
||||
performed to parse incomplete urls. Fields not provided will be None.
|
||||
This parser is RFC 3986 and RFC 6874 compliant.
|
||||
|
||||
The parser logic and helper functions are based heavily on
|
||||
work done in the ``rfc3986`` module.
|
||||
|
||||
:param str url: URL to parse into a :class:`.Url` namedtuple.
|
||||
|
||||
Partly backwards-compatible with :mod:`urllib.parse`.
|
||||
|
||||
Example:
|
||||
|
||||
.. code-block:: python
|
||||
|
||||
import urllib3
|
||||
|
||||
print( urllib3.util.parse_url('http://google.com/mail/'))
|
||||
# Url(scheme='http', host='google.com', port=None, path='/mail/', ...)
|
||||
|
||||
print( urllib3.util.parse_url('google.com:80'))
|
||||
# Url(scheme=None, host='google.com', port=80, path=None, ...)
|
||||
|
||||
print( urllib3.util.parse_url('/foo?bar'))
|
||||
# Url(scheme=None, host=None, port=None, path='/foo', query='bar', ...)
|
||||
"""
|
||||
if not url:
|
||||
# Empty
|
||||
return Url()
|
||||
|
||||
source_url = url
|
||||
if not _SCHEME_RE.search(url):
|
||||
url = "//" + url
|
||||
|
||||
scheme: str | None
|
||||
authority: str | None
|
||||
auth: str | None
|
||||
host: str | None
|
||||
port: str | None
|
||||
port_int: int | None
|
||||
path: str | None
|
||||
query: str | None
|
||||
fragment: str | None
|
||||
|
||||
try:
|
||||
scheme, authority, path, query, fragment = _URI_RE.match(url).groups() # type: ignore[union-attr]
|
||||
normalize_uri = scheme is None or scheme.lower() in _NORMALIZABLE_SCHEMES
|
||||
|
||||
if scheme:
|
||||
scheme = scheme.lower()
|
||||
|
||||
if authority:
|
||||
auth, _, host_port = authority.rpartition("@")
|
||||
auth = auth or None
|
||||
host, port = _HOST_PORT_RE.match(host_port).groups() # type: ignore[union-attr]
|
||||
if auth and normalize_uri:
|
||||
auth = _encode_invalid_chars(auth, _USERINFO_CHARS)
|
||||
if port == "":
|
||||
port = None
|
||||
else:
|
||||
auth, host, port = None, None, None
|
||||
|
||||
if port is not None:
|
||||
port_int = int(port)
|
||||
if not (0 <= port_int <= 65535):
|
||||
raise LocationParseError(url)
|
||||
else:
|
||||
port_int = None
|
||||
|
||||
host = _normalize_host(host, scheme)
|
||||
|
||||
if normalize_uri and path:
|
||||
path = _remove_path_dot_segments(path)
|
||||
path = _encode_invalid_chars(path, _PATH_CHARS)
|
||||
if normalize_uri and query:
|
||||
query = _encode_invalid_chars(query, _QUERY_CHARS)
|
||||
if normalize_uri and fragment:
|
||||
fragment = _encode_invalid_chars(fragment, _FRAGMENT_CHARS)
|
||||
|
||||
except (ValueError, AttributeError) as e:
|
||||
raise LocationParseError(source_url) from e
|
||||
|
||||
# For the sake of backwards compatibility we put empty
|
||||
# string values for path if there are any defined values
|
||||
# beyond the path in the URL.
|
||||
# TODO: Remove this when we break backwards compatibility.
|
||||
if not path:
|
||||
if query is not None or fragment is not None:
|
||||
path = ""
|
||||
else:
|
||||
path = None
|
||||
|
||||
return Url(
|
||||
scheme=scheme,
|
||||
auth=auth,
|
||||
host=host,
|
||||
port=port_int,
|
||||
path=path,
|
||||
query=query,
|
||||
fragment=fragment,
|
||||
)
|
||||
@@ -0,0 +1,42 @@
|
||||
from __future__ import annotations
|
||||
|
||||
import typing
|
||||
from types import TracebackType
|
||||
|
||||
|
||||
def to_bytes(
|
||||
x: str | bytes, encoding: str | None = None, errors: str | None = None
|
||||
) -> bytes:
|
||||
if isinstance(x, bytes):
|
||||
return x
|
||||
elif not isinstance(x, str):
|
||||
raise TypeError(f"not expecting type {type(x).__name__}")
|
||||
if encoding or errors:
|
||||
return x.encode(encoding or "utf-8", errors=errors or "strict")
|
||||
return x.encode()
|
||||
|
||||
|
||||
def to_str(
|
||||
x: str | bytes, encoding: str | None = None, errors: str | None = None
|
||||
) -> str:
|
||||
if isinstance(x, str):
|
||||
return x
|
||||
elif not isinstance(x, bytes):
|
||||
raise TypeError(f"not expecting type {type(x).__name__}")
|
||||
if encoding or errors:
|
||||
return x.decode(encoding or "utf-8", errors=errors or "strict")
|
||||
return x.decode()
|
||||
|
||||
|
||||
def reraise(
|
||||
tp: type[BaseException] | None,
|
||||
value: BaseException,
|
||||
tb: TracebackType | None = None,
|
||||
) -> typing.NoReturn:
|
||||
try:
|
||||
if value.__traceback__ is not tb:
|
||||
raise value.with_traceback(tb)
|
||||
raise value
|
||||
finally:
|
||||
value = None # type: ignore[assignment]
|
||||
tb = None
|
||||
124
path/to/venv/lib/python3.12/site-packages/urllib3/util/wait.py
Normal file
124
path/to/venv/lib/python3.12/site-packages/urllib3/util/wait.py
Normal file
@@ -0,0 +1,124 @@
|
||||
from __future__ import annotations
|
||||
|
||||
import select
|
||||
import socket
|
||||
from functools import partial
|
||||
|
||||
__all__ = ["wait_for_read", "wait_for_write"]
|
||||
|
||||
|
||||
# How should we wait on sockets?
|
||||
#
|
||||
# There are two types of APIs you can use for waiting on sockets: the fancy
|
||||
# modern stateful APIs like epoll/kqueue, and the older stateless APIs like
|
||||
# select/poll. The stateful APIs are more efficient when you have a lots of
|
||||
# sockets to keep track of, because you can set them up once and then use them
|
||||
# lots of times. But we only ever want to wait on a single socket at a time
|
||||
# and don't want to keep track of state, so the stateless APIs are actually
|
||||
# more efficient. So we want to use select() or poll().
|
||||
#
|
||||
# Now, how do we choose between select() and poll()? On traditional Unixes,
|
||||
# select() has a strange calling convention that makes it slow, or fail
|
||||
# altogether, for high-numbered file descriptors. The point of poll() is to fix
|
||||
# that, so on Unixes, we prefer poll().
|
||||
#
|
||||
# On Windows, there is no poll() (or at least Python doesn't provide a wrapper
|
||||
# for it), but that's OK, because on Windows, select() doesn't have this
|
||||
# strange calling convention; plain select() works fine.
|
||||
#
|
||||
# So: on Windows we use select(), and everywhere else we use poll(). We also
|
||||
# fall back to select() in case poll() is somehow broken or missing.
|
||||
|
||||
|
||||
def select_wait_for_socket(
|
||||
sock: socket.socket,
|
||||
read: bool = False,
|
||||
write: bool = False,
|
||||
timeout: float | None = None,
|
||||
) -> bool:
|
||||
if not read and not write:
|
||||
raise RuntimeError("must specify at least one of read=True, write=True")
|
||||
rcheck = []
|
||||
wcheck = []
|
||||
if read:
|
||||
rcheck.append(sock)
|
||||
if write:
|
||||
wcheck.append(sock)
|
||||
# When doing a non-blocking connect, most systems signal success by
|
||||
# marking the socket writable. Windows, though, signals success by marked
|
||||
# it as "exceptional". We paper over the difference by checking the write
|
||||
# sockets for both conditions. (The stdlib selectors module does the same
|
||||
# thing.)
|
||||
fn = partial(select.select, rcheck, wcheck, wcheck)
|
||||
rready, wready, xready = fn(timeout)
|
||||
return bool(rready or wready or xready)
|
||||
|
||||
|
||||
def poll_wait_for_socket(
|
||||
sock: socket.socket,
|
||||
read: bool = False,
|
||||
write: bool = False,
|
||||
timeout: float | None = None,
|
||||
) -> bool:
|
||||
if not read and not write:
|
||||
raise RuntimeError("must specify at least one of read=True, write=True")
|
||||
mask = 0
|
||||
if read:
|
||||
mask |= select.POLLIN
|
||||
if write:
|
||||
mask |= select.POLLOUT
|
||||
poll_obj = select.poll()
|
||||
poll_obj.register(sock, mask)
|
||||
|
||||
# For some reason, poll() takes timeout in milliseconds
|
||||
def do_poll(t: float | None) -> list[tuple[int, int]]:
|
||||
if t is not None:
|
||||
t *= 1000
|
||||
return poll_obj.poll(t)
|
||||
|
||||
return bool(do_poll(timeout))
|
||||
|
||||
|
||||
def _have_working_poll() -> bool:
|
||||
# Apparently some systems have a select.poll that fails as soon as you try
|
||||
# to use it, either due to strange configuration or broken monkeypatching
|
||||
# from libraries like eventlet/greenlet.
|
||||
try:
|
||||
poll_obj = select.poll()
|
||||
poll_obj.poll(0)
|
||||
except (AttributeError, OSError):
|
||||
return False
|
||||
else:
|
||||
return True
|
||||
|
||||
|
||||
def wait_for_socket(
|
||||
sock: socket.socket,
|
||||
read: bool = False,
|
||||
write: bool = False,
|
||||
timeout: float | None = None,
|
||||
) -> bool:
|
||||
# We delay choosing which implementation to use until the first time we're
|
||||
# called. We could do it at import time, but then we might make the wrong
|
||||
# decision if someone goes wild with monkeypatching select.poll after
|
||||
# we're imported.
|
||||
global wait_for_socket
|
||||
if _have_working_poll():
|
||||
wait_for_socket = poll_wait_for_socket
|
||||
elif hasattr(select, "select"):
|
||||
wait_for_socket = select_wait_for_socket
|
||||
return wait_for_socket(sock, read, write, timeout)
|
||||
|
||||
|
||||
def wait_for_read(sock: socket.socket, timeout: float | None = None) -> bool:
|
||||
"""Waits for reading to be available on a given socket.
|
||||
Returns True if the socket is readable, or False if the timeout expired.
|
||||
"""
|
||||
return wait_for_socket(sock, read=True, timeout=timeout)
|
||||
|
||||
|
||||
def wait_for_write(sock: socket.socket, timeout: float | None = None) -> bool:
|
||||
"""Waits for writing to be available on a given socket.
|
||||
Returns True if the socket is readable, or False if the timeout expired.
|
||||
"""
|
||||
return wait_for_socket(sock, write=True, timeout=timeout)
|
||||
Reference in New Issue
Block a user